import java.util.*; import java.util.zip.*; import java.util.List; import java.util.regex.*; import java.util.concurrent.*; import java.util.concurrent.atomic.*; import java.util.concurrent.locks.*; import java.util.function.*; import javax.swing.*; import javax.swing.event.*; import javax.swing.text.*; import javax.swing.table.*; import java.io.*; import java.net.*; import java.lang.reflect.*; import java.lang.ref.*; import java.lang.management.*; import java.security.*; import java.security.spec.*; import java.awt.*; import java.awt.event.*; import java.awt.image.*; import java.awt.geom.*; import javax.imageio.*; import java.math.*; import java.time.Duration; import java.lang.invoke.VarHandle; import java.lang.invoke.MethodHandles; // VectorSSI - SSI with straight line segments import static x30_pkg.x30_util.DynamicObject; import java.awt.geom.*; import java.text.*; import java.text.NumberFormat; import java.util.TimeZone; class main { static class VectorSSI extends AbstractSSI { VectorSSI() {} // core values (mandatory): first column and row occupied final public VectorSSI setX1(short x1){ return x1(x1); } public VectorSSI x1(short x1) { this.x1 = x1; return this; } final public short getX1(){ return x1(); } public short x1() { return x1; } short x1; final public VectorSSI setY1(short y1){ return y1(y1); } public VectorSSI y1(short y1) { this.y1 = y1; return this; } final public short getY1(){ return y1(); } public short y1() { return y1; } short y1; // Curves of x start and x end, relative to (x1, y1) // Both have same length final public VectorSSI setLeftCurve(InterpolatedDoubleArray leftCurve){ return leftCurve(leftCurve); } public VectorSSI leftCurve(InterpolatedDoubleArray leftCurve) { this.leftCurve = leftCurve; return this; } final public InterpolatedDoubleArray getLeftCurve(){ return leftCurve(); } public InterpolatedDoubleArray leftCurve() { return leftCurve; } InterpolatedDoubleArray leftCurve; final public VectorSSI setRightCurve(InterpolatedDoubleArray rightCurve){ return rightCurve(rightCurve); } public VectorSSI rightCurve(InterpolatedDoubleArray rightCurve) { this.rightCurve = rightCurve; return this; } final public InterpolatedDoubleArray getRightCurve(){ return rightCurve(); } public InterpolatedDoubleArray rightCurve() { return rightCurve; } InterpolatedDoubleArray rightCurve; VectorSSI(SSI ssi) { ssi.copyAbstractSSI(this); Rect r = ssi.bounds(); x1(toShort_enforce(r.x1())); y1(toShort_enforce(r.y1())); int h = r.h(); int[] left = new int[h], right = new int[h]; for (int y = 0; y < h; y++) { left[y] = ssi.getLeft(y1+y)-x1; right[y] = ssi.getRight(y1+y)-x1; } leftCurve(new CompressToInterpolatedDoubleArray(left).get()); rightCurve(new CompressToInterpolatedDoubleArray(right).get()); } final public int h(){ return height(); } public int height() { return leftCurve.length(); } int y2() { return y1+h(); } final SSI get(){ return toSSI(); } SSI toSSI() { int h = h(); var ssi = new SSI(y1, y2()); copyAbstractSSI(ssi); int[] left = leftCurve.rounded(); int[] right = rightCurve.rounded(); for (int y = 0; y < h; y++) ssi.set(y1+y, x1+left[y], x1+right[y]); return ssi; } public void drawOn(Graphics2D g) { toSSI().drawOn(g); } // How many points define the shape of this vector SSI // (left + right border) int nPoints() { return leftCurve.nPillars() + rightCurve.nPillars(); } public long sizeInInts() { // "v", color, x1, y1, height(), leftCurve, rightCurve return 5+leftCurve.nInts/*_withoutFirstAndLastIndex*/()+rightCurve.nInts/*_withoutFirstAndLastIndex*/(); } // TODO /*VectorSSI reduceToInts(int ints) { ints -= 5; // constant part int nPillars = ints/2; // max pillars we can afford (left+right) }*/ // optimizable public Rect bounds_cache; public Rect bounds() { if (bounds_cache == null) bounds_cache = bounds_load(); return bounds_cache;} public Rect bounds_load() { return toSSI().bounds(); } public Integer numberOfPixels_cache; public int numberOfPixels() { if (numberOfPixels_cache == null) numberOfPixels_cache = numberOfPixels_load(); return numberOfPixels_cache;} public Integer numberOfPixels_load() { return toSSI().numberOfPixels(); } public void readWrite(StringHead head) { head.exchangeLine(() -> toLine(), __1 -> fromLine(__1)); } String toLine() { List elements = ll("v", colorToString(), x1, y1, height()); addAll(elements, asList(iroundAll(leftCurve.indicesAndValues/*_withoutFirstAndLastIndex*/()))); addAll(elements, asList(iroundAll(rightCurve.indicesAndValues/*_withoutFirstAndLastIndex*/()))); return spaceCombine(elements); } void fromLine(String line) { Iterator it = splitAtSpaceIterator(line); assertEquals("v", nextFromIterator(it)); x1 = toShort_enforce(parseInt(nextFromIterator(it))); y1 = toShort_enforce(parseInt(nextFromIterator(it))); // TODO /*int h = parseInt(nextFromIterator(it)); init(y1, y1+h); for i over data: data[i] = toX(parseInt(nextFromIterator(it)));*/ } } static short toShort_enforce(long l) { if (l != (short) l) throw fail("Too large for short: " + l); return (short) l; } static int y2(Rectangle r) { return r.y+r.height; } static List ll(A... a) { ArrayList l = new ArrayList(a.length); if (a != null) for (A x : a) l.add(x); return l; } static void addAll(Collection c, Iterable b) { if (c != null && b != null) for (A a : b) c.add(a); } static boolean addAll(Collection c, Collection b) { return c != null && b != null && c.addAll(b); } static boolean addAll(Collection c, B... b) { return c != null && b != null && c.addAll(Arrays.asList(b)); } static Map addAll(Map a, Map b) { if (a != null && b != null) a.putAll(b); return a; } static A addAll(A c, Collection components) { return addComponents(c, components); } static A addAll(A c, Component... components) { return addComponents(c, components); } // unclear semantics as to whether return null on null static ArrayList asList(A[] a) { return a == null ? new ArrayList() : new ArrayList(Arrays.asList(a)); } static ArrayList asList(int[] a) { if (a == null) return null; ArrayList l = emptyList(a.length); for (int i : a) l.add(i); return l; } static ArrayList asList(long[] a) { if (a == null) return null; ArrayList l = emptyList(a.length); for (long i : a) l.add(i); return l; } static ArrayList asList(float[] a) { if (a == null) return null; ArrayList l = emptyList(a.length); for (float i : a) l.add(i); return l; } static ArrayList asList(double[] a) { if (a == null) return null; ArrayList l = emptyList(a.length); for (double i : a) l.add(i); return l; } static ArrayList asList(short[] a) { if (a == null) return null; ArrayList l = emptyList(a.length); for (short i : a) l.add(i); return l; } static ArrayList asList(Iterator it) { ArrayList l = new ArrayList(); if (it != null) while (it.hasNext()) l.add(it.next()); return l; } // disambiguation static ArrayList asList(IterableIterator s) { return asList((Iterator) s); } static ArrayList asList(Iterable s) { if (s instanceof ArrayList) return (ArrayList) s; ArrayList l = new ArrayList(); if (s != null) for (A a : s) l.add(a); return l; } static ArrayList asList(Producer p) { ArrayList l = new ArrayList(); A a; if (p != null) while ((a = p.next()) != null) l.add(a); return l; } static ArrayList asList(Enumeration e) { ArrayList l = new ArrayList(); if (e != null) while (e.hasMoreElements()) l.add(e.nextElement()); return l; } static ArrayList asList(ReverseChain c) { return c == null ? emptyList() : c.toList(); } static List asList(Pair p) { return p == null ? null : ll(p.a, p.b); } static int[] iroundAll(double[] a, int start, int end) { return iroundDoubleArray(a, start, end); } static int[] iroundAll(double[] a) { return iroundDoubleArray(a); } static String spaceCombine(Object... l) { return joinNemptiesWithSpace(flattenCollections(ll(l))); } static IterableIterator splitAtSpaceIterator(String s) { return iff_null(new IF0() { int i = 0, l = l(s); public String get() { // skip space(s) while (i < l) { if (isSpaceEtc(s.charAt(i))) ++i; else break; } if (i >= l) return null; int j = i; // scan for non-whitespace while (j < l && !isSpaceEtc(s.charAt(j))) ++j; String part = substring(s, i, j); i = j; return part; } }); } static A assertEquals(Object x, A y) { return assertEquals("", x, y); } static A assertEquals(String msg, Object x, A y) { if (assertVerbose()) return assertEqualsVerbose(msg, x, y); if (!(x == null ? y == null : x.equals(y))) throw fail((msg != null ? msg + ": " : "") + y + " != " + x); return y; } static A nextFromIterator(Iterator it) { return it == null || !it.hasNext() ? null : it.next(); } static int parseInt(String s) { return emptyString(s) ? 0 : Integer.parseInt(s); } static int parseInt(char c) { return Integer.parseInt(str(c)); } static RuntimeException fail() { throw new RuntimeException("fail"); } static RuntimeException fail(Throwable e) { throw asRuntimeException(e); } static RuntimeException fail(Object msg) { throw new RuntimeException(String.valueOf(msg)); } static RuntimeException fail(Object... objects) { throw new Fail(objects); } static RuntimeException fail(String msg) { throw new RuntimeException(msg == null ? "" : msg); } static RuntimeException fail(String msg, Throwable innerException) { throw new RuntimeException(msg, innerException); } static A addComponents(A c, Collection components) { if (nempty(components)) { swing(() -> { for (Component comp : components) if (comp != null) c.add(comp); revalidate(c); }); } return c; } static A addComponents(A c, Component... components) { return addComponents(c, asList(components)); } static ArrayList emptyList() { return new ArrayList(); //ret Collections.emptyList(); } static ArrayList emptyList(int capacity) { return new ArrayList(max(0, capacity)); } // Try to match capacity static ArrayList emptyList(Iterable l) { return l instanceof Collection ? emptyList(((Collection) l).size()) : emptyList(); } static ArrayList emptyList(Object[] l) { return emptyList(l(l)); } // get correct type at once static ArrayList emptyList(Class c) { return new ArrayList(); } static int[] iroundDoubleArray(double[] a, int start, int end) { int[] b = new int[end-start]; for (int i = start; i < end; i++) b[i-start] = iround(a[i]); return b; } static int[] iroundDoubleArray(double[] a) { return a == null ? null : iroundDoubleArray(a, 0, a.length); } static String joinNemptiesWithSpace(String... strings) { return joinNempties(" ", strings); } static String joinNemptiesWithSpace(Collection strings) { return joinNempties(" ", strings); } static List flattenCollections(Iterable a) { List l = new ArrayList(); for (Object x : a) if (x instanceof Collection) l.addAll(flattenCollections((Collection) x)); else l.add(x); return l; } // f: func -> A (stream ends when f returns null) static IterableIterator iff_null(final Object f) { return iteratorFromFunction(f); } static IterableIterator iff_null(F0 f) { return iteratorFromFunction(f); } static IterableIterator iff_null(IF0 f) { return iteratorFromFunction(f); } static int l(Object[] a) { return a == null ? 0 : a.length; } static int l(boolean[] a) { return a == null ? 0 : a.length; } static int l(byte[] a) { return a == null ? 0 : a.length; } static int l(short[] a) { return a == null ? 0 : a.length; } static int l(long[] a) { return a == null ? 0 : a.length; } static int l(int[] a) { return a == null ? 0 : a.length; } static int l(float[] a) { return a == null ? 0 : a.length; } static int l(double[] a) { return a == null ? 0 : a.length; } static int l(char[] a) { return a == null ? 0 : a.length; } static int l(Collection c) { return c == null ? 0 : c.size(); } static int l(Iterator i) { return iteratorCount_int_close(i); } // consumes the iterator && closes it if possible static int l(Map m) { return m == null ? 0 : m.size(); } static int l(CharSequence s) { return s == null ? 0 : s.length(); } static long l(File f) { return f == null ? 0 : f.length(); } static int l(IMultiMap mm) { return mm == null ? 0 : mm.size(); } static int l(IntRange r) { return r == null ? 0 : r.length(); } static double l(DoubleRange r) { return r == null ? 0 : r.length(); } static int l(IntBuffer b) { return b == null ? 0 : b.size(); } static int l(IntSize o) { return o == null ? 0 : o.size(); } static boolean isSpaceEtc(char c) { return c == ' ' || c == '\t' || c == '\r' || c == '\n'; } static String substring(String s, int x) { return substring(s, x, strL(s)); } static String substring(String s, int x, int y) { if (s == null) return null; if (x < 0) x = 0; int n = s.length(); if (y < x) y = x; if (y > n) y = n; if (x >= y) return ""; return s.substring(x, y); } static String substring(String s, IntRange r) { return r == null ? null : substring(s, r.start, r.end); } // convenience method for quickly dropping a prefix static String substring(String s, CharSequence l) { return substring(s, lCharSequence(l)); } static ThreadLocal assertVerbose_value = new ThreadLocal(); static void assertVerbose(boolean b) { assertVerbose_value.set(b); } static boolean assertVerbose() { return isTrue(assertVerbose_value.get()); } static A assertEqualsVerbose(Object x, A y) { assertEqualsVerbose((String) null, x, y); return y; } // x = expected, y = actual static A assertEqualsVerbose(String msg, Object x, A y) { if (!eq(x, y)) { throw fail((nempty(msg) ? msg + ": " : "") + "expected: "+ x + ", got: " + y); } else print("OK" + (empty(msg) ? "" : " " + msg) + ": " + /*sfu*/(x)); return y; } static boolean eq(Object a, Object b) { return a == b || a != null && b != null && a.equals(b); } // a little kludge for stuff like eq(symbol, "$X") static boolean eq(Symbol a, String b) { return eq(str(a), b); } static String nullIfEmpty(String s) { return isEmpty(s) ? null : s; } static Map nullIfEmpty(Map map) { return isEmpty(map) ? null : map; } static List nullIfEmpty(List l) { return isEmpty(l) ? null : l; } static boolean emptyString(String s) { return s == null || s.length() == 0; } static String str(Object o) { return o == null ? "null" : o.toString(); } static String str(char[] c) { return new String(c); } static String str(char[] c, int offset, int count) { return new String(c, offset, count); } static RuntimeException asRuntimeException(Throwable t) { if (t instanceof Error) _handleError((Error) t); return t instanceof RuntimeException ? (RuntimeException) t : new RuntimeException(t); } static boolean nempty(Collection c) { return !empty(c); } static boolean nempty(CharSequence s) { return !empty(s); } static boolean nempty(Object[] o) { return !empty(o); } static boolean nempty(byte[] o) { return !empty(o); } static boolean nempty(int[] o) { return !empty(o); } static boolean nempty(BitSet bs) { return !empty(bs); } static boolean nempty(Map m) { return !empty(m); } static boolean nempty(Iterator i) { return i != null && i.hasNext(); } static boolean nempty(IMultiMap mm) { return mm != null && mm.size() != 0; } static boolean nempty(Object o) { return !empty(o); } static boolean nempty(IntRange r) { return !empty(r); } static boolean nempty(IntBuffer b) { return b != null && !b.isEmpty(); } static boolean nempty(Rect r) { return r != null && r.w != 0 && r.h != 0; } static Object swing(Object f) { return swingAndWait(f); } static void swing(Runnable f) { swingAndWait(f); } static A swing(F0 f) { return (A) swingAndWait(f); } static A swing(IF0 f) { return (A) swingAndWait(f); } static A revalidate(final A c) { if (c == null || !c.isShowing()) return c; { swing(() -> { // magic combo to actually relayout and repaint c.revalidate(); c.repaint(); }); } return c; } static void revalidate(JFrame f) { revalidate((Component) f); } static void revalidate(JInternalFrame f) { revalidate((Component) f); } static int max(int a, int b) { return Math.max(a, b); } static int max(int a, int b, int c) { return max(max(a, b), c); } static long max(int a, long b) { return Math.max((long) a, b); } static long max(long a, long b) { return Math.max(a, b); } static double max(int a, double b) { return Math.max((double) a, b); } static float max(float a, float b) { return Math.max(a, b); } static double max(double a, double b) { return Math.max(a, b); } static > A max (Iterable l) { A max = null; var it = iterator(l); if (it.hasNext()) { max = it.next(); while (it.hasNext()) { A a = it.next(); if (cmp(a, max) > 0) max = a; } } return max; } /*Nah. static int max(Collection c) { int x = Integer.MIN_VALUE; for (int i : c) x = max(x, i); ret x; }*/ static double max(double[] c) { if (c.length == 0) return Double.MIN_VALUE; double x = c[0]; for (int i = 1; i < c.length; i++) x = Math.max(x, c[i]); return x; } static float max(float[] c) { if (c.length == 0) return Float.MAX_VALUE; float x = c[0]; for (int i = 1; i < c.length; i++) x = Math.max(x, c[i]); return x; } static byte max(byte[] c) { byte x = -128; for (byte d : c) if (d > x) x = d; return x; } static short max(short[] c) { short x = -0x8000; for (short d : c) if (d > x) x = d; return x; } static int max(int[] c) { int x = Integer.MIN_VALUE; for (int d : c) if (d > x) x = d; return x; } static > A max(A a, A b) { return cmp(a, b) >= 0 ? a : b; } static int iround(double d) { return (int) Math.round(d); } static int iround(Number n) { return iround(toDouble(n)); } static String joinNempties(String sep, Object... strings) { return joinStrings(sep, strings); } static String joinNempties(String sep, Iterable strings) { return joinStrings(sep, strings); } // f: func -> A (stream ends when f returns null) static IterableIterator iteratorFromFunction(final Object f) { class IFF extends IterableIterator { A a; boolean done = false; public boolean hasNext() { getNext(); return !done; } public A next() { getNext(); if (done) throw fail(); A _a = a; a = null; return _a; } void getNext() { if (done || a != null) return; a = (A) callF(f); done = a == null; } }; return new IFF(); } // optimized version for F0 argument static IterableIterator iteratorFromFunction(F0 f) { return iteratorFromFunction_f0(f); } static IterableIterator iteratorFromFunction(IF0 f) { return iteratorFromFunction_if0(f); } static int iteratorCount_int_close(Iterator i) { try { int n = 0; if (i != null) while (i.hasNext()) { i.next(); ++n; } if (i instanceof AutoCloseable) ((AutoCloseable) i).close(); return n; } catch (Exception __e) { throw rethrow(__e); } } static int strL(String s) { return s == null ? 0 : s.length(); } static int lCharSequence(CharSequence s) { return s == null ? 0 : s.length(); } static boolean isTrue(Object o) { if (o instanceof Boolean) return ((Boolean) o).booleanValue(); if (o == null) return false; if (o instanceof ThreadLocal) // TODO: remove this return isTrue(((ThreadLocal) o).get()); throw fail(getClassName(o)); } static boolean isTrue(Boolean b) { return b != null && b.booleanValue(); } static volatile StringBuffer local_log = new StringBuffer(); // not redirected static boolean printAlsoToSystemOut = true; static volatile Appendable print_log = local_log; // might be redirected, e.g. to main bot // in bytes - will cut to half that static volatile int print_log_max = 1024*1024; static volatile int local_log_max = 100*1024; static boolean print_silent = false; // total mute if set static Object print_byThread_lock = new Object(); static volatile ThreadLocal print_byThread; // special handling by thread - prefers F1 static volatile Object print_allThreads; static volatile Object print_preprocess; static void print() { print(""); } static A print(String s, A o) { print(combinePrintParameters(s, o)); return o; } // slightly overblown signature to return original object... static A print(A o) { ping_okInCleanUp(); if (print_silent) return o; String s = o + "\n"; print_noNewLine(s); return o; } static void print_noNewLine(String s) { try { Object f = getThreadLocal(print_byThread_dontCreate()); if (f == null) f = print_allThreads; if (f != null) // We do need the general callF machinery here as print_byThread is sometimes shared between modules if (isFalse( f instanceof F1 ? ((F1) f).get(s) : callF(f, s))) return; } catch (Throwable e) { System.out.println(getStackTrace(e)); } print_raw(s); } static void print_raw(String s) { if (print_preprocess != null) s = (String) callF(print_preprocess, s); s = fixNewLines(s); Appendable loc = local_log; Appendable buf = print_log; int loc_max = print_log_max; if (buf != loc && buf != null) { print_append(buf, s, print_log_max); loc_max = local_log_max; } if (loc != null) print_append(loc, s, loc_max); if (printAlsoToSystemOut) System.out.print(s); vmBus_send("printed", mc(), s); } static void print_autoRotate() { } static boolean empty(Collection c) { return c == null || c.isEmpty(); } static boolean empty(Iterable c) { return c == null || !c.iterator().hasNext(); } static boolean empty(CharSequence s) { return s == null || s.length() == 0; } static boolean empty(Map map) { return map == null || map.isEmpty(); } static boolean empty(Object[] o) { return o == null || o.length == 0; } static boolean empty(BitSet bs) { return bs == null || bs.isEmpty(); } static boolean empty(Object o) { if (o instanceof Collection) return empty((Collection) o); if (o instanceof String) return empty((String) o); if (o instanceof Map) return empty((Map) o); if (o instanceof Object[]) return empty((Object[]) o); if (o instanceof byte[]) return empty((byte[]) o); if (o == null) return true; throw fail("unknown type for 'empty': " + getType(o)); } static boolean empty(Iterator i) { return i == null || !i.hasNext(); } static boolean empty(double[] a) { return a == null || a.length == 0; } static boolean empty(float[] a) { return a == null || a.length == 0; } static boolean empty(int[] a) { return a == null || a.length == 0; } static boolean empty(long[] a) { return a == null || a.length == 0; } static boolean empty(byte[] a) { return a == null || a.length == 0; } static boolean empty(short[] a) { return a == null || a.length == 0; } static boolean empty(IMultiMap mm) { return mm == null || mm.size() == 0; } static boolean empty(File f) { return getFileSize(f) == 0; } static boolean empty(IntRange r) { return r == null || r.empty(); } static boolean empty(DoubleRange r) { return r == null || r.isEmpty(); } static boolean empty(IntBuffer b) { return b == null || b.isEmpty(); } static boolean empty(Rect r) { return !(r != null && r.w != 0 && r.h != 0); } static boolean empty(Chain c) { return c == null; } static boolean empty(AppendableChain c) { return c == null; } static String appendColonIfNempty(String s) { return empty(s) ? "" : s + ": "; } static boolean isEmpty(Collection c) { return c == null || c.isEmpty(); } static boolean isEmpty(CharSequence s) { return s == null || s.length() == 0; } static boolean isEmpty(Object[] a) { return a == null || a.length == 0; } static boolean isEmpty(byte[] a) { return a == null || a.length == 0; } static boolean isEmpty(Map map) { return map == null || map.isEmpty(); } static boolean isEmpty(DoubleRange r) { return r == null || r.isEmpty(); } static boolean isEmpty(AppendableChain c) { return c == null; } static AutoCloseable tempInterceptPrintIfNotIntercepted(F1 f) { return print_byThread().get() == null ? tempInterceptPrint(f) : null; } static void _handleError(Error e) { //call(javax(), '_handleError, e); } static void swingAndWait(Runnable r) { try { if (isAWTThread()) r.run(); else EventQueue.invokeAndWait(addThreadInfoToRunnable(r)); } catch (Exception __e) { throw rethrow(__e); } } static Object swingAndWait(final Object f) { if (isAWTThread()) return callF(f); else { final Var result = new Var(); swingAndWait(new Runnable() { public void run() { try { result.set(callF(f)); } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "result.set(callF(f));"; }}); return result.get(); } } static Iterator iterator(Iterable c) { return c == null ? emptyIterator() : c.iterator(); } static int cmp(Number a, Number b) { return a == null ? b == null ? 0 : -1 : cmp(a.doubleValue(), b.doubleValue()); } static int cmp(double a, double b) { return a < b ? -1 : a == b ? 0 : 1; } static int cmp(int a, int b) { return a < b ? -1 : a == b ? 0 : 1; } static int cmp(long a, long b) { return a < b ? -1 : a == b ? 0 : 1; } static int cmp(Object a, Object b) { if (a == null) return b == null ? 0 : -1; if (b == null) return 1; return ((Comparable) a).compareTo(b); } static double toDouble(Object o) { if (o instanceof Number) return ((Number) o).doubleValue(); if (o instanceof BigInteger) return ((BigInteger) o).doubleValue(); if (o instanceof String) return parseDouble((String) o); if (o == null) return 0.0; throw fail(o); } static String joinStrings(String sep, Object... strings) { return joinStrings(sep, Arrays.asList(strings)); } static String joinStrings(String sep, Iterable strings) { StringBuilder buf = new StringBuilder(); for (Object o : unnull(strings)) { String s = strOrNull(o); if (nempty(s)) { if (nempty(buf)) buf.append(sep); buf.append(s); } } return str(buf); } static Map> callF_cache = newDangerousWeakHashMap(); static A callF(F0 f) { return f == null ? null : f.get(); } static B callF(F1 f, A a) { return f == null ? null : f.get(a); } static A callF(IF0 f) { return f == null ? null : f.get(); } static B callF(IF1 f, A a) { return f == null ? null : f.get(a); } static B callF(A a, IF1 f) { return f == null ? null : f.get(a); } static C callF(IF2 f, A a, B b) { return f == null ? null : f.get(a, b); } static void callF(VF1 f, A a) { if (f != null) f.get(a); } static void callF(A a, IVF1 f) { if (f != null) f.get(a); } static void callF(IVF1 f, A a) { if (f != null) f.get(a); } static Object callF(Runnable r) { { if (r != null) r.run(); } return null; } static Object callF(Object f, Object... args) { return safeCallF(f, args); } static Object safeCallF(Object f, Object... args) { if (f instanceof Runnable) { ((Runnable) f).run(); return null; } if (f == null) return null; Class c = f.getClass(); ArrayList methods; synchronized(callF_cache) { methods = callF_cache.get(c); if (methods == null) methods = callF_makeCache(c); } int n = l(methods); if (n == 0) { if (f instanceof String) throw fail("Legacy call: " + f); throw fail("No get method in " + getClassName(c)); } if (n == 1) return invokeMethod(methods.get(0), f, args); for (int i = 0; i < n; i++) { Method m = methods.get(i); if (call_checkArgs(m, args, false)) return invokeMethod(m, f, args); } throw fail("No matching get method in " + getClassName(c)); } // used internally static ArrayList callF_makeCache(Class c) { ArrayList l = new ArrayList(); Class _c = c; do { for (Method m : _c.getDeclaredMethods()) if (m.getName().equals("get")) { makeAccessible(m); l.add(m); } if (!l.isEmpty()) break; _c = _c.getSuperclass(); } while (_c != null); callF_cache.put(c, l); return l; } static IterableIterator iteratorFromFunction_f0(final F0 f) { class IFF2 extends IterableIterator { A a; boolean done = false; public boolean hasNext() { getNext(); return !done; } public A next() { getNext(); if (done) throw fail(); A _a = a; a = null; return _a; } void getNext() { if (done || a != null) return; a = f.get(); done = a == null; } }; return new IFF2(); } static IterableIterator iteratorFromFunction_if0(final IF0 f) { class IFF2 extends IterableIterator { A a; boolean done = false; public boolean hasNext() { getNext(); return !done; } public A next() { getNext(); if (done) throw fail(); A _a = a; a = null; return _a; } void getNext() { if (done || a != null) return; a = f.get(); done = a == null; } }; return new IFF2(); } static RuntimeException rethrow(Throwable t) { if (t instanceof Error) _handleError((Error) t); throw t instanceof RuntimeException ? (RuntimeException) t : new RuntimeException(t); } static RuntimeException rethrow(String msg, Throwable t) { throw new RuntimeException(msg, t); } static String getClassName(Object o) { return o == null ? "null" : o instanceof Class ? ((Class) o).getName() : o.getClass().getName(); } static String combinePrintParameters(String s, Object o) { return (endsWithLetterOrDigit(s) ? s + ": " : s) + o; } static void ping_okInCleanUp() { if (ping_pauseAll || ping_anyActions) ping_impl(true); } // this syntax should be removed... static Object getThreadLocal(Object o, String name) { ThreadLocal t = (ThreadLocal) (getOpt(o, name)); return t != null ? t.get() : null; } static A getThreadLocal(ThreadLocal tl) { return tl == null ? null : tl.get(); } static A getThreadLocal(ThreadLocal tl, A defaultValue) { return or(getThreadLocal(tl), defaultValue); } static ThreadLocal print_byThread_dontCreate() { return print_byThread; } static boolean isFalse(Object o) { return eq(false, o); } static String getStackTrace(Throwable throwable) { lastException(throwable); return getStackTrace_noRecord(throwable); } static String getStackTrace_noRecord(Throwable throwable) { StringWriter writer = new StringWriter(); throwable.printStackTrace(new PrintWriter(writer)); return hideCredentials(writer.toString()); } static String getStackTrace() { return getStackTrace_noRecord(new Throwable()); } static String getStackTrace(String msg) { return getStackTrace_noRecord(new Throwable(msg)); } static String fixNewLines(String s) { int i = indexOf(s, '\r'); if (i < 0) return s; int l = s.length(); StringBuilder out = new StringBuilder(l); out.append(s, 0, i); for (; i < l; i++) { char c = s.charAt(i); if (c != '\r') out.append(c); else { out.append('\n'); if (i+1 < l && s.charAt(i+1) == '\n') ++i; } } return out.toString(); } static void print_append(Appendable buf, String s, int max) { try { synchronized(buf) { buf.append(s); if (buf instanceof StringBuffer) rotateStringBuffer(((StringBuffer) buf), max); else if (buf instanceof StringBuilder) rotateStringBuilder(((StringBuilder) buf), max); } } catch (Exception __e) { throw rethrow(__e); } } static void vmBus_send(String msg, Object... args) { Object arg = vmBus_wrapArgs(args); pcallFAll_minimalExceptionHandling(vm_busListeners_live(), msg, arg); pcallFAll_minimalExceptionHandling(vm_busListenersByMessage_live().get(msg), msg, arg); } static void vmBus_send(String msg) { vmBus_send(msg, (Object) null); } static Class mc() { return main.class; } static String getType(Object o) { return getClassName(o); } static long getFileSize(String path) { return path == null ? 0 : new File(path).length(); } static long getFileSize(File f) { return f == null ? 0 : f.length(); } static ThreadLocal print_byThread() { synchronized(print_byThread_lock) { if (print_byThread == null) print_byThread = new ThreadLocal(); } return print_byThread; } // f can return false to suppress regular printing // call print_raw within f to actually print something static AutoCloseable tempInterceptPrint(F1 f) { return tempSetThreadLocal(print_byThread(), f); } // TODO: test if android complains about this static boolean isAWTThread() { if (isAndroid()) return false; if (isHeadless()) return false; return isAWTThread_awt(); } static boolean isAWTThread_awt() { return SwingUtilities.isEventDispatchThread(); } static Runnable addThreadInfoToRunnable(final Object r) { final Object info = _threadInfo(); return info == null ? asRunnable(r) : new Runnable() { public void run() { try { _inheritThreadInfo(info); callF(r); } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "_inheritThreadInfo(info); callF(r);"; }}; } static Iterator emptyIterator() { return Collections.emptyIterator(); } static double parseDouble(String s) { return empty(s) ? 0.0 : Double.parseDouble(s); } static String unnull(String s) { return s == null ? "" : s; } static Collection unnull(Collection l) { return l == null ? emptyList() : l; } static List unnull(List l) { return l == null ? emptyList() : l; } static int[] unnull(int[] l) { return l == null ? emptyIntArray() : l; } static char[] unnull(char[] l) { return l == null ? emptyCharArray() : l; } static double[] unnull(double[] l) { return l == null ? emptyDoubleArray() : l; } static Map unnull(Map l) { return l == null ? emptyMap() : l; } static Iterable unnull(Iterable i) { return i == null ? emptyList() : i; } static A[] unnull(A[] a) { return a == null ? (A[]) emptyObjectArray() : a; } static BitSet unnull(BitSet b) { return b == null ? new BitSet() : b; } static Pt unnull(Pt p) { return p == null ? new Pt() : p; } //ifclass Symbol static Symbol unnull(Symbol s) { return s == null ? emptySymbol() : s; } //endif static Pair unnull(Pair p) { return p != null ? p : new Pair(null, null); } static int unnull(Integer i) { return i == null ? 0 : i; } static long unnull(Long l) { return l == null ? 0L : l; } static double unnull(Double l) { return l == null ? 0.0 : l; } static String strOrNull(Object o) { return o == null ? null : str(o); } static Map newDangerousWeakHashMap() { return _registerDangerousWeakMap(synchroMap(new WeakHashMap())); } // initFunction: voidfunc(Map) - is called initially, and after clearing the map static Map newDangerousWeakHashMap(Object initFunction) { return _registerDangerousWeakMap(synchroMap(new WeakHashMap()), initFunction); } static Object invokeMethod(Method m, Object o, Object... args) { try { try { return m.invoke(o, args); } catch (InvocationTargetException e) { throw rethrow(getExceptionCause(e)); } catch (IllegalArgumentException e) { throw new IllegalArgumentException(e.getMessage() + " - was calling: " + m + ", args: " + joinWithSpace(classNames(args))); } } catch (Exception __e) { throw rethrow(__e); } } static boolean call_checkArgs(Method m, Object[] args, boolean debug) { Class[] types = m.getParameterTypes(); if (types.length != l(args)) { if (debug) print("Bad parameter length: " + args.length + " vs " + types.length); return false; } for (int i = 0; i < types.length; i++) { Object arg = args[i]; if (!(arg == null ? !types[i].isPrimitive() : isInstanceX(types[i], arg))) { if (debug) print("Bad parameter " + i + ": " + arg + " vs " + types[i]); return false; } } return true; } static Field makeAccessible(Field f) { try { f.setAccessible(true); } catch (Throwable e) { // Note: The error reporting only works with Java VM option --illegal-access=deny vmBus_send("makeAccessible_error", e, f); } return f; } static Method makeAccessible(Method m) { try { m.setAccessible(true); } catch (Throwable e) { vmBus_send("makeAccessible_error", e, m); } return m; } static Constructor makeAccessible(Constructor c) { try { c.setAccessible(true); } catch (Throwable e) { vmBus_send("makeAccessible_error", e, c); } return c; } static boolean endsWithLetterOrDigit(String s) { return s != null && s.length() > 0 && Character.isLetterOrDigit(s.charAt(s.length()-1)); } // legacy mode //sbool ping_actions_shareable = true; static volatile boolean ping_pauseAll = false; static int ping_sleep = 100; // poll pauseAll flag every 100 static volatile boolean ping_anyActions = false; static Map ping_actions = newWeakHashMap(); static ThreadLocal ping_isCleanUpThread = new ThreadLocal(); // ignore pingSource if not PingV3 static boolean ping(PingSource pingSource) { return ping(); } // always returns true static boolean ping() { //ifdef useNewPing newPing(); //endifdef if (ping_pauseAll || ping_anyActions) ping_impl(true /* XXX */); //ifndef LeanMode ping_impl(); endifndef return true; } // returns true when it slept static boolean ping_impl(boolean okInCleanUp) { try { if (ping_pauseAll && !isAWTThread()) { do Thread.sleep(ping_sleep); while (ping_pauseAll); return true; } if (ping_anyActions) { // don't allow sharing ping_actions if (!okInCleanUp && !isTrue(ping_isCleanUpThread.get())) failIfUnlicensed(); Object action = null; synchronized(ping_actions) { if (!ping_actions.isEmpty()) { action = ping_actions.get(currentThread()); if (action instanceof Runnable) ping_actions.remove(currentThread()); if (ping_actions.isEmpty()) ping_anyActions = false; } } if (action instanceof Runnable) ((Runnable) action).run(); else if (eq(action, "cancelled")) throw fail("Thread cancelled."); } return false; } catch (Exception __e) { throw rethrow(__e); } } static Object getOpt(Object o, String field) { return getOpt_cached(o, field); } static Object getOpt(String field, Object o) { return getOpt_cached(o, field); } static Object getOpt_raw(Object o, String field) { try { Field f = getOpt_findField(o.getClass(), field); if (f == null) return null; makeAccessible(f); return f.get(o); } catch (Exception __e) { throw rethrow(__e); } } // access of static fields is not yet optimized static Object getOpt(Class c, String field) { try { if (c == null) return null; Field f = getOpt_findStaticField(c, field); if (f == null) return null; makeAccessible(f); return f.get(null); } catch (Exception __e) { throw rethrow(__e); } } static Field getOpt_findStaticField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field) && (f.getModifiers() & java.lang.reflect.Modifier.STATIC) != 0) return f; _c = _c.getSuperclass(); } while (_c != null); return null; } static A or(A a, A b) { return a != null ? a : b; } // PersistableThrowable doesn't hold GC-disturbing class references in backtrace static volatile PersistableThrowable lastException_lastException; static PersistableThrowable lastException() { return lastException_lastException; } static void lastException(Throwable e) { lastException_lastException = persistableThrowable(e); } static String hideCredentials(URL url) { return url == null ? null : hideCredentials(str(url)); } static String hideCredentials(String url) { try { if (startsWithOneOf(url, "http://", "https://") && isAGIBlueDomain(hostNameFromURL(url))) return url; } catch (Throwable e) { print("HideCredentials", e); } return url.replaceAll("([&?])(_pass|key|cookie)=[^&\\s\"]*", "$1$2="); } static String hideCredentials(Object o) { return hideCredentials(str(o)); } static int indexOf(List l, A a, int startIndex) { if (l == null) return -1; int n = l(l); for (int i = startIndex; i < n; i++) if (eq(l.get(i), a)) return i; return -1; } static int indexOf(List l, int startIndex, A a) { return indexOf(l, a, startIndex); } static int indexOf(List l, A a) { if (l == null) return -1; return l.indexOf(a); } static int indexOf(String a, String b) { return a == null || b == null ? -1 : a.indexOf(b); } static int indexOf(String a, String b, int i) { return a == null || b == null ? -1 : a.indexOf(b, i); } static int indexOf(String a, char b) { return a == null ? -1 : a.indexOf(b); } static int indexOf(String a, int i, char b) { return indexOf(a, b, i); } static int indexOf(String a, char b, int i) { return a == null ? -1 : a.indexOf(b, i); } static int indexOf(String a, int i, String b) { return a == null || b == null ? -1 : a.indexOf(b, i); } static int indexOf(A[] x, A a) { int n = l(x); for (int i = 0; i < n; i++) if (eq(x[i], a)) return i; return -1; } static int indexOf(Iterable l, A a) { if (l == null) return -1; int i = 0; for (A x : l) { if (eq(x, a)) return i; i++; } return -1; } static void rotateStringBuffer(StringBuffer buf, int max) { try { if (buf == null) return; synchronized(buf) { if (buf.length() <= max) return; try { int newLength = max/2; int ofs = buf.length()-newLength; String newString = buf.substring(ofs); buf.setLength(0); buf.append("[...] ").append(newString); } catch (Exception e) { buf.setLength(0); } buf.trimToSize(); } } catch (Exception __e) { throw rethrow(__e); } } static void rotateStringBuilder(StringBuilder buf, int max) { try { if (buf == null) return; synchronized(buf) { if (buf.length() <= max) return; try { int newLength = max/2; int ofs = buf.length()-newLength; String newString = buf.substring(ofs); buf.setLength(0); buf.append("[...] ").append(newString); } catch (Exception e) { buf.setLength(0); } buf.trimToSize(); } } catch (Exception __e) { throw rethrow(__e); } } static Object vmBus_wrapArgs(Object... args) { return empty(args) ? null : l(args) == 1 ? args[0] : args; } static void pcallFAll_minimalExceptionHandling(Collection l, Object... args) { if (l != null) for (Object f : cloneList(l)) { ping(); pcallF_minimalExceptionHandling(f, args); } } static void pcallFAll_minimalExceptionHandling(Iterator it, Object... args) { while (it.hasNext()) { ping(); pcallF_minimalExceptionHandling(it.next(), args); } } static Set vm_busListeners_live_cache; static Set vm_busListeners_live() { if (vm_busListeners_live_cache == null) vm_busListeners_live_cache = vm_busListeners_live_load(); return vm_busListeners_live_cache;} static Set vm_busListeners_live_load() { return vm_generalIdentityHashSet("busListeners"); } static Map vm_busListenersByMessage_live_cache; static Map vm_busListenersByMessage_live() { if (vm_busListenersByMessage_live_cache == null) vm_busListenersByMessage_live_cache = vm_busListenersByMessage_live_load(); return vm_busListenersByMessage_live_cache;} static Map vm_busListenersByMessage_live_load() { return vm_generalHashMap("busListenersByMessage"); } static AutoCloseable tempSetThreadLocal(final ThreadLocal tl, A a) { if (tl == null) return null; final A prev = setThreadLocal(tl, a); return new AutoCloseable() { public String toString() { return "tl.set(prev);"; } public void close() throws Exception { tl.set(prev); }}; } static int isAndroid_flag; static boolean isAndroid() { if (isAndroid_flag == 0) isAndroid_flag = System.getProperty("java.vendor").toLowerCase().indexOf("android") >= 0 ? 1 : -1; return isAndroid_flag > 0; } static Boolean isHeadless_cache; static boolean isHeadless() { if (isHeadless_cache != null) return isHeadless_cache; if (isAndroid()) return isHeadless_cache = true; if (GraphicsEnvironment.isHeadless()) return isHeadless_cache = true; // Also check if AWT actually works. // If DISPLAY variable is set but no X server up, this will notice. try { SwingUtilities.isEventDispatchThread(); return isHeadless_cache = false; } catch (Throwable e) { return isHeadless_cache = true; } } static List> _threadInfo_makers = synchroList(); static Object _threadInfo() { if (empty(_threadInfo_makers)) return null; HashMap map = new HashMap(); pcallFAll(_threadInfo_makers, map); return map; } static Runnable asRunnable(Object o) { return toRunnable(o); } static void _inheritThreadInfo(Object info) { _threadInheritInfo(info); } static int[] emptyIntArray_a = new int[0]; static int[] emptyIntArray() { return emptyIntArray_a; } static char[] emptyCharArray = new char[0]; static char[] emptyCharArray() { return emptyCharArray; } static double[] emptyDoubleArray = new double[0]; static double[] emptyDoubleArray() { return emptyDoubleArray; } static Map emptyMap() { return new HashMap(); } static Object[] emptyObjectArray_a = new Object[0]; static Object[] emptyObjectArray() { return emptyObjectArray_a; } static Symbol emptySymbol_value; static Symbol emptySymbol() { if (emptySymbol_value == null) emptySymbol_value = symbol(""); return emptySymbol_value; } static List _registerDangerousWeakMap_preList; static A _registerDangerousWeakMap(A map) { return _registerDangerousWeakMap(map, null); } static A _registerDangerousWeakMap(A map, Object init) { callF(init, map); if (init instanceof String) { final String f = (String) init; init = new VF1() { public void get(Map map) { try { callMC(f, map) ; } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "callMC(f, map)"; }}; } if (javax() == null) { // We're in class init if (_registerDangerousWeakMap_preList == null) _registerDangerousWeakMap_preList = synchroList(); _registerDangerousWeakMap_preList.add(pair(map, init)); return map; } call(javax(), "_registerDangerousWeakMap", map, init); return map; } static void _onLoad_registerDangerousWeakMap() { assertNotNull(javax()); if (_registerDangerousWeakMap_preList == null) return; for (Pair p : _registerDangerousWeakMap_preList) _registerDangerousWeakMap(p.a, p.b); _registerDangerousWeakMap_preList = null; } static Map synchroMap() { return synchroHashMap(); } static Map synchroMap(Map map) { return Collections.synchronizedMap(map); } static Throwable getExceptionCause(Throwable e) { Throwable c = e.getCause(); return c != null ? c : e; } static String joinWithSpace(Iterable c) { return join(" ", c); } static String joinWithSpace(Object... c) { return join(" ", c); } static List classNames(Collection l) { return getClassNames(l); } static List classNames(Object[] l) { return getClassNames(asList(l)); } static boolean isInstanceX(Class type, Object arg) { if (type == boolean.class) return arg instanceof Boolean; if (type == int.class) return arg instanceof Integer; if (type == long.class) return arg instanceof Long; if (type == float.class) return arg instanceof Float; if (type == short.class) return arg instanceof Short; if (type == char.class) return arg instanceof Character; if (type == byte.class) return arg instanceof Byte; if (type == double.class) return arg instanceof Double; return type.isInstance(arg); } static Map newWeakHashMap() { return _registerWeakMap(synchroMap(new WeakHashMap())); } static void newPing() { var tl = newPing_actionTL(); Runnable action = tl == null ? null : tl.get(); { if (action != null) action.run(); } } static void failIfUnlicensed() { assertTrue("license off", licensed()); } static Thread currentThread() { return Thread.currentThread(); } //static final Map> getOpt_cache = newDangerousWeakHashMap(f getOpt_special_init); static class getOpt_Map extends WeakHashMap { getOpt_Map() { if (getOpt_special == null) getOpt_special = new HashMap(); clear(); } public void clear() { super.clear(); //print("getOpt clear"); put(Class.class, getOpt_special); put(String.class, getOpt_special); } } static final Map> getOpt_cache = _registerDangerousWeakMap(synchroMap(new getOpt_Map())); static HashMap getOpt_special; // just a marker /*static void getOpt_special_init(Map map) { map.put(Class.class, getOpt_special); map.put(S.class, getOpt_special); }*/ static Map getOpt_getFieldMap(Object o) { Class c = _getClass(o); HashMap map = getOpt_cache.get(c); if (map == null) map = getOpt_makeCache(c); return map; } static Object getOpt_cached(Object o, String field) { try { if (o == null) return null; Map map = getOpt_getFieldMap(o); if (map == getOpt_special) { if (o instanceof Class) return getOpt((Class) o, field); /*if (o instanceof S) ret getOpt(getBot((S) o), field);*/ if (o instanceof Map) return ((Map) o).get(field); } Field f = map.get(field); if (f != null) return f.get(o); if (o instanceof DynamicObject) return syncMapGet2(((DynamicObject) o).fieldValues, field); return null; } catch (Exception __e) { throw rethrow(__e); } } // used internally - we are in synchronized block static HashMap getOpt_makeCache(Class c) { HashMap map; if (isSubtypeOf(c, Map.class)) map = getOpt_special; else { map = new HashMap(); if (!reflection_classesNotToScan().contains(c.getName())) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) { makeAccessible(f); String name = f.getName(); if (!map.containsKey(name)) map.put(name, f); } _c = _c.getSuperclass(); } while (_c != null); } } if (getOpt_cache != null) getOpt_cache.put(c, map); return map; } static Field getOpt_findField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field)) return f; _c = _c.getSuperclass(); } while (_c != null); return null; } static PersistableThrowable persistableThrowable(Throwable e) { return e == null ? null : new PersistableThrowable(e); } static boolean startsWithOneOf(String s, String... l) { for (String x : l) if (startsWith(s, x)) return true; return false; } static boolean startsWithOneOf(String s, Matches m, String... l) { for (String x : l) if (startsWith(s, x, m)) return true; return false; } static boolean isAGIBlueDomain(String domain) { return domainIsUnder(domain, theAGIBlueDomain()); } static String hostNameFromURL(String url) { try { return empty(url) ? null : new URL(url).getHost(); } catch (Exception __e) { throw rethrow(__e); } } static ArrayList cloneList(Iterable l) { return l instanceof Collection ? cloneList((Collection) l) : asList(l); } static ArrayList cloneList(Collection l) { if (l == null) return new ArrayList(); synchronized(collectionMutex(l)) { return new ArrayList(l); } } static Object pcallF_minimalExceptionHandling(Object f, Object... args) { try { return callFunction(f, args); } catch (Throwable e) { System.out.println(getStackTrace(e)); _storeException(e); } return null; } static Set vm_generalIdentityHashSet(Object name) { synchronized(vm_generalMap()) { Set set = (Set) (vm_generalMap_get(name)); if (set == null) vm_generalMap_put(name, set = syncIdentityHashSet()); return set; } } static Map vm_generalHashMap(Object name) { synchronized(vm_generalMap()) { Map m = (Map) (vm_generalMap_get(name)); if (m == null) vm_generalMap_put(name, m = syncHashMap()); return m; } } static A setThreadLocal(ThreadLocal tl, A value) { if (tl == null) return null; A old = tl.get(); tl.set(value); return old; } static List synchroList() { return synchroList(new ArrayList()); } static List synchroList(List l) { return Collections.synchronizedList(l); } static void pcallFAll(Collection l, Object... args) { if (l != null) for (Object f : cloneList(l)) pcallF(f, args); } static void pcallFAll(Iterator it, Object... args) { while (it.hasNext()) pcallF(it.next(), args); } static Runnable toRunnable(final Object o) { if (o == null) return null; if (o instanceof Runnable) return (Runnable) o; if (o instanceof String) throw fail("callF_legacy"); return new Runnable() { public void run() { try { callF(o) ; } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "callF(o)"; }}; } static List> _threadInheritInfo_retrievers = synchroList(); static void _threadInheritInfo(Object info) { if (info == null) return; pcallFAll(_threadInheritInfo_retrievers, (Map) info); } static WeakHasherMap symbol_map = new WeakHasherMap(new Hasher() { public int hashCode(Symbol symbol) { return symbol.text.hashCode(); } public boolean equals(Symbol a, Symbol b) { if (a == null) return b == null; return b != null && eq(a.text, b.text); } }); static Symbol symbol(String s) { if (s == null) return null; synchronized(symbol_map) { // TODO: avoid object creation by passing the string to findKey Symbol symbol = new Symbol(s, true); Symbol existingSymbol = symbol_map.findKey(symbol); if (existingSymbol == null) symbol_map.put(existingSymbol = symbol, true); return existingSymbol; } } static Symbol symbol(CharSequence s) { if (s == null) return null; if (s instanceof Symbol) return (Symbol) s; if (s instanceof String) return symbol((String) s); return symbol(str(s)); } static Symbol symbol(Object o) { return symbol((CharSequence) o); } static HashMap> callMC_cache = new HashMap(); static String callMC_key; static Method callMC_value; // varargs assignment fixer for a single string array argument static Object callMC(String method, String[] arg) { return callMC(method, new Object[] {arg}); } static Object callMC(String method, Object... args) { try { Method me; if (callMC_cache == null) callMC_cache = new HashMap(); // initializer time workaround synchronized(callMC_cache) { me = method == callMC_key ? callMC_value : null; } if (me != null) try { return invokeMethod(me, null, args); } catch (IllegalArgumentException e) { throw new RuntimeException("Can't call " + me + " with arguments " + classNames(args), e); } List m; synchronized(callMC_cache) { m = callMC_cache.get(method); } if (m == null) { if (callMC_cache.isEmpty()) { callMC_makeCache(); m = callMC_cache.get(method); } if (m == null) throw fail("Method named " + method + " not found in main"); } int n = m.size(); if (n == 1) { me = m.get(0); synchronized(callMC_cache) { callMC_key = method; callMC_value = me; } try { return invokeMethod(me, null, args); } catch (IllegalArgumentException e) { throw new RuntimeException("Can't call " + me + " with arguments " + classNames(args), e); } } for (int i = 0; i < n; i++) { me = m.get(i); if (call_checkArgs(me, args, false)) return invokeMethod(me, null, args); } throw fail("No method called " + method + " with arguments (" + joinWithComma(getClasses(args)) + ") found in main"); } catch (Exception __e) { throw rethrow(__e); } } static void callMC_makeCache() { synchronized(callMC_cache) { callMC_cache.clear(); Class _c = (Class) mc(), c = _c; while (c != null) { for (Method m : c.getDeclaredMethods()) if ((m.getModifiers() & java.lang.reflect.Modifier.STATIC) != 0) { makeAccessible(m); multiMapPut(callMC_cache, m.getName(), m); } c = c.getSuperclass(); } } } static Class javax() { return getJavaX(); } static Pair pair(A a, B b) { return new Pair(a, b); } static Pair pair(A a) { return new Pair(a, a); } static Object call(Object o) { return callF(o); } // varargs assignment fixer for a single string array argument static Object call(Object o, String method, String[] arg) { return call(o, method, new Object[] {arg}); } static Object call(Object o, String method, Object... args) { //ret call_cached(o, method, args); return call_withVarargs(o, method, args); } static A assertNotNull(A a) { assertTrue(a != null); return a; } static A assertNotNull(String msg, A a) { assertTrue(msg, a != null); return a; } static Map synchroHashMap() { return synchronizedMap(new HashMap()); } public static String join(String glue, Iterable strings) { if (strings == null) return ""; if (strings instanceof Collection) { if (((Collection) strings).size() == 1) return str(first((Collection) strings)); } StringBuilder buf = new StringBuilder(); Iterator i = strings.iterator(); if (i.hasNext()) { buf.append(i.next()); while (i.hasNext()) buf.append(glue).append(i.next()); } return buf.toString(); } public static String join(String glue, String... strings) { return join(glue, Arrays.asList(strings)); } public static String join(String glue, Object... strings) { return join(glue, Arrays.asList(strings)); } static String join(Iterable strings) { return join("", strings); } static String join(Iterable strings, String glue) { return join(glue, strings); } public static String join(String[] strings) { return join("", strings); } static String join(String glue, Pair p) { return p == null ? "" : str(p.a) + glue + str(p.b); } static List getClassNames(Collection l) { List out = new ArrayList(); if (l != null) for (Object o : l) out.add(o == null ? null : getClassName(o)); return out; } static List _registerWeakMap_preList; static A _registerWeakMap(A map) { if (javax() == null) { // We're in class init if (_registerWeakMap_preList == null) _registerWeakMap_preList = synchroList(); _registerWeakMap_preList.add(map); return map; } try { call(javax(), "_registerWeakMap", map); } catch (Throwable e) { printException(e); print("Upgrade JavaX!!"); } return map; } static void _onLoad_registerWeakMap() { assertNotNull(javax()); if (_registerWeakMap_preList == null) return; for (Object o : _registerWeakMap_preList) _registerWeakMap(o); _registerWeakMap_preList = null; } static x30_pkg.x30_util.BetterThreadLocal newPing_actionTL; static x30_pkg.x30_util.BetterThreadLocal newPing_actionTL() { if (newPing_actionTL == null) newPing_actionTL = vm_generalMap_getOrCreate("newPing_actionTL", () -> { Runnable value = (Runnable) (callF_gen(vm_generalMap_get("newPing_valueForNewThread"))); var tl = new x30_pkg.x30_util.BetterThreadLocal(); tl.set(value); return tl; }); return newPing_actionTL; } static void assertTrue(Object o) { if (!(eq(o, true) /*|| isTrue(pcallF(o))*/)) throw fail(str(o)); } static boolean assertTrue(String msg, boolean b) { if (!b) throw fail(msg); return b; } static boolean assertTrue(boolean b) { if (!b) throw fail("oops"); return b; } static volatile boolean licensed_yes = true; static boolean licensed() { if (!licensed_yes) return false; ping_okInCleanUp(); return true; } static void licensed_off() { licensed_yes = false; } static void clear(Collection c) { if (c != null) c.clear(); } static void clear(Map map) { if (map != null) map.clear(); } static void put(Map map, A a, B b) { if (map != null) map.put(a, b); } static void put(List l, int i, A a) { if (l != null && i >= 0 && i < l(l)) l.set(i, a); } static Class _getClass(String name) { try { return Class.forName(name); } catch (ClassNotFoundException e) { return null; // could optimize this } } static Class _getClass(Object o) { return o == null ? null : o instanceof Class ? (Class) o : o.getClass(); } static Class _getClass(Object realm, String name) { try { return classLoaderForObject(realm).loadClass(classNameToVM(name)); } catch (ClassNotFoundException e) { return null; // could optimize this } } static B syncMapGet2(Map map, A a) { if (map == null) return null; synchronized(collectionMutex(map)) { return map.get(a); } } static B syncMapGet2(A a, Map map) { return syncMapGet2(map, a); } static boolean isSubtypeOf(Class a, Class b) { return a != null && b != null && b.isAssignableFrom(a); // << always hated that method, let's replace it! } static Set reflection_classesNotToScan_value = litset( "jdk.internal.loader.URLClassPath" ); static Set reflection_classesNotToScan() { return reflection_classesNotToScan_value; } static boolean startsWith(String a, String b) { return a != null && a.startsWith(unnull(b)); } static boolean startsWith(String a, char c) { return nemptyString(a) && a.charAt(0) == c; } static boolean startsWith(String a, String b, Matches m) { if (!startsWith(a, b)) return false; if (m != null) m.m = new String[] {substring(a, strL(b))}; return true; } static boolean startsWith(List a, List b) { if (a == null || listL(b) > listL(a)) return false; for (int i = 0; i < listL(b); i++) if (neq(a.get(i), b.get(i))) return false; return true; } static boolean domainIsUnder(String domain, String mainDomain) { return eqic(domain, mainDomain) || ewic(domain, "." + mainDomain); } static String theAGIBlueDomain() { return "agi.blue"; } // TODO: JDK 17!! ?? No! Yes? Yes!! static Object collectionMutex(List l) { return l; } static Object collectionMutex(Object o) { if (o instanceof List) return o; // TODO: actually use our own maps so we can get the mutex properly String c = className(o); return o; } static Object callFunction(Object f, Object... args) { return callF(f, args); } static Throwable _storeException_value; static void _storeException(Throwable e) { _storeException_value = e; } static Map vm_generalMap_map; static Map vm_generalMap() { if (vm_generalMap_map == null) vm_generalMap_map = (Map) get(javax(), "generalMap"); return vm_generalMap_map; } static Object vm_generalMap_get(Object key) { return vm_generalMap().get(key); } static Object vm_generalMap_put(Object key, Object value) { return mapPutOrRemove(vm_generalMap(), key, value); } static Set syncIdentityHashSet() { return (Set) synchronizedSet(identityHashSet()); } static Map syncHashMap() { return synchroHashMap(); } static Object pcallF(Object f, Object... args) { return pcallFunction(f, args); } static A pcallF(F0 f) { try { return f == null ? null : f.get(); } catch (Throwable __e) { printStackTrace(__e); } return null; } static B pcallF(F1 f, A a) { try { return f == null ? null : f.get(a); } catch (Throwable __e) { printStackTrace(__e); } return null; } static void pcallF(VF1 f, A a) { try { { if (f != null) f.get(a); } } catch (Throwable __e) { printStackTrace(__e); } } static Object pcallF(Runnable r) { try { { if (r != null) r.run(); } } catch (Throwable __e) { printStackTrace(__e); } return null; } static A pcallF(IF0 f) { try { return f == null ? null : f.get(); } catch (Throwable __e) { printStackTrace(__e); } return null; } static B pcallF(IF1 f, A a) { try { return f == null ? null : f.get(a); } catch (Throwable __e) { printStackTrace(__e); } return null; } static String joinWithComma(Collection c) { return join(", ", c); } static String joinWithComma(Object... c) { return join(", ", c); } static String joinWithComma(String... c) { return join(", ", c); } static String joinWithComma(Pair p) { return p == null ? "" : joinWithComma(str(p.a), str(p.b)); } static List getClasses(Object[] array) { List l = emptyList(l(array)); for (Object o : array) l.add(_getClass(o)); return l; } static void multiMapPut(Map> map, A a, B b) { List l = map.get(a); if (l == null) map.put(a, l = new ArrayList()); l.add(b); } static void multiMapPut(MultiMap mm, A key, B value) { if (mm != null && key != null && value != null) mm.put(key, value); } static Class __javax; static Class getJavaX() { try { return __javax; } catch (Exception __e) { throw rethrow(__e); } } static void __setJavaX(Class j) { __javax = j; _onJavaXSet(); } static Object call_withVarargs(Object o, String methodName, Object... args) { try { if (o == null) return null; if (o instanceof Class) { Class c = (Class) o; _MethodCache cache = callOpt_getCache(c); Method me = cache.findStaticMethod(methodName, args); if (me != null) return invokeMethod(me, null, args); // try varargs List methods = cache.cache.get(methodName); if (methods != null) methodSearch: for (Method m : methods) { { if (!(m.isVarArgs())) continue; } { if (!(isStaticMethod(m))) continue; } Object[] newArgs = massageArgsForVarArgsCall(m, args); if (newArgs != null) return invokeMethod(m, null, newArgs); } throw fail("Method " + c.getName() + "." + methodName + "(" + joinWithComma(classNames(args)) + ") not found"); } else { Class c = o.getClass(); _MethodCache cache = callOpt_getCache(c); Method me = cache.findMethod(methodName, args); if (me != null) return invokeMethod(me, o, args); // try varargs List methods = cache.cache.get(methodName); if (methods != null) methodSearch: for (Method m : methods) { { if (!(m.isVarArgs())) continue; } Object[] newArgs = massageArgsForVarArgsCall(m, args); if (newArgs != null) return invokeMethod(m, o, newArgs); } throw fail("Method " + c.getName() + "." + methodName + "(" + joinWithComma(classNames(args)) + ") not found"); } } catch (Exception __e) { throw rethrow(__e); } } static Map synchronizedMap() { return synchroMap(); } static Map synchronizedMap(Map map) { return synchroMap(map); } static Object first(Object list) { return first((Iterable) list); } static A first(List list) { return empty(list) ? null : list.get(0); } static A first(A[] bla) { return bla == null || bla.length == 0 ? null : bla[0]; } static Pair first(Map map) { return mapEntryToPair(first(entrySet(map))); } static Pair first(MultiMap mm) { if (mm == null) return null; var e = first(mm.data.entrySet()); if (e == null) return null; return pair(e.getKey(), first(e.getValue())); } static A first(IterableIterator i) { return first((Iterator) i); } static A first(Iterator i) { return i == null || !i.hasNext() ? null : i.next(); } static A first(Iterable i) { if (i == null) return null; Iterator it = i.iterator(); return it.hasNext() ? it.next() : null; } static Character first(String s) { return empty(s) ? null : s.charAt(0); } static Character first(CharSequence s) { return empty(s) ? null : s.charAt(0); } static A first(Pair p) { return p == null ? null : p.a; } static Byte first(byte[] l) { return empty(l) ? null : l[0]; } static int first(IntBuffer buf) { return buf.get(0); } static byte first(ByteBuffer buf) { return buf.get(0); } static A first(A[] l, IF1 pred) { return firstThat(l, pred); } static A first(Iterable l, IF1 pred) { return firstThat(l, pred); } static A first(IF1 pred, Iterable l) { return firstThat(pred, l); } static A first(AppendableChain a) { return a == null ? null : a.element; } static A printException(A e) { printStackTrace(e); return e; } static A vm_generalMap_getOrCreate(Object key, F0 create) { return vm_generalMap_getOrCreate(key, f0ToIF0(create)); } static A vm_generalMap_getOrCreate(Object key, IF0 create) { Map generalMap = vm_generalMap(); if (generalMap == null) return null; // must be x30 init synchronized(generalMap) { // should switch to locks here A a = (A) (vm_generalMap_get(key)); if (a == null) vm_generalMap_put(key, a = create == null ? null : create.get()); return a; } } static A callF_gen(F0 f) { return f == null ? null : f.get(); } static B callF_gen(F1 f, A a) { return f == null ? null : f.get(a); } static A callF_gen(IF0 f) { return f == null ? null : f.get(); } static B callF_gen(IF1 f, A a) { return f == null ? null : f.get(a); } static B callF_gen(A a, IF1 f) { return f == null ? null : f.get(a); } static C callF_gen(IF2 f, A a, B b) { return f == null ? null : f.get(a, b); } static void callF_gen(VF1 f, A a) { { if (f != null) f.get(a); } } static void callF_gen(A a, IVF1 f) { { if (f != null) f.get(a); } } static void callF_gen(IVF1 f, A a) { { if (f != null) f.get(a); } } static Object callF_gen(Runnable r) { { if (r != null) r.run(); } return null; } static Object callF_gen(Object f, Object... args) { return callF(f, args); } static ClassLoader classLoaderForObject(Object o) { if (o instanceof ClassLoader) return ((ClassLoader) o); if (o == null) return null; return _getClass(o).getClassLoader(); } // Note: This is actually broken. Inner classes must stay with a $ separator static String classNameToVM(String name) { return name.replace(".", "$"); } static HashSet litset(A... items) { return lithashset(items); } static boolean nemptyString(String s) { return s != null && s.length() > 0; } static int listL(Collection l) { return l == null ? 0 : l.size(); } static boolean neq(Object a, Object b) { return !eq(a, b); } static boolean eqic(String a, String b) { if ((a == null) != (b == null)) return false; if (a == null) return true; return a.equalsIgnoreCase(b); } static boolean eqic(Symbol a, Symbol b) { return eq(a, b); } static boolean eqic(Symbol a, String b) { return eqic(asString(a), b); } static boolean eqic(char a, char b) { if (a == b) return true; char u1 = Character.toUpperCase(a); char u2 = Character.toUpperCase(b); if (u1 == u2) return true; return Character.toLowerCase(u1) == Character.toLowerCase(u2); } static boolean ewic(String a, String b) { return endsWithIgnoreCase(a, b); } static boolean ewic(String a, String b, Matches m) { return endsWithIgnoreCase(a, b, m); } static String className(Object o) { return getClassName(o); } // get purpose 1: access a list/array/map (safer version of x.get(y)) static A get(List l, int idx) { return l != null && idx >= 0 && idx < l(l) ? l.get(idx) : null; } // seems to conflict with other signatures /*static B get(Map map, A key) { ret map != null ? map.get(key) : null; }*/ static A get(A[] l, int idx) { return idx >= 0 && idx < l(l) ? l[idx] : null; } // default to false static boolean get(boolean[] l, int idx) { return idx >= 0 && idx < l(l) ? l[idx] : false; } // get purpose 2: access a field by reflection or a map static Object get(Object o, String field) { try { if (o == null) return null; if (o instanceof Class) return get((Class) o, field); if (o instanceof Map) return ((Map) o).get(field); Field f = getOpt_findField(o.getClass(), field); if (f != null) { makeAccessible(f); return f.get(o); } if (o instanceof DynamicObject) return getOptDynOnly(((DynamicObject) o), field); } catch (Exception e) { throw asRuntimeException(e); } throw new RuntimeException("Field '" + field + "' not found in " + o.getClass().getName()); } static Object get_raw(String field, Object o) { return get_raw(o, field); } static Object get_raw(Object o, String field) { try { if (o == null) return null; Field f = get_findField(o.getClass(), field); makeAccessible(f); return f.get(o); } catch (Exception __e) { throw rethrow(__e); } } static Object get(Class c, String field) { try { Field f = get_findStaticField(c, field); makeAccessible(f); return f.get(null); } catch (Exception e) { throw new RuntimeException(e); } } static Field get_findStaticField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field) && (f.getModifiers() & java.lang.reflect.Modifier.STATIC) != 0) return f; _c = _c.getSuperclass(); } while (_c != null); throw new RuntimeException("Static field '" + field + "' not found in " + c.getName()); } static Field get_findField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field)) return f; _c = _c.getSuperclass(); } while (_c != null); throw new RuntimeException("Field '" + field + "' not found in " + c.getName()); } static Object get(String field, Object o) { return get(o, field); } static boolean get(BitSet bs, int idx) { return bs != null && bs.get(idx); } static B mapPutOrRemove(Map map, A key, B value) { if (map != null && key != null) if (value != null) return map.put(key, value); else return map.remove(key); return null; } static Set synchronizedSet() { return synchroHashSet(); } static Set synchronizedSet(Set set) { return Collections.synchronizedSet(set); } static Set identityHashSet() { return Collections.newSetFromMap(new IdentityHashMap()); } static Object pcallFunction(Object f, Object... args) { try { return callFunction(f, args); } catch (Throwable __e) { printStackTrace(__e); } return null; } static A printStackTrace(A e) { // we go to system.out now - system.err is nonsense if (e != null) print(getStackTrace(e)); return e; } static void printStackTrace() { printStackTrace(new Throwable()); } static void printStackTrace(String msg) { printStackTrace(new Throwable(msg)); } static void printStackTrace(String msg, Throwable e) { printStackTrace(new Throwable(msg, e)); } static void _onJavaXSet() {} static final Map callOpt_cache = newDangerousWeakHashMap(); static Object callOpt_cached(Object o, String methodName, Object... args) { try { if (o == null) return null; if (o instanceof Class) { Class c = (Class) o; _MethodCache cache = callOpt_getCache(c); // TODO: (super-rare) case where method exists static and non-static // with different args Method me = cache.findMethod(methodName, args); if (me == null || (me.getModifiers() & Modifier.STATIC) == 0) return null; return invokeMethod(me, null, args); } else { Class c = o.getClass(); _MethodCache cache = callOpt_getCache(c); Method me = cache.findMethod(methodName, args); if (me == null) return null; return invokeMethod(me, o, args); } } catch (Exception __e) { throw rethrow(__e); } } // no longer synchronizes! (see #1102990) static _MethodCache callOpt_getCache(Class c) { _MethodCache cache = callOpt_cache.get(c); if (cache == null) callOpt_cache.put(c, cache = new _MethodCache(c)); return cache; } static boolean isStaticMethod(Method m) { return methodIsStatic(m); } static Object[] massageArgsForVarArgsCall(Executable m, Object[] args) { Class[] types = m.getParameterTypes(); int n = types.length-1, nArgs = l(args); if (nArgs < n) return null; for (int i = 0; i < n; i++) if (!argumentCompatibleWithType(args[i], types[i])) return null; Class varArgType = types[n].getComponentType(); for (int i = n; i < nArgs; i++) if (!argumentCompatibleWithType(args[i], varArgType)) return null; Object[] newArgs = new Object[n+1]; arraycopy(args, 0, newArgs, 0, n); // TODO: optimize int nVarArgs = nArgs-n; Object varArgs = Array.newInstance(varArgType, nVarArgs); for (int i = 0; i < nVarArgs; i++) Array.set(varArgs, i, args[n+i]); newArgs[n] = varArgs; return newArgs; } static Pair mapEntryToPair(Map.Entry e) { return e == null ? null : pair(e.getKey(), e.getValue()); } static Set> entrySet(Map map) { return _entrySet(map); } static A firstThat(Iterable l, IF1 pred) { for (A a : unnullForIteration(l)) if (pred.get(a)) return a; return null; } static A firstThat(A[] l, IF1 pred) { for (A a : unnullForIteration(l)) if (pred.get(a)) return a; return null; } static A firstThat(IF1 pred, Iterable l) { return firstThat(l, pred); } static A firstThat(IF1 pred, A[] l) { return firstThat(l, pred); } static IF0 f0ToIF0(F0 f) { return f == null ? null : () -> f.get(); } static HashSet lithashset(A... items) { HashSet set = new HashSet(); for (A a : items) set.add(a); return set; } static String asString(Object o) { return o == null ? null : o.toString(); } static boolean endsWithIgnoreCase(String a, String b) { int la = l(a), lb = l(b); return la >= lb && regionMatchesIC(a, la-lb, b, 0, lb); } static boolean endsWithIgnoreCase(String a, String b, Matches m) { if (!endsWithIgnoreCase(a, b)) return false; if (m != null) m.m = new String[] { substring(a, 0, l(a)-l(b)) }; return true; } static Object getOptDynOnly(DynamicObject o, String field) { if (o == null || o.fieldValues == null) return null; return o.fieldValues.get(field); } static Set synchroHashSet() { return synchronizedSet(new HashSet()); } static boolean methodIsStatic(Method m) { return (m.getModifiers() & Modifier.STATIC) != 0; } static boolean argumentCompatibleWithType(Object arg, Class type) { return arg == null ? !type.isPrimitive() : isInstanceX(type, arg); } static void arraycopy(Object[] a, Object[] b) { if (a != null && b != null) arraycopy(a, 0, b, 0, Math.min(a.length, b.length)); } static void arraycopy(Object src, int srcPos, int destPos, int n) { arraycopy(src, srcPos, src, destPos, n); } static void arraycopy(Object src, int srcPos, Object dest, int destPos, int n) { if (n != 0) System.arraycopy(src, srcPos, dest, destPos, n); } static Set> _entrySet(Map map) { return map == null ? Collections.EMPTY_SET : map.entrySet(); } static String unnullForIteration(String s) { return s == null ? "" : s; } static Collection unnullForIteration(Collection l) { return l == null ? immutableEmptyList() : l; } static List unnullForIteration(List l) { return l == null ? immutableEmptyList() : l; } static byte[] unnullForIteration(byte[] l) { return l == null ? emptyByteArray() : l; } static int[] unnullForIteration(int[] l) { return l == null ? emptyIntArray() : l; } static char[] unnullForIteration(char[] l) { return l == null ? emptyCharArray() : l; } static double[] unnullForIteration(double[] l) { return l == null ? emptyDoubleArray() : l; } static short[] unnullForIteration(short[] l) { return l == null ? emptyShortArray() : l; } static Map unnullForIteration(Map l) { return l == null ? immutableEmptyMap() : l; } static Iterable unnullForIteration(Iterable i) { return i == null ? immutableEmptyList() : i; } static A[] unnullForIteration(A[] a) { return a == null ? (A[]) emptyObjectArray() : a; } static BitSet unnullForIteration(BitSet b) { return b == null ? new BitSet() : b; } static Pt unnullForIteration(Pt p) { return p == null ? new Pt() : p; } //ifclass Symbol static Symbol unnullForIteration(Symbol s) { return s == null ? emptySymbol() : s; } //endif static Pair unnullForIteration(Pair p) { return p != null ? p : new Pair(null, null); } static long unnullForIteration(Long l) { return l == null ? 0L : l; } static boolean regionMatchesIC(String a, int offsetA, String b, int offsetB, int len) { return a != null && a.regionMatches(true, offsetA, b, offsetB, len); } static List immutableEmptyList() { return Collections.emptyList(); } static byte[] emptyByteArray_a = new byte[0]; static byte[] emptyByteArray() { return emptyByteArray_a; } static short[] emptyShortArray = new short[0]; static short[] emptyShortArray() { return emptyShortArray; } static Map immutableEmptyMap() { return Collections.emptyMap(); } static abstract class VF1 implements IVF1 { public abstract void get(A a); } // immutable, has strong refs // Do not run in a synchronized block - it goes wrong in the presence // of elaborate classloaders (like in Gazelle BEA) // see #1102990 and #1102991 final static class _MethodCache { final Class c; final HashMap> cache = new HashMap(); _MethodCache(Class c) { this.c = c; _init(); } void _init() { Class _c = c; java.lang.Module myModule = getClass().getModule(); boolean anyHiddenClasses = false; while (_c != null) { boolean exported = classIsExportedTo(_c, myModule); if (!exported) anyHiddenClasses = true; else for (Method m : _c.getDeclaredMethods()) if ((anyHiddenClasses || !isAbstract(m)) && !reflection_isForbiddenMethod(m)) multiMapPut(cache, m.getName(), makeAccessible(m)); _c = _c.getSuperclass(); } // add default methods - this might lead to a duplication // because the overridden method is also added, but it's not // a problem except for minimal performance loss. // If any classes in the hierarchy were inaccessible, we add // all interface methods (see test_callForbiddenMethodByReflection for a test) for (Class intf : allInterfacesImplementedBy(c)) for (Method m : intf.getDeclaredMethods()) if ((anyHiddenClasses || m.isDefault()) && !reflection_isForbiddenMethod(m)) multiMapPut(cache, m.getName(), makeAccessible(m)); } // Returns only matching methods Method findMethod(String method, Object[] args) { try { List m = cache.get(method); if (m == null) return null; int n = m.size(); for (int i = 0; i < n; i++) { Method me = m.get(i); if (call_checkArgs(me, args, false)) return me; } return null; } catch (Exception __e) { throw rethrow(__e); } } Method findStaticMethod(String method, Object[] args) { try { List m = cache.get(method); if (m == null) return null; int n = m.size(); for (int i = 0; i < n; i++) { Method me = m.get(i); if (isStaticMethod(me) && call_checkArgs(me, args, false)) return me; } return null; } catch (Exception __e) { throw rethrow(__e); } } //Cl allMethods() { ret allValues(cache); } } static class Matches { String[] m; Matches() {} Matches(String... m) { this.m = m;} String get(int i) { return i < m.length ? m[i] : null; } String unq(int i) { return unquote(get(i)); } String tlc(int i) { return unq(i).toLowerCase(); } boolean bool(int i) { return "true".equals(unq(i)); } String rest() { return m[m.length-1]; } // for matchStart int psi(int i) { return Integer.parseInt(unq(i)); } public String toString() { return "Matches(" + joinWithComma(quoteAll(asList(m))) + ")"; } public int hashCode() { return _hashCode(toList(m)); } public boolean equals(Object o) { return o instanceof Matches && arraysEqual(m, ((Matches) o).m); } } // for the version with MasterSymbol (used WAY back in "Smart Bot"!) see #1010608 static class Symbol implements CharSequence { String text; Symbol() {} Symbol(String text, boolean dummy) { this.text = text;} // weird signature to prevent accidental calling public int hashCode() { return _hashCode(text); } public String toString() { return text; } public boolean equals(Object o) { return this == o; } // implementation of CharSequence methods public int length() { return text.length(); } public char charAt(int index) { return text.charAt(index); } public CharSequence subSequence(int start, int end) { return text.substring(start, end); } } static class Var implements IVar, ISetter { Var() {} Var(A v) { this.v = v;} A v; // you can access this directly if you use one thread public synchronized void set(A a) { if (v != a) { v = a; notifyAll(); } } public synchronized A get() { return v; } public synchronized boolean has() { return v != null; } public void clear() { set(null); } public synchronized A getAndSet(A a) { var value = v; set(a); return value; } public IF0 getter() { return () -> get(); } public IVF1 setter() { return __32 -> set(__32); } public String toString() { return str(this.get()); } } abstract static class AbstractSSI implements G2Drawable, HasBounds, SizeInInts, StringIO, INumberOfPixels { AbstractSSI() {} // Color in 15 bit final public AbstractSSI setHi15color(short hi15color){ return hi15color(hi15color); } public AbstractSSI hi15color(short hi15color) { this.hi15color = hi15color; return this; } final public short getHi15color(){ return hi15color(); } public short hi15color() { return hi15color; } short hi15color; Color color() { return main.hi15color(hi15color); } AbstractSSI color(Color color) { return hi15color(colorToHi15(color)); } String colorToString() { return lower(colorToHex(color())); } final SSI render(){ return toSSI(); } abstract SSI toSSI(); void copyAbstractSSI(AbstractSSI dest) { dest.hi15color(hi15color); } double compressibility() { return doubleRatio(numberOfPixels(), sizeInInts()); } AbstractSSI reduceToInts(int ints) { return null; } } // In the newest pinging system (with flag PingV3), a ping source // is the object that "allows" some code to run. // When that code calls ping(), the ping source's action (if defined) // is triggered. // This allows randomly interrupting code execution, for example. static class PingSource { // returns true if it slept final public PingSource setAction(IF0 action){ return action(action); } public PingSource action(IF0 action) { this.action = action; return this; } final public IF0 getAction(){ return action(); } public IF0 action() { return action; } volatile IF0 action; // optional description of this ping source String text; // optional thread pool that this ping source likes to run in ThreadPool threadPool; PingSource() {} PingSource(ThreadPool threadPool) { this.threadPool = threadPool;} PingSource(ThreadPool threadPool, String text) { this.text = text; this.threadPool = threadPool;} PingSource(IF0 action) { this.action = action;} // returns true if it slept final boolean get() { var a = action; return a != null && a.get(); } final void ping() { var a = action; if (a != null) a.get(); } void cancel() { action = new Cancelled(); } class Cancelled implements IF0 { public Boolean get() { throw new PingSourceCancelledException(PingSource.this); } } class Encapsulated implements Runnable , IFieldsToList{ Runnable r; Encapsulated() {} Encapsulated(Runnable r) { this.r = r;}public Object[] _fieldsToList() { return new Object[] {r}; } public void run() { try { //System.out.println("Encapsulated running: " + r); try { pingSource_tl().set(PingSource.this); //System.out.println("Ping source set"); ping(); r.run(); //System.out.println("Done running"); } finally { //System.out.println("Finally"); pingSource_tl().set(null); } } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return PingSource.this + ": " + r; } } void dO(Runnable r) { if (r == null) return; threadPool.acquireThreadOrQueue(new Encapsulated(r)); } public String toString() { String t = text; return nempty(t) ? t : super.toString(); } ISleeper_v2 sleeper() { return threadPool.sleeper(); } } static class InterpolatedDoubleArray implements IntSize { InterpolatedDoubleArray() {} int[] indices; double[] values; InterpolatedDoubleArray(int[] indices, double[] values) { this.values = values; this.indices = indices;} final public int length(){ return size(); } public int size() { return empty(indices) ? 0 : last(indices)+1; } int nPillars() { return l(indices); } final double[] get(){ return toDoubleArray(); } double[] toDoubleArray() { int n = length(); double[] array = new double[n]; for (int i = 0; i < indices.length; i++) { int iEnd = indices[i]; double value = values[i]; array[iEnd] = value; if (i > 0) { int iStart = indices[i-1]; if (iStart+1 < iEnd) { double startValue = values[i-1]; double step = (value-startValue)/(iEnd-iStart), val = startValue; for (int j = iStart+1; j < iEnd; j++) { val += step; array[j] = val; } } } } return array; } int[] rounded() { return iroundDoubleArray(get()); } double[] indicesAndValues() { int n = nPillars(); double[] array = new double[n*2]; for (int i = 0; i < n; i++) { array[i*2] = indices[i]; array[i*2+1] = values[i]; } return array; } double[] indicesAndValues_withoutFirstAndLastIndex() { int n = nPillars(); double[] array = new double[max(1, n*2-2)]; int j = 0; for (int i = 0; i < n; i++) { if (i != 0 && i != n-1) array[j++] = indices[i]; array[j++] = values[i]; } return array; } int nInts_withoutFirstAndLastIndex() { return max(1, nPillars()*2-2); } int nInts() { return nPillars()*2; } InterpolatedDoubleArray topPart(int nPillars) { return new InterpolatedDoubleArray( takeFirst(nPillars, indices), takeFirst(nPillars, values)); } } // records its full size (total value count) in a field now static class MultiMap implements IMultiMap { Map> data = new HashMap>(); int fullSize; MultiMap() {} MultiMap(boolean useTreeMap) { if (useTreeMap) data = new TreeMap(); } MultiMap(MultiMap map) { putAll(map); } MultiMap(Map> data) { this.data = data;} void put(A key, B value) { synchronized(data) { List list = data.get(key); if (list == null) data.put(key, list = _makeEmptyList()); list.add(value); ++fullSize; }} void add(A key, B value) { put(key, value); } void addAll(A key, Collection values) { putAll(key, values); } void addAllIfNotThere(A key, Collection values) { synchronized(data) { for (B value : values) setPut(key, value); }} void setPut(A key, B value) { synchronized(data) { if (!containsPair(key, value)) put(key, value); }} boolean containsPair(A key, B value) { synchronized(data) { return get(key).contains(value); }} void putAll(Collection keys, B value) { synchronized(data) { for (A key : unnullForIteration(keys)) put(key, value); }} void putAll(A key, Collection values) { synchronized(data) { if (nempty(values)) getActual(key).addAll(values); }} void putAll(Iterable> pairs) { synchronized(data) { for (Pair p : unnullForIteration(pairs)) put(p.a, p.b); }} void removeAll(A key, Collection values) { synchronized(data) { for (B value : values) remove(key, value); }} public List get(A key) { synchronized(data) { List list = data.get(key); return list == null ? Collections. emptyList() : list; }} List getOpt(A key) { synchronized(data) { return data.get(key); }} List getAndClear(A key) { synchronized(data) { List l = cloneList(data.get(key)); remove(key); return l; }} // returns actual mutable live list // creates the list if not there List getActual(A key) { synchronized(data) { List list = data.get(key); if (list == null) data.put(key, list = _makeEmptyList()); return list; }} void clean(A key) { synchronized(data) { List list = data.get(key); if (list != null && list.isEmpty()) { fullSize -= l(list); data.remove(key); } }} final public Set keys(){ return keySet(); } public Set keySet() { synchronized(data) { return data.keySet(); }} void remove(A key) { synchronized(data) { fullSize -= l(this.getOpt(key)); data.remove(key); }} final void remove(Pair p){ removePair(p); } void removePair(Pair p) { if (p != null) remove(p.a, p.b); } void remove(A key, B value) { synchronized(data) { List list = data.get(key); if (list != null) { if (list.remove(value)) fullSize--; if (list.isEmpty()) data.remove(key); } }} void clear() { synchronized(data) { data.clear(); }} boolean containsKey(A key) { synchronized(data) { return data.containsKey(key); }} B getFirst(A key) { synchronized(data) { List list = get(key); return list.isEmpty() ? null : list.get(0); }} void addAll(MultiMap map) { putAll(map); } void putAll(MultiMap map) { synchronized(data) { for (A key : map.keySet()) putAll(key, map.get(key)); }} void putAll(Map map) { synchronized(data) { if (map != null) for (Map.Entry e : map.entrySet()) put(e.getKey(), e.getValue()); }} final public int keyCount(){ return keysSize(); } public int keysSize() { synchronized(data) { return l(data); }} final public int fullSize(){ return size(); } public int size() { synchronized(data) { return fullSize; }} // expensive operation List reverseGet(B b) { synchronized(data) { List l = new ArrayList(); for (A key : data.keySet()) if (data.get(key).contains(b)) l.add(key); return l; }} Map> asMap() { synchronized(data) { return cloneMap(data); }} boolean isEmpty() { synchronized(data) { return data.isEmpty(); }} // override in subclasses List _makeEmptyList() { return new ArrayList(); } // returns live lists Collection> allLists() { synchronized(data) { return new ArrayList(data.values()); } } Collection> values() { return allLists(); } List allValues() { return concatLists(data.values()); } Object mutex() { return data; } public String toString() { return "mm" + str(data); } } /* * @(#)WeakHashMap.java 1.5 98/09/30 * * Copyright 1998 by Sun Microsystems, Inc., * 901 San Antonio Road, Palo Alto, California, 94303, U.S.A. * All rights reserved. * * This software is the confidential and proprietary information * of Sun Microsystems, Inc. ("Confidential Information"). You * shall not disclose such Confidential Information and shall use * it only in accordance with the terms of the license agreement * you entered into with Sun. */ // From https://github.com/mernst/plume-lib/blob/df0bfafc3c16848d88f4ea0ef3c8bf3367ae085e/java/src/plume/WeakHasherMap.java static final class WeakHasherMap extends AbstractMap implements Map { private Hasher hasher = null; /*@Pure*/ private boolean keyEquals(Object k1, Object k2) { return (hasher==null ? k1.equals(k2) : hasher.equals(k1, k2)); } /*@Pure*/ private int keyHashCode(Object k1) { return (hasher==null ? k1.hashCode() : hasher.hashCode(k1)); } // The WeakKey class can't be static because it depends on the hasher. // That in turn means that its methods can't be static. // However, I need to be able to call the methods such as create() that // were static in the original version of this code. // This finesses that. private /*@Nullable*/ WeakKey WeakKeyCreate(K k) { if (k == null) return null; else return new WeakKey(k); } private /*@Nullable*/ WeakKey WeakKeyCreate(K k, ReferenceQueue q) { if (k == null) return null; else return new WeakKey(k, q); } // Cannot be a static class: uses keyHashCode() and keyEquals() private final class WeakKey extends WeakReference { private int hash; /* Hashcode of key, stored here since the key may be tossed by the GC */ private WeakKey(K k) { super(k); hash = keyHashCode(k); } private /*@Nullable*/ WeakKey create(K k) { if (k == null) return null; else return new WeakKey(k); } private WeakKey(K k, ReferenceQueue q) { super(k, q); hash = keyHashCode(k); } private /*@Nullable*/ WeakKey create(K k, ReferenceQueue q) { if (k == null) return null; else return new WeakKey(k, q); } /* A WeakKey is equal to another WeakKey iff they both refer to objects that are, in turn, equal according to their own equals methods */ /*@Pure*/ @Override public boolean equals(/*@Nullable*/ Object o) { if (o == null) return false; // never happens if (this == o) return true; // This test is illegal because WeakKey is a generic type, // so use the getClass hack below instead. // if (!(o instanceof WeakKey)) return false; if (!(o.getClass().equals(WeakKey.class))) return false; Object t = this.get(); @SuppressWarnings("unchecked") Object u = ((WeakKey)o).get(); if ((t == null) || (u == null)) return false; if (t == u) return true; return keyEquals(t, u); } /*@Pure*/ @Override public int hashCode() { return hash; } } /* Hash table mapping WeakKeys to values */ private HashMap hash; /* Reference queue for cleared WeakKeys */ private ReferenceQueue queue = new ReferenceQueue(); /* Remove all invalidated entries from the map, that is, remove all entries whose keys have been discarded. This method should be invoked once by each public mutator in this class. We don't invoke this method in public accessors because that can lead to surprising ConcurrentModificationExceptions. */ @SuppressWarnings("unchecked") private void processQueue() { WeakKey wk; while ((wk = (WeakKey)queue.poll()) != null) { // unchecked cast hash.remove(wk); } } /* -- Constructors -- */ /** * Constructs a new, empty WeakHashMap with the given * initial capacity and the given load factor. * * @param initialCapacity the initial capacity of the * WeakHashMap * * @param loadFactor the load factor of the WeakHashMap * * @throws IllegalArgumentException If the initial capacity is less than * zero, or if the load factor is * nonpositive */ public WeakHasherMap(int initialCapacity, float loadFactor) { hash = new HashMap(initialCapacity, loadFactor); } /** * Constructs a new, empty WeakHashMap with the given * initial capacity and the default load factor, which is * 0.75. * * @param initialCapacity the initial capacity of the * WeakHashMap * * @throws IllegalArgumentException If the initial capacity is less than * zero */ public WeakHasherMap(int initialCapacity) { hash = new HashMap(initialCapacity); } /** * Constructs a new, empty WeakHashMap with the default * capacity and the default load factor, which is 0.75. */ public WeakHasherMap() { hash = new HashMap(); } /** * Constructs a new, empty WeakHashMap with the default * capacity and the default load factor, which is 0.75. * The WeakHashMap uses the specified hasher for hashing * keys and comparing them for equality. * @param h the Hasher to use when hashing values for this map */ public WeakHasherMap(Hasher h) { hash = new HashMap(); hasher = h; } /* -- Simple queries -- */ /** * Returns the number of key-value mappings in this map. * Note: In contrast to most implementations of the * Map interface, the time required by this operation is * linear in the size of the map. */ /*@Pure*/ @Override public int size() { return entrySet().size(); } /** * Returns true if this map contains no key-value mappings. */ /*@Pure*/ @Override public boolean isEmpty() { return entrySet().isEmpty(); } /** * Returns true if this map contains a mapping for the * specified key. * * @param key the key whose presence in this map is to be tested */ /*@Pure*/ @Override public boolean containsKey(Object key) { @SuppressWarnings("unchecked") K kkey = (K) key; return hash.containsKey(WeakKeyCreate(kkey)); } /* -- Lookup and modification operations -- */ /** * Returns the value to which this map maps the specified key. * If this map does not contain a value for this key, then return * null. * * @param key the key whose associated value, if any, is to be returned */ /*@Pure*/ @Override public /*@Nullable*/ V get(Object key) { // type of argument is Object, not K @SuppressWarnings("unchecked") K kkey = (K) key; return hash.get(WeakKeyCreate(kkey)); } /** * Updates this map so that the given key maps to the given * value. If the map previously contained a mapping for * key then that mapping is replaced and the previous value is * returned. * * @param key the key that is to be mapped to the given * value * @param value the value to which the given key is to be * mapped * * @return the previous value to which this key was mapped, or * null if if there was no mapping for the key */ @Override public V put(K key, V value) { processQueue(); return hash.put(WeakKeyCreate(key, queue), value); } /** * Removes the mapping for the given key from this map, if * present. * * @param key the key whose mapping is to be removed * * @return the value to which this key was mapped, or null if * there was no mapping for the key */ @Override public V remove(Object key) { // type of argument is Object, not K processQueue(); @SuppressWarnings("unchecked") K kkey = (K) key; return hash.remove(WeakKeyCreate(kkey)); } /** * Removes all mappings from this map. */ @Override public void clear() { processQueue(); hash.clear(); } /* -- Views -- */ /* Internal class for entries */ // This can't be static, again because of dependence on hasher. @SuppressWarnings("TypeParameterShadowing") private final class Entry implements Map.Entry { private Map.Entry ent; private K key; /* Strong reference to key, so that the GC will leave it alone as long as this Entry exists */ Entry(Map.Entry ent, K key) { this.ent = ent; this.key = key; } /*@Pure*/ @Override public K getKey() { return key; } /*@Pure*/ @Override public V getValue() { return ent.getValue(); } @Override public V setValue(V value) { return ent.setValue(value); } /*@Pure*/ private boolean keyvalEquals(K o1, K o2) { return (o1 == null) ? (o2 == null) : keyEquals(o1, o2); } /*@Pure*/ private boolean valEquals(V o1, V o2) { return (o1 == null) ? (o2 == null) : o1.equals(o2); } /*@Pure*/ @SuppressWarnings("NonOverridingEquals") public boolean equals(Map.Entry e /* Object o*/) { // if (! (o instanceof Map.Entry)) return false; // Map.Entry e = (Map.Entry)o; return (keyvalEquals(key, e.getKey()) && valEquals(getValue(), e.getValue())); } /*@Pure*/ @Override public int hashCode() { V v; return (((key == null) ? 0 : keyHashCode(key)) ^ (((v = getValue()) == null) ? 0 : v.hashCode())); } } /* Internal class for entry sets */ private final class EntrySet extends AbstractSet> { Set> hashEntrySet = hash.entrySet(); @Override public Iterator> iterator() { return new Iterator>() { Iterator> hashIterator = hashEntrySet.iterator(); Map.Entry next = null; @Override public boolean hasNext() { while (hashIterator.hasNext()) { Map.Entry ent = hashIterator.next(); WeakKey wk = ent.getKey(); K k = null; if ((wk != null) && ((k = wk.get()) == null)) { /* Weak key has been cleared by GC */ continue; } next = new Entry(ent, k); return true; } return false; } @Override public Map.Entry next() { if ((next == null) && !hasNext()) throw new NoSuchElementException(); Map.Entry e = next; next = null; return e; } @Override public void remove() { hashIterator.remove(); } }; } /*@Pure*/ @Override public boolean isEmpty() { return !(iterator().hasNext()); } /*@Pure*/ @Override public int size() { int j = 0; for (Iterator> i = iterator(); i.hasNext(); i.next()) j++; return j; } @Override public boolean remove(Object o) { processQueue(); if (!(o instanceof Map.Entry)) return false; @SuppressWarnings("unchecked") Map.Entry e = (Map.Entry)o; // unchecked cast Object ev = e.getValue(); WeakKey wk = WeakKeyCreate(e.getKey()); Object hv = hash.get(wk); if ((hv == null) ? ((ev == null) && hash.containsKey(wk)) : hv.equals(ev)) { hash.remove(wk); return true; } return false; } /*@Pure*/ @Override public int hashCode() { int h = 0; for (Iterator> i = hashEntrySet.iterator(); i.hasNext(); ) { Map.Entry ent = i.next(); WeakKey wk = ent.getKey(); Object v; if (wk == null) continue; h += (wk.hashCode() ^ (((v = ent.getValue()) == null) ? 0 : v.hashCode())); } return h; } } private /*@Nullable*/ Set> entrySet = null; /** * Returns a Set view of the mappings in this map. */ /*@SideEffectFree*/ @Override public Set> entrySet() { if (entrySet == null) entrySet = new EntrySet(); return entrySet; } // find matching key K findKey(Object key) { processQueue(); K kkey = (K) key; // TODO: use replacement for HashMap to avoid reflection WeakKey wkey = WeakKeyCreate(kkey); WeakKey found = hashMap_findKey(hash, wkey); return found == null ? null : found.get(); } } static class Pair implements Comparable> { final public Pair setA(A a){ return a(a); } public Pair a(A a) { this.a = a; return this; } final public A getA(){ return a(); } public A a() { return a; } A a; final public Pair setB(B b){ return b(b); } public Pair b(B b) { this.b = b; return this; } final public B getB(){ return b(); } public B b() { return b; } B b; Pair() {} Pair(A a, B b) { this.b = b; this.a = a;} public int hashCode() { return hashCodeFor(a) + 2*hashCodeFor(b); } public boolean equals(Object o) { if (o == this) return true; if (!(o instanceof Pair)) return false; Pair t = (Pair) o; return eq(a, t.a) && eq(b, t.b); } public String toString() { return "<" + a + ", " + b + ">"; } public int compareTo(Pair p) { if (p == null) return 1; int i = ((Comparable) a).compareTo(p.a); if (i != 0) return i; return ((Comparable) b).compareTo(p.b); } } static class Fail extends RuntimeException implements IFieldsToList{ Object[] objects; Fail() {} Fail(Object... objects) { this.objects = objects;}public Object[] _fieldsToList() { return new Object[] {objects}; } Fail(Throwable cause, Object... objects) { super(cause); this.objects = objects; } public String toString() { return joinNemptiesWithColon("Fail", getMessage()); } public String getMessage() { return commaCombine(getCause(), objects); } } static class Rect implements WidthAndHeight , IFieldsToList{ static final String _fieldOrder = "x y w h"; int x; int y; int w; int h; Rect() {} Rect(int x, int y, int w, int h) { this.h = h; this.w = w; this.y = y; this.x = x;} public boolean equals(Object o) { if (!(o instanceof Rect)) return false; Rect __1 = (Rect) o; return x == __1.x && y == __1.y && w == __1.w && h == __1.h; } public int hashCode() { int h = 2543108; h = boostHashCombine(h, _hashCode(x)); h = boostHashCombine(h, _hashCode(y)); h = boostHashCombine(h, _hashCode(w)); h = boostHashCombine(h, _hashCode(h)); return h; } public Object[] _fieldsToList() { return new Object[] {x, y, w, h}; } Rect(Rectangle r) { x = r.x; y = r.y; w = r.width; h = r.height; } Rect(Pt p, int w, int h) { this.h = h; this.w = w; x = p.x; y = p.y; } Rect(Rect r) { x = r.x; y = r.y; w = r.w; h = r.h; } final Rectangle getRectangle() { return new Rectangle(x, y, w, h); } public String toString() { return x + "," + y + " / " + w + "," + h; } final int x1() { return x; } final int y1() { return y; } final int x2() { return x + w; } final int y2() { return y + h; } final boolean contains(Pt p) { return contains(p.x, p.y); } final boolean contains(int _x, int _y) { return _x >= x && _y >= y && _x < x+w && _y < y+h; } final boolean contains(Rectangle r) { return rectContains(this, r); } final boolean empty() { return w <= 0 || h <= 0; } final public int getWidth() { return w; } final public int getHeight() { return h; } final public int area() { return w*h; } WidthAndHeight widthAndHeight() { return main.widthAndHeight(w, h); } } // SSI - Simple Scanline Image // A partial image consisting of exactly one horizontal line per row. // All pixels are of the same color. // The important values are y1 and data static class SSI extends AbstractSSI implements ByteIO, StringIO { SSI() {} // core value (mandatory): first row occupied final public SSI setY1(short y1){ return y1(y1); } public SSI y1(short y1) { this.y1 = y1; return this; } final public short getY1(){ return y1(); } public short y1() { return y1; } short y1; // core value (mandatory): x coordinates per row // x_left is inclusive, x_right is exclusive // all x coordinates are absolute in image // // Order in array: // x_left at y1, x_right at y1, // x_left at y1+1, x_right at y1+1, ,,, final public SSI setData(short[] data){ return data(data); } public SSI data(short[] data) { this.data = data; return this; } final public short[] getData(){ return data(); } public short[] data() { return data; } short[] data; SSI(int y1, int y2) { init(y1, y2); } void init(int y1, int y2) { this.y1 = toShort_enforce(y1); data = newShortArrayOrNull((y2-y1)*2); } // all coordinates passed in are absolute void set(int y, int xLeft, int xRight) { data[(y-y1)*2] = toShort_enforce(xLeft); data[(y-y1)*2+1] = toShort_enforce(xRight); } // all coordinates passed in and out are absolute int getLeft (int y) { return data[(y-y1)*2]; } int getRight(int y) { return data[(y-y1)*2+1]; } // bounds can be calculated quickly from core values & are then cached public Rect bounds_cache; public Rect bounds() { if (bounds_cache == null) bounds_cache = bounds_load(); return bounds_cache;} public Rect bounds_load() { int x1 = Integer.MAX_VALUE, x2 = 0; for (int i = 0; i < l(data); i += 2) { x1 = min(x1, data[i]); x2 = max(x2, data[i+1]); } return rectFromPoints(x1, y1, x2, y2()); } // same with number of pixels int numberOfPixels_cache = -1; public int numberOfPixels() { if (numberOfPixels_cache < 0) { int n = 0; for (int i = 0; i < l(data); i += 2) n += max(0, data[i+1]-data[i]); numberOfPixels_cache = n; } return numberOfPixels_cache; } public int getHeight() { return l(data)/2; } int y2() { return y1+height(); } public boolean contains(Pt p) { return contains(p.x, p.y); } public boolean contains(int x, int y) { if (y < y1) return false; int i = (y-y1)*2; if (i >= l(data)) return false; return x >= data[i] && x < data[i+1]; } SSI color(Color color) { super.color(color); return this; } public SSI hi15color(short hi15color) { super.hi15color(hi15color); return this; } public void drawOn(Graphics2D g) { g.setColor(color()); int h = height(); for (int y = 0; y < h; y++) { int x1 = data[y*2], x2 = data[y*2+1]; if (x1 < x2) g.drawLine(x1, y1+y, x2-1, y1+y); } } // doesn't set a color // TODO public void drawOutline(Graphics2D g) { int h = height(); IntRange last = intRange(0, 0); for (int y = 0; y < h; y++) { IntRange r = intRange(data[y*2], data[y*2+1]); // anything to draw in this line? if (nempty(r)) { if (empty(last)) // draw full line if just starting g.drawLine(r.start, y1+y, r.end-1, y1+y); else { // We make a line from the left boundary that if possible goes only to last.start but is at least 1 pixel wide int xleft = max(r.start, last.start-1); // Same from the right boundary int xright = min(r.end-1, last.end); g.drawLine(r.start, y1+y, xleft, y1+y); g.drawLine(xright, y1+y, r.end-1, y1+y); } } last = r; } } SSI topPart(int nLines) { if (nLines <= 0) return null; SSI ssi = new SSI(y1, toShort_enforce(y1+nLines)).hi15color(hi15color); arrayCopy(data, ssi.data, 0, l(ssi.data)); return ssi; } // an SSI is coherent if all scanlines are non-empty // and the SSI is one region boolean coherent() { return coherent(false); } boolean coherent(boolean withDiagonals) { int h = height(); for (int y = 0; y < h; y++) { int i = y*2; int x1 = data[i], x2 = data[i+1]; if (x1 >= x2) return false; if (y > 0) { int lastx1 = data[i-2], lastx2 = data[i-1]; if (withDiagonals) { lastx1--; lastx2++; } if (!intRangesOverlap(x1, x2, lastx1, lastx2)) return false; } } return true; } public void readWrite(ByteHead head) { head.exchangeShort(() -> hi15color, color -> hi15color = color); head.exchangeShort(() -> y1, y1 -> this.y1 = y1); head.exchangeShort(() -> toShort_enforce(y2()), y2 -> init(y1, y2)); for (int i = 0; i < l(data); i++) { var _i_2 = i; head.exchangeShort(() -> data[_i_2], x -> data[_i_2] = x); } } SSI toSSI() { return this; } public long sizeInInts() { // "s", color, y1, height, data return 4+height()*2; } SSI reduceToInts(int ints) { return topPart((ints-4)/2); } public void readWrite(StringHead head) { head.exchangeLine(() -> toLine(), __1 -> fromLine(__1)); } String toLine() { return spaceCombine("s", colorToString(), y1, height(), toList(data)); } void fromLine(String line) { Iterator it = splitAtSpaceIterator(line); assertEquals("s", nextFromIterator(it)); int y1 = parseInt(nextFromIterator(it)); int h = parseInt(nextFromIterator(it)); init(y1, y1+h); for (int i = 0; i < l(data); i++) data[i] = toShort_enforce(parseInt(nextFromIterator(it))); } } static abstract class F0 { abstract A get(); } static abstract class F1 { abstract B get(A a); } // you still need to implement hasNext() and next() static abstract class IterableIterator implements Iterator, Iterable { public Iterator iterator() { return this; } public void remove() { unsupportedOperation(); } } public static interface IF0 { A get(); } static interface Hasher { int hashCode(A a); boolean equals(A a, A b); } static class CompressToInterpolatedDoubleArray { // raw data to compress (integers) int[] data; // output InterpolatedDoubleArray result; // options final public CompressToInterpolatedDoubleArray setSlopeTolerance(double slopeTolerance){ return slopeTolerance(slopeTolerance); } public CompressToInterpolatedDoubleArray slopeTolerance(double slopeTolerance) { this.slopeTolerance = slopeTolerance; return this; } final public double getSlopeTolerance(){ return slopeTolerance(); } public double slopeTolerance() { return slopeTolerance; } double slopeTolerance = 0.01; // internal IntBuffer indices = new IntBuffer(); DoubleBuffer values = new DoubleBuffer(); CompressToInterpolatedDoubleArray(int[] data) { this.data = data;} InterpolatedDoubleArray get() { int iData = 0; while (iData < data.length) { int startValue = data[iData]; // possible range of actual floating point starting value DoubleRange startValueRange = doubleRange(startValue-0.5, startValue+0.5); // see how far the straight line goes from iData DoubleRange totalSlopeRange = null; int jData; // our straight line ends at jData-1 for (jData = iData+1; jData < data.length; jData++) { double x = data[jData], h = jData-iData; // possible range of actual floating point value DoubleRange xRange = doubleRange(x-0.5, x+0.5); // most generous range for possible slope depending // on possible floating point values at start and end DoubleRange slopeRange = doubleRange( (xRange.start-startValueRange.end)/h, (xRange.end-startValueRange.start)/h); // grow range a little to avoid size 0 ranges slopeRange = growRange(slopeTolerance, slopeRange); //printVars(+iData, +jData, +slopeRange, +totalSlopeRange); if (totalSlopeRange == null) totalSlopeRange = slopeRange; else { slopeRange = intersectRanges(slopeRange, totalSlopeRange); if (empty(slopeRange)) break; else totalSlopeRange = slopeRange; } } indices.add(iData); values.add(data[iData]); iData = max(iData+1, jData-1); } return result = new InterpolatedDoubleArray(indices.toArrayNonNull(), values.toArrayNonNull()); } } static interface IF1 { B get(A a); } static class StringHead implements Closeable { final public StringHead setReadMode(boolean readMode){ return readMode(readMode); } public StringHead readMode(boolean readMode) { this.readMode = readMode; return this; } final public boolean getReadMode(){ return readMode(); } public boolean readMode() { return readMode; } boolean readMode = false; final public StringHead setWriteMode(boolean writeMode){ return writeMode(writeMode); } public StringHead writeMode(boolean writeMode) { this.writeMode = writeMode; return this; } final public boolean getWriteMode(){ return writeMode(); } public boolean writeMode() { return writeMode; } boolean writeMode = false; final public BufferedReader getReader(){ return reader(); } public BufferedReader reader() { return reader; } BufferedReader reader; final public Writer getWriter(){ return writer(); } public Writer writer() { return writer; } Writer writer; StringHead() {} StringHead(Reader reader) { reader(reader); } StringHead(Writer writer) { writer(writer); } StringHead reader(Reader reader) { this.reader = bufferedReader(reader); readMode(true); return this; } StringHead writer(Writer writer) { this.writer = writer; writeMode(true); return this; } void finish() {} String readLine() { String line = readLineFromReader(reader); if (line == null) close(); return line; } void writeLine(String line) { try { writer.write(line); writer.write('\n'); } catch (Exception __e) { throw rethrow(__e); } } void exchangeLine(IF0 getter, IVF1 setter) { if (writeMode()) writeLine(getter.get()); if (readMode()) setter.get(readLine()); } public void close() { try { { cleanUp(reader); reader = null; } { cleanUp(writer); writer = null; } } catch (Exception __e) { throw rethrow(__e); } } void exchange(StringIO writable) { if (writable != null) writable.readWrite(this); } void exchangeAll(Iterable writables) { if (writables != null) for (var writable : writables) exchange(writable); } } static class PersistableThrowable extends DynamicObject { String className; String msg; String stacktrace; PersistableThrowable() {} PersistableThrowable(Throwable e) { if (e == null) className = "Crazy Null Error"; else { className = getClassName(e).replace('/', '.'); msg = e.getMessage(); stacktrace = getStackTrace_noRecord(e); } } public String toString() { return nempty(msg) ? className + ": " + msg : className; } RuntimeException asRuntimeException() { return new Fail(this); } } static interface IVF1 { void get(A a); } static class DoubleBuffer implements Iterable { double[] data; int size; DoubleBuffer() {} DoubleBuffer(int size) { if (size != 0) data = new double[size]; } DoubleBuffer(Iterable l) { addAll(l); } DoubleBuffer(Collection l) { this(l(l)); addAll(l); } DoubleBuffer(double... data) { this.data = data; size = l(data); } void add(double i) { if (size >= lDoubleArray(data)) { data = resizeDoubleArray(data, Math.max(1, toInt(Math.min(maximumSafeArraySize(), lDoubleArray(data)*2L)))); if (size >= data.length) throw fail("DoubleBuffer too large: " + size); } data[size++] = i; } void addAll(Iterable l) { if (l != null) for (double i : l) add(i); } double[] toArray() { return size == 0 ? null : resizeDoubleArray(data, size); } double[] toArrayNonNull() { return unnull(toArray()); } List toList() { return doubleArrayToList(data, 0, size); } List asVirtualList() { return new RandomAccessAbstractList() { public int size() { return size; } public Double get(int i) { return DoubleBuffer.this.get(i); } public Double set(int i, Double val) { Double a = get(i); data[i] = val; return a; } }; } void reset() { size = 0; } void clear() { reset(); } int size() { return size; } boolean isEmpty() { return size == 0; } double get(int idx) { if (idx >= size) throw fail("Index out of range: " + idx + "/" + size); return data[idx]; } void set(int idx, double value) { if (idx >= size) throw fail("Index out of range: " + idx + "/" + size); data[idx] = value; } double popLast() { if (size == 0) throw fail("empty buffer"); return data[--size]; } double last() { return data[size-1]; } double nextToLast() { return data[size-2]; } public String toString() { return squareBracket(joinWithSpace(toList())); } public Iterator iterator() { return new IterableIterator() { int i = 0; public boolean hasNext() { return i < size; } public Double next() { //if (!hasNext()) fail("Index out of bounds: " + i); return data[i++]; } }; } /*public DoubleIterator doubleIterator() { ret new DoubleIterator { int i = 0; public bool hasNext() { ret i < size; } public int next() { //if (!hasNext()) fail("Index out of bounds: " + i); ret data[i++]; } toString { ret "Iterator@" + i + " over " + DoubleBuffer.this; } }; }*/ void trimToSize() { data = resizeDoubleArray(data, size); } int indexOf(double b) { for (int i = 0; i < size; i++) if (data[i] == b) return i; return -1; } double[] subArray(int start, int end) { return subDoubleArray(data, start, min(end, size)); } } interface SizeInInts { long sizeInInts(); } static class PingSourceCancelledException extends RuntimeException implements IFieldsToList{ PingSource pingSource; PingSourceCancelledException() {} PingSourceCancelledException(PingSource pingSource) { this.pingSource = pingSource;} public String toString() { return shortClassName_dropNumberPrefix(this) + "(" + pingSource + ")"; }public Object[] _fieldsToList() { return new Object[] {pingSource}; } } static class Pt implements Comparable, IDoublePt { int x, y; Pt() {} Pt(Point p) { x = p.x; y = p.y; } Pt(int x, int y) { this.y = y; this.x = x;} Point getPoint() { return new Point(x, y); } public boolean equals(Object o) { return o instanceof Pt && x == ((Pt) o).x && y == ((Pt) o).y; } public int hashCode() { return boostHashCombine(x, y); } // compare in scan order public int compareTo(Pt p) { if (y != p.y) return cmp(y, p.y); return cmp(x, p.x); } public String toString() { return x + ", " + y; } double length() { return sqrt(x*x+y*y); } public Pt minus(Pt p) { return ptMinus(this, p); } public double x_double() { return x; } public double y_double() { return y; } } static interface ISetter { void set(A a); } // The idea is to leave max as the actual number of cores the system // has (numberOfCores()), and in case of being fully booked, raise an // alert (customerMustWaitAlert) which can be handled by a strategy // object (different reactions are possible). // If nothing is done in such an event, clients are processed serially // (no guarantees of order), split up among the available threads. /* SYNChronisation order: 1. PooledThread 2. ThreadPool */ static class ThreadPool implements AutoCloseable { int max = numberOfCores(); List all = new ArrayList(); Set used = new HashSet(); Set free = new HashSet(); boolean verbose, retired; // our own ping surce so we can start threads & keep them running class InternalPingSource extends PingSource {} InternalPingSource internalPingSource = new InternalPingSource(); MultiSleeper sleeper = new MultiSleeper(); ThreadPool() {} ThreadPool(int max) { this.max = max;} synchronized int maxSize() { return max; } synchronized int total() { return l(used)+l(free); } transient Set onCustomerMustWaitAlert; public ThreadPool onCustomerMustWaitAlert(Runnable r) { onCustomerMustWaitAlert = createOrAddToSyncLinkedHashSet(onCustomerMustWaitAlert, r); return this; } public ThreadPool removeCustomerMustWaitAlertListener(Runnable r) { main.remove(onCustomerMustWaitAlert, r); return this; } public void customerMustWaitAlert() { if (onCustomerMustWaitAlert != null) for (var listener : onCustomerMustWaitAlert) pcallF_typed(listener); } void fireCustomerMustWaitAlert() { vmBus_send("customerMustWaitAlert", this, currentThread()); customerMustWaitAlert(); } // DOESN'T WAIT. adds action to a thread's queue if nothing is // available immediately. PooledThread acquireThreadOrQueue(Runnable action) { if (action == null) return null; PooledThread t; synchronized(this) { if (_hasFreeAfterCreating()) { t = _firstFreeThread(); markUsed(t); } else t = _anyThread(); } t.addWork(action); // will move it from free to used return t; } // run in synchronized block boolean _hasFreeAfterCreating() { checkNotRetired(); if (nempty(free)) return true; if (total() < max) { PooledThread t = newThread(); all.add(t); free.add(t); return true; } return false; } // WAITS until thread is available PooledThread acquireThreadOrWait(Runnable action) { try { if (action == null) return null; PooledThread t; while (true) { synchronized(this) { if (_hasFreeAfterCreating()) { t = _firstFreeThread(); break; } else _waitWaitWait(); } } t.addWork(action); return t; } catch (Exception __e) { throw rethrow(__e); } } PooledThread _firstFreeThread() { return first(free); } PooledThread _anyThread() { return random(used); } class PooledThread extends Thread { PooledThread(String name) { super(name); } AppendableChain q; synchronized Runnable _grabWorkOrSleep() { try { Runnable r = first(q); if (r == null) { markFree(this); if (verbose) print("Thread sleeps"); synchronized(this) { wait(); } if (verbose) print("Thread woke up"); return null; } q = popFirst(q); return r; } catch (Exception __e) { throw rethrow(__e); } } public void run() { try { pingSource_tl().set(internalPingSource); while (!retired()) { ping(); Runnable r = _grabWorkOrSleep(); if (verbose) print(this + " work: " + r); if (r != null) try { if (verbose) print(this + " running: " + r); r.run(); pingSource_tl().set(internalPingSource); if (verbose) print(this + " done"); } catch (Throwable e) { pingSource_tl().set(internalPingSource); if (verbose) print(this + " error"); printStackTrace(e); } finally { pingSource_tl().set(internalPingSource); if (verbose) print("ThreadPool finally"); } } } catch (Exception __e) { throw rethrow(__e); } } synchronized boolean isEmpty() { return empty(q); } // append to q (do later) void addWork(Runnable r) { if (verbose) print("Added work to " + this + ": " + r); synchronized(this) { q = chainPlus(q, r); notifyAll(); } } } PooledThread newThread() { PooledThread t = new PooledThread("Thread Pool Inhabitant " + n2(total()+1)); t.start(); return t; } synchronized void markFree(PooledThread t) { used.remove(t); free.add(t); notifyAll(); } synchronized void markUsed(PooledThread t) { free.remove(t); used.add(t); } synchronized public String toString() { return retired() ? "Retired ThreadPool" : "ThreadPool " + roundBracket(commaCombine( n2(used) + " used out of " + n2(total()), max <= total() ? null : "could grow to " + n2(max))); } synchronized boolean retired() { return retired; } synchronized void retire() { if (verbose) print("ThreadPool Retiring"); retired = true; for (var thread : free) syncNotifyAll(thread); // wake it up so it exits } void checkNotRetired() { if (retired()) throw fail("retired"); } // We could do a soft-close here (stop the idle threads, let running threads finish, then end those too, stop accepting new orders) // or a hard close (interrupt all threads, stop accepting new orders) synchronized public void close() { try { retire(); } catch (Exception __e) { throw rethrow(__e); } } // run in synchronized block void _waitWaitWait() { try { do { fireCustomerMustWaitAlert(); wait(); checkNotRetired(); } while (empty(free)); } catch (Exception __e) { throw rethrow(__e); } } void dO(String text, Runnable r) { if (r == null) return; new PingSource(this, text).dO(r); } ISleeper_v2 sleeper() { return sleeper; } } // it's unclear whether the end is inclusive or exclusive // (usually exclusive I guess) static class IntRange { int start, end; IntRange() {} IntRange(int start, int end) { this.end = end; this.start = start;} IntRange(IntRange r) { start = r.start; end = r.end; } public boolean equals(Object o) { return stdEq2(this, o); } public int hashCode() { return stdHash2(this); } final int length() { return end-start; } final boolean empty() { return start >= end; } final boolean isEmpty() { return start >= end; } static String _fieldOrder = "start end"; public String toString() { return "[" + start + ";" + end + "]"; } } // We use big-endian as DataOutputStream does static class ByteHead /*is DataOutput*/ { final public ByteHead setReadMode(boolean readMode){ return readMode(readMode); } public ByteHead readMode(boolean readMode) { this.readMode = readMode; return this; } final public boolean getReadMode(){ return readMode(); } public boolean readMode() { return readMode; } boolean readMode = false; final public ByteHead setWriteMode(boolean writeMode){ return writeMode(writeMode); } public ByteHead writeMode(boolean writeMode) { this.writeMode = writeMode; return this; } final public boolean getWriteMode(){ return writeMode(); } public boolean writeMode() { return writeMode; } boolean writeMode = false; final public InputStream getInputStream(){ return inputStream(); } public InputStream inputStream() { return inputStream; } InputStream inputStream; final public OutputStream getOutputStream(){ return outputStream(); } public OutputStream outputStream() { return outputStream; } OutputStream outputStream; final public ByteHead setByteCounter(long byteCounter){ return byteCounter(byteCounter); } public ByteHead byteCounter(long byteCounter) { this.byteCounter = byteCounter; return this; } final public long getByteCounter(){ return byteCounter(); } public long byteCounter() { return byteCounter; } long byteCounter; ByteHead() {} ByteHead(InputStream inputStream) { inputStream(inputStream); } ByteHead(OutputStream outputStream) { outputStream(outputStream); } ByteHead inputStream(InputStream inputStream) { this.inputStream = inputStream; readMode(true); return this; } ByteHead outputStream(OutputStream outputStream) { this.outputStream = outputStream; writeMode(true); return this; } void write(byte[] data) { try { ensureWriteMode(); { if (outputStream != null) outputStream.write(data); } byteCounter += data.length; } catch (Exception __e) { throw rethrow(__e); } } void writeLong(long l) { writeInt((int) (l >> 32)); writeInt((int) l); } void writeInt(int i) { write(i >> 24); write(i >> 16); write(i >> 8); write(i); } void writeShort(int i) { write(i >> 8); write(i); } final void write(int i){ writeByte(i); } void writeByte(int i) { try { ensureWriteMode(); { if (outputStream != null) outputStream.write(i); } byteCounter++; } catch (Exception __e) { throw rethrow(__e); } } void writeASCII(char c) { write(toASCII(c)); } void writeASCII(String s) { write(toASCII(s)); } void exchangeASCII(String s) { exchangeConstantBytes(toASCII(s)); } void exchangeConstantBytes(byte[] data) { for (int i = 0; i < l(data); i++) exchangeByte(data[i]); } long readLong() { long i = readInt() << 32; return i | (readInt() & 0xFFFFFFFFL); } int readInt() { int i = read() << 24; i |= read() << 16; i |= read() << 8; return i | read(); } short readShort() { int i = read() << 8; return (short) (i | read()); } // -1 for EOF final int read(){ return readByte(); } int readByte() { try { ensureReadMode(); ++byteCounter; return inputStream.read(); } catch (Exception __e) { throw rethrow(__e); } } void ensureReadMode() { if (!readMode) throw fail("Not in read mode"); } void ensureWriteMode() { if (!writeMode) throw fail("Not in write mode"); } // exchange = read or write depending on mode void exchangeByte(byte getter, IVF1 setter) { exchangeByte(() -> getter, setter); } void exchangeByte(IF0 getter, IVF1 setter) { if (writeMode()) writeByte(getter.get()); if (readMode()) setter.get(toUByte(readByte())); } void exchangeShort(IF0 getter, IVF1 setter) { if (writeMode()) writeShort(getter.get()); if (readMode()) setter.get(readShort()); } void exchangeLong(IVar var) { exchangeLong(var.getter(), var.setter()); } void exchangeLong(IF0 getter, IVF1 setter) { if (writeMode()) writeLong(getter.get()); if (readMode()) setter.get(readLong()); } void exchangeByte(byte i) { exchangeByte(() -> i, j -> assertEquals(i, j)); } void exchangeInt(int i) { exchangeInt(() -> i, j -> assertEquals(i, j)); } void exchangeInt(IF0 getter, IVF1 setter) { if (writeMode()) writeInt(getter.get()); if (readMode()) setter.get(readInt()); } void exchange(ByteIO writable) { if (writable != null) writable.readWrite(this); } void exchangeAll(Iterable writables) { if (writables != null) for (var writable : writables) exchange(writable); } // write size in bytes of element first (as int), // then the element itself. // upon reading, size is actually ignored. void exchangeWithSize(ByteIO writable) { if (writeMode()) { byte[] data = writable.saveToByteArray(); writeInt(l(data)); write(data); } if (readMode()) { int n = readInt(); writable.readWrite(this); } } void finish() {} } interface StringIO { void readWrite(StringHead head); default String saveToString() { return saveToString(new StringHead()); } default String saveToString(StringHead head) { var writer = stringWriter(); head.writer(writer); readWrite(head); head.finish(); return str(writer); } default File saveToTextFile(File file) { Writer out = bufferedFileWriter(file); try { var head = new StringHead(out); readWrite(head); head.finish(); return file; } finally { _close(out); }} default StringIO fromString(String data){ return load(data); } default StringIO load(String data) { readWrite(new StringHead(stringReader(data))); return this; } default StringIO loadTextFile(File file) { var in = bufferedReader(file); try { readWrite(new StringHead(in)); return this; } finally { _close(in); }} } interface ByteIO { void readWrite(ByteHead head); default byte[] saveAsByteArray(){ return saveToByteArray(); } default byte[] toByteArray(){ return saveToByteArray(); } default byte[] saveToByteArray() { return saveToByteArray(new ByteHead()); } default byte[] saveAsByteArray(ByteHead head){ return saveToByteArray(head); } default byte[] toByteArray(ByteHead head){ return saveToByteArray(head); } default byte[] saveToByteArray(ByteHead head) { var baos = byteArrayOutputStream(); head.outputStream(baos); readWrite(head); head.finish(); return baos.toByteArray(); } default String toHexString() { return main.toHexString(toByteArray()); } default File saveToFile(File file) { OutputStream out = bufferedFileOutputStream(file); try { var head = new ByteHead(out); readWrite(head); head.finish(); return file; } finally { _close(out); }} default ByteIO fromByteArray(byte[] data){ return load(data); } default ByteIO load(byte[] data) { readWrite(new ByteHead(new ByteArrayInputStream(data))); return this; } default ByteIO load(File file) { InputStream in = bufferedInputStream(file); try { readWrite(new ByteHead(in)); return this; } finally { _close(in); }} } final static class DoubleRange implements Comparable { final public double getStart(){ return start(); } public double start() { return start; } double start; final public double getEnd(){ return end(); } public double end() { return end; } double end; DoubleRange() {} DoubleRange(double start, double end) { this.end = end; this.start = start;} public boolean equals(Object o) { return stdEq2(this, o); } public int hashCode() { return stdHash2(this); } double length() { return end-start; } boolean isEmpty() { return start >= end; } double center() { return (start+end)/2; } static String _fieldOrder = "start end"; public String toString() { return "[" + start + ";" + end + "]"; } @Override public int compareTo(DoubleRange r) { int c = cmp(start, r.start); if (c != 0) return c; return cmp(end, r.end); } } interface INumberOfPixels { int numberOfPixels(); } static interface IFieldsToList { Object[] _fieldsToList(); } static interface ISleeper_v2 { Sleeping doLater(Timestamp targetTime, Runnable r); public default Sleeping doAfter(double seconds, Runnable r) { return doLater(tsNow().plusSeconds(seconds), r); } } interface IntSize { int size(); } static class IntBuffer implements Iterable { int[] data; int size; IntBuffer() {} IntBuffer(int size) { if (size != 0) data = new int[size]; } IntBuffer(Iterable l) { if (l instanceof Collection) allocate(((Collection) l).size()); addAll(l); } void add(int i) { if (size >= lIntArray(data)) { data = resizeIntArray(data, Math.max(1, toInt(Math.min(maximumSafeArraySize(), lIntArray(data)*2L)))); if (size >= data.length) throw fail("IntBuffer too large: " + size); } data[size++] = i; } void allocate(int n) { data = resizeIntArray(data, max(n, size())); } void setSize(int n) { data = resizeIntArray(data, n); size = min(l(data), size); } void addAll(Iterable l) { if (l != null) for (int i : l) add(i); } void addAll(int... l) { if (l != null) for (int i : l) add(i); } // Note: may return the internal array final int[] toIntArray(){ return toArray(); } int[] toArray() { return size == 0 ? null : resizeIntArray(data, size); } int[] toArrayNonNull() { return unnull(toArray()); } // abandoned version /*L toList() { ret intArrayToList(data, 0, size); }*/ // now all these return a virtual list final List asList(){ return toList(); } final List asVirtualList(){ return toList(); } List toList() { return new RandomAccessAbstractList() { public int size() { return size; } public Integer get(int i) { return IntBuffer.this.get(i); } public Integer set(int i, Integer val) { Integer a = get(i); data[i] = val; return a; } }; } void reset() { size = 0; } void clear() { reset(); } int size() { return size; } boolean isEmpty() { return size == 0; } int get(int idx) { if (idx >= size) throw fail("Index out of range: " + idx + "/" + size); return data[idx]; } void set(int idx, int value) { if (idx >= size) throw fail("Index out of range: " + idx + "/" + size); data[idx] = value; } int popLast() { if (size == 0) throw fail("empty buffer"); return data[--size]; } int last() { return data[size-1]; } int nextToLast() { return data[size-2]; } public String toString() { return squareBracket(joinWithSpace(toList())); } public Iterator iterator() { return new IterableIterator() { int i = 0; public boolean hasNext() { return i < size; } public Integer next() { //if (!hasNext()) fail("Index out of bounds: " + i); return data[i++]; } }; } public IntegerIterator integerIterator() { return new IntegerIterator() { int i = 0; public boolean hasNext() { return i < size; } public int next() { //if (!hasNext()) fail("Index out of bounds: " + i); return data[i++]; } public String toString() { return "Iterator@" + i + " over " + IntBuffer.this; } }; } void trimToSize() { data = resizeIntArray(data, size); } } interface IMultiMap { public Set keySet(); public Collection get(A a); public int size(); public int keyCount(); } interface G2Drawable { void drawOn(Graphics2D g); default void drawOn(BufferedImage img) { drawOn(img.createGraphics()); } } static interface IVar extends IF0 { void set(A a); A get(); // reified type of value (if available) default Class getType() { return null; } default IF0 getter() { return () -> get(); } default IVF1 setter() { return __1 -> set(__1); } default boolean has() { return get() != null; } default void clear() { set(null); } } static interface WidthAndHeight { default int w(){ return getWidth(); } default int width(){ return getWidth(); } int getWidth(); default int h(){ return getHeight(); } default int height(){ return getHeight(); } int getHeight(); public default Rect bounds() { return rect(0, 0, getWidth(), getHeight()); } default int area() { return toInt(areaAsLong()); } default long areaAsLong() { return longMul(w(), h()); } } interface HasBounds extends WidthAndHeight { Rect bounds(); default int getWidth() { return bounds().h; } default int getHeight() { return bounds().w; } } abstract static class Sleeping implements AutoCloseable , IFieldsToList{ Timestamp targetTime; Runnable action; Sleeping() {} Sleeping(Timestamp targetTime, Runnable action) { this.action = action; this.targetTime = targetTime;} public String toString() { return shortClassName_dropNumberPrefix(this) + "(" + targetTime + ", " + action + ")"; }public Object[] _fieldsToList() { return new Object[] {targetTime, action}; } long remainingMS() { return targetTime.minus(tsNow()); } } // AppendableChain has one "smart" head element (with size counter // and pointer to the chain's last element), all the other nodes are // maximally simple (MinimalChain). // This allows O(1) front insertion, front removal and back insertion // (not removal at the back though) which is fine for what I need this // for (event queues). // // Stefan Reich, Oct 21 static class AppendableChain extends MinimalChain implements Iterable, IntSize { MinimalChain last; // pointer to last element in chain (which may be us) final public int getSize(){ return size(); } public int size() { return size; } int size; // total length of chain AppendableChain() {} // only used internally AppendableChain(A element) { this.element = element; size = 1; last = this; } // intermediate constructor called by itemPlusChain() AppendableChain(A element, AppendableChain next) { this.next = next; this.element = element; if (next == null) return; MinimalChain b = new MinimalChain(); b.element = next.element; b.next = next.next; this.next = b; last = next.last; size = next.size+1; } public String toString() { return str(toList()); } // append at the end boolean add(A a) { MinimalChain newLast = new MinimalChain(a); last.next = newLast; last = newLast; ++size; return true; } // drop first element AppendableChain popFirst() { if (next == null) return null; element = next.element; if (last == next) last = this; next = next.next; --size; return this; } ArrayList toList() { ArrayList l = emptyList(size); MinimalChain c = this; while (c != null) { l.add(c.element); c = c.next; } return l; } //public Iterator iterator() { ret toList().iterator(); } class ACIt extends IterableIterator < A > { MinimalChain c = AppendableChain.this; public boolean hasNext() { return c != null; } public A next() { var a = c.element; c = c.next; return a; } } public IterableIterator iterator() { return new ACIt(); } } static class MultiSleeper extends RestartableCountdown implements ISleeper_v2 { TreeMultiMap entries = new TreeMultiMap(); void check() { var time = nextWakeUpTime(); var action = firstValue(entries); setTargetTime(time == null ? 0 : time.sysTime(), new Runnable() { public void run() { try { List toCall; synchronized(MultiSleeper.this) { toCall = entries.get(time); entries.remove(time); } check(); pcallFAll(toCall); } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "List toCall;\r\n synchronized(MultiSleeper.this) {\r\n toCa..."; }}); } synchronized void removeEntry(Timestamp targetTime, Runnable action) { entries.remove(targetTime, action); } // API synchronized Timestamp nextWakeUpTime() { return firstKey(entries); } public synchronized Sleeping doLater(Timestamp targetTime, Runnable r) { if (r == null || targetTime == null) return null; targetTime = max(targetTime, tsNow()); entries.put(targetTime, r); check(); return new Sleeping(targetTime, r) { public void close() { try { removeEntry(targetTime, r); } catch (Exception __e) { throw rethrow(__e); } } }; } } interface IDoublePt { public double x_double(); public double y_double(); } abstract static class RandomAccessAbstractList extends AbstractList implements RandomAccess { } abstract static class IntegerIterator { abstract boolean hasNext(); abstract int next(); } static class Timestamp implements Comparable , IFieldsToList{ long date; Timestamp(long date) { this.date = date;} public boolean equals(Object o) { if (!(o instanceof Timestamp)) return false; Timestamp __1 = (Timestamp) o; return date == __1.date; } public int hashCode() { int h = 2059094262; h = boostHashCombine(h, _hashCode(date)); return h; } public Object[] _fieldsToList() { return new Object[] {date}; } Timestamp() { date = now(); } Timestamp(Date date) { if (date != null) this.date = date.getTime(); } long unixDate() { return date; } long unixSeconds() { return unixDate()/1000; } public String toString() { return formatLocalDateWithSeconds(date); } // Hmm. Should Timestamp(0) be equal to null? Question, questions... public int compareTo(Timestamp t) { return t == null ? 1 : cmp(date, t.date); } Timestamp plus(Seconds seconds) { return plus(seconds == null ? null : seconds.getDouble()); } final Timestamp plusSeconds(double seconds){ return plus(seconds); } Timestamp plus(double seconds) { return new Timestamp(date+toMS(seconds)); } // returns milliseconds long minus(Timestamp ts) { return unixDate()-ts.unixDate(); } long sysTime() { return clockTimeToSystemTime(date); } Duration minusAsDuration(Timestamp ts) { return Duration.ofMillis(minus(ts)); } } static class MinimalChain implements Iterable { A element; MinimalChain next; MinimalChain() {} MinimalChain(A element) { this.element = element;} MinimalChain(A element, MinimalChain next) { this.next = next; this.element = element;} public String toString() { return str(toList()); } ArrayList toList() { ArrayList l = new ArrayList(); MinimalChain c = this; while (c != null) { l.add(c.element); c = c.next; } return l; } void setElement(A a) { element = a; } void setNext(MinimalChain next) { this.next = next; } // TODO: optimize public Iterator iterator() { return toList().iterator(); } A get() { return element; } } static class RestartableCountdown implements AutoCloseable { java.util.Timer timer; long targetTime; // in sys time long /*firings,*/ totalSleepTime; // stats synchronized void setTargetTime(long targetTime, Runnable action) { if (targetTime <= 0) stop(); else if (targetTime != this.targetTime) { start(targetTime-sysNow(), action); this.targetTime = targetTime; } } // stops the countdown and restarts it synchronized void start(long delayMS, Object action) { stop(); if (delayMS <= 0) { startThread(new Runnable() { public void run() { try { callF(action); } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "callF(action);"; }}); } else { totalSleepTime += delayMS; timer = doLater_daemon(delayMS, action); targetTime = sysNow()+delayMS; } } void start(double delaySeconds, Object action) { start(toMS(delaySeconds), action); } synchronized void stop() { cancelTimer(timer); timer = null; targetTime = 0; } public void close() { stop(); } } static class Seconds implements Comparable , IFieldsToList{ double seconds; Seconds() {} Seconds(double seconds) { this.seconds = seconds;} public boolean equals(Object o) { if (!(o instanceof Seconds)) return false; Seconds __1 = (Seconds) o; return seconds == __1.seconds; } public int hashCode() { int h = -660217249; h = boostHashCombine(h, _hashCode(seconds)); return h; } public Object[] _fieldsToList() { return new Object[] {seconds}; } final double get(){ return seconds(); } final double getDouble(){ return seconds(); } double seconds() { return seconds; } public String toString() { return formatDouble(seconds, 3) + " s"; } public int compareTo(Seconds s) { return cmp(seconds, s.seconds); } Seconds div(double x) { return new Seconds(get()/x); } Seconds minus(Seconds x) { return new Seconds(get()-x.get()); } } static class TreeMultiMap extends MultiMap { TreeMultiMap() { super(true); } TreeMultiMap(MultiMap map) { this(); putAll(map); } } static Class getClass(String name) { return _getClass(name); } static Class getClass(Object o) { return _getClass(o); } static Class getClass(Object realm, String name) { return _getClass(realm, name); } static boolean classIsExportedTo(Class c, java.lang.Module destModule) { if (c == null || destModule == null) return false; java.lang.Module srcModule = c.getModule(); String packageName = c.getPackageName(); return srcModule.isExported(packageName, destModule); } static boolean isAbstract(Class c) { return (c.getModifiers() & Modifier.ABSTRACT) != 0; } static boolean isAbstract(Method m) { return (m.getModifiers() & Modifier.ABSTRACT) != 0; } static boolean reflection_isForbiddenMethod(Method m) { return m.getDeclaringClass() == Object.class && eqOneOf(m.getName(), "finalize", "clone", "registerNatives"); } static Set allInterfacesImplementedBy(Object o) { return allInterfacesImplementedBy(_getClass(o)); } static Set allInterfacesImplementedBy(Class c) { if (c == null) return null; HashSet set = new HashSet(); allInterfacesImplementedBy_find(c, set); return set; } static void allInterfacesImplementedBy_find(Class c, Set set) { if (c.isInterface() && !set.add(c)) return; do { for (Class intf : c.getInterfaces()) allInterfacesImplementedBy_find(intf, set); } while ((c = c.getSuperclass()) != null); } static Method findMethod(Object o, String method, Object... args) { return findMethod_cached(o, method, args); } static boolean findMethod_checkArgs(Method m, Object[] args, boolean debug) { Class[] types = m.getParameterTypes(); if (types.length != args.length) { if (debug) System.out.println("Bad parameter length: " + args.length + " vs " + types.length); return false; } for (int i = 0; i < types.length; i++) if (!(args[i] == null || isInstanceX(types[i], args[i]))) { if (debug) System.out.println("Bad parameter " + i + ": " + args[i] + " vs " + types[i]); return false; } return true; } static Method findStaticMethod(Class c, String method, Object... args) { Class _c = c; while (c != null) { for (Method m : c.getDeclaredMethods()) { if (!m.getName().equals(method)) continue; if ((m.getModifiers() & Modifier.STATIC) == 0 || !findStaticMethod_checkArgs(m, args)) continue; return m; } c = c.getSuperclass(); } return null; } static boolean findStaticMethod_checkArgs(Method m, Object[] args) { Class[] types = m.getParameterTypes(); if (types.length != args.length) return false; for (int i = 0; i < types.length; i++) if (!(args[i] == null || isInstanceX(types[i], args[i]))) return false; return true; } static String unquote(String s) { if (s == null) return null; if (startsWith(s, '[')) { int i = 1; while (i < s.length() && s.charAt(i) == '=') ++i; if (i < s.length() && s.charAt(i) == '[') { String m = s.substring(1, i); if (s.endsWith("]" + m + "]")) return s.substring(i+1, s.length()-i-1); } } return unquoteSingleOrDoubleQuotes(s); } static List quoteAll(String[] l) { return quoteAll(asList(l)); } static List quoteAll(Collection l) { List x = new ArrayList(); for (String s : l) x.add(quote(s)); return x; } static int _hashCode(Object a) { return a == null ? 0 : a.hashCode(); } static ArrayList toList(A[] a) { return asList(a); } static ArrayList toList(int[] a) { return asList(a); } static ArrayList toList(short[] a) { return asList(a); } static ArrayList toList(Set s) { return asList(s); } static ArrayList toList(Iterable s) { return asList(s); } static boolean arraysEqual(Object[] a, Object[] b) { if (a.length != b.length) return false; for (int i = 0; i < a.length; i++) if (neq(a[i], b[i])) return false; return true; } static Color hi15color(short hi15) { return hi15ToColor_clean(hi15); } static java.awt.Color color(String hex) { return awtColor(hex); } static short colorToHi15(RGB rgb) { return rgbToHi15(rgb); } static short colorToHi15(Color color) { return rgbToHi15(color); } static short colorToHi15(int rgb) { return rgbToHi15(rgb); } static String lower(String s) { return s == null ? null : s.toLowerCase(); } static char lower(char c) { return Character.toLowerCase(c); } static String colorToHex(Color c) { return c == null ? null : new RGB(c).getHexString(); } static double doubleRatio(double x, double y) { return y == 0 ? 0 : x/y; } static double doubleRatio(Seconds x, Seconds y) { return doubleRatio(x.get(), y.get()); } static BetterThreadLocal pingSource_tl_var = new BetterThreadLocal() { @Override public PingSource initialValue() { return ping_v3_pingSourceMaker().get(); } }; static BetterThreadLocal pingSource_tl() { return pingSource_tl_var; } static A last(List l) { return empty(l) ? null : l.get(l.size()-1); } static char last(String s) { return empty(s) ? '#' : s.charAt(l(s)-1); } static byte last(byte[] a) { return l(a) != 0 ? a[l(a)-1] : 0; } static int last(int[] a) { return l(a) != 0 ? a[l(a)-1] : 0; } static double last(double[] a) { return l(a) != 0 ? a[l(a)-1] : 0; } static A last(A[] a) { return l(a) != 0 ? a[l(a)-1] : null; } static A last(Iterator it) { A a = null; while (it.hasNext()) { ping(); a = it.next(); } return a; } static A last(Collection l) { if (l == null) return null; if (l instanceof List) return (A) last((List) l); if (l instanceof SortedSet) return (A) last((SortedSet) l); Iterator it = iterator(l); A a = null; while (it.hasNext()) { ping(); a = it.next(); } return a; } static A last(SortedSet l) { return l == null ? null : l.last(); } static A last(ReverseChain l) { return l == null ? null : l.element; } static int last(IntBuffer buf) { return buf.get(buf.size()-1); } static byte last(ByteBuffer buf) { return buf.get(buf.size()-1); } static double last(DoubleBuffer l) { return l.last(); } static A last(CompactLinkedHashSet set) { return set == null ? null : set.last(); } static double[] toDoubleArray(Collection l) { double[] a = new double[l(l)]; int i = 0; if (a.length != 0) for (double x : l) a[i++] = x; return a; } static double[] toDoubleArray(IntBuffer b) { int n = l(b); double[] a = new double[n]; for (int i = 0; i < n; i++) a[i] = b.get(i); return a; } static int length(Object[] array) { return array == null ? 0 : array.length; } static int length(List list) { return list == null ? 0 : list.size(); } static int length(String s) { return s == null ? 0 : s.length(); } static List takeFirst(List l, int n) { return l(l) <= n ? l : newSubListOrSame(l, 0, n); } static List takeFirst(int n, List l) { return takeFirst(l, n); } static String takeFirst(int n, String s) { return substring(s, 0, n); } static String takeFirst(String s, int n) { return substring(s, 0, n); } static CharSequence takeFirst(int n, CharSequence s) { return subCharSequence(s, 0, n); } static List takeFirst(int n, Iterator it) { if (it == null) return null; List l = new ArrayList(); for (int _repeat_0 = 0; _repeat_0 < n; _repeat_0++) { if (it.hasNext()) l.add(it.next()); else break; } return l; } static List takeFirst(int n, Iterable i) { if (i == null) return null; return i == null ? null : takeFirst(n, i.iterator()); } static List takeFirst(int n, IterableIterator i) { return takeFirst(n, (Iterator) i); } static int[] takeFirst(int n, int[] a) { return takeFirstOfIntArray(n, a); } static short[] takeFirst(int n, short[] a) { return takeFirstOfShortArray(n, a); } static byte[] takeFirst(int n, byte[] a) { return takeFirstOfByteArray(n, a); } static byte[] takeFirst(byte[] a, int n) { return takeFirstOfByteArray(n, a); } static double[] takeFirst(int n, double[] a) { return takeFirstOfDoubleArray(n, a); } static double[] takeFirst(double[] a, int n) { return takeFirstOfDoubleArray(n, a); } static Map putAll(Map a, Map b) { if (a != null && b != null) a.putAll(b); return a; } static MultiMap putAll(MultiMap a, Map b) { if (a != null) a.putAll((Map) b); return a; } static Map putAll(Map a, Object... b) { if (a != null) litmap_impl(a, b); return a; } static void remove(List l, int i) { if (l != null && i >= 0 && i < l(l)) l.remove(i); } static void remove(Collection l, A a) { if (l != null) l.remove(a); } static B remove(Map map, Object a) { return map == null ? null : map.remove(a); } static void remove(BitSet bs, int i) { bs.clear(i); } static A getAndClear(IVar v) { A a = v.get(); v.set(null); return a; } static Set keys(Map map) { return map == null ? new HashSet() : map.keySet(); } // convenience shortcut for keys_gen static Set keys(Object map) { return keys((Map) map); } static Set keys(IMultiMap mm) { return mm.keySet(); } static Set keySet(Map map) { return map == null ? new HashSet() : map.keySet(); } static Set keySet(Object map) { return keys((Map) map); } static Set keySet(MultiMap mm) { return mm.keySet(); } static int keysSize(MultiMap mm) { return lKeys(mm); } static A reverseGet(List l, int idx) { if (l == null || idx < 0) return null; int n = l(l); return idx < n ? l.get(n-1-idx) : null; } static Map cloneMap(Map map) { if (map == null) return new HashMap(); // assume mutex is equal to map synchronized(map) { return map instanceof TreeMap ? new TreeMap((TreeMap) map) // copies comparator : map instanceof LinkedHashMap ? new LinkedHashMap(map) : new HashMap(map); } } static List cloneMap(Iterable l, IF1 f) { List x = emptyList(l); if (l != null) for (A o : cloneList(l)) x.add(f.get(o)); return x; } static Collection values(Map map) { return map == null ? emptyList() : map.values(); } // convenience shortcut for values_gen static Collection values(Object map) { return values((Map) map); } static Collection values(MultiMap mm) { return mm == null ? emptyList() : concatLists(values(mm.data)); } static > List allValues(Map map) { List out = new ArrayList(); for (var l : values(map)) addAll(out, l); return out; } static List concatLists(Iterable... lists) { List l = new ArrayList(); if (lists != null) for (Iterable list : lists) addAll(l, list); return l; } static List concatLists(Collection> lists) { List l = new ArrayList(); if (lists != null) for (Iterable list : lists) addAll(l, list); return l; } static Method hashMap_findKey_method; static A hashMap_findKey(HashMap map, Object key) { try { if (hashMap_findKey_method == null) hashMap_findKey_method = findMethodNamed(HashMap.class, "getNode"); Map.Entry entry = (Map.Entry) hashMap_findKey_method.invoke(map, hashMap_internalHash(key), key); // java.util.Map.Entry entry = (java.util.Map.Entry) call(hash, 'getNode, hashMap_internalHash(key), wkey); return entry == null ? null : entry.getKey(); } catch (Exception __e) { throw rethrow(__e); } } static String a(String noun) { if (eq(noun, "")) return "?"; return ("aeiou".indexOf(noun.charAt(0)) >= 0 ? "an " : "a ") + noun; } static String a(String contents, Object... params) { return hfulltag("a", contents, params); } static String b(Object contents, Object... params) { return tag("b", contents, params); } static int hashCodeFor(Object a) { return a == null ? 0 : a.hashCode(); } static String joinNemptiesWithColon(String... strings) { return joinNempties(": ", strings); } static String joinNemptiesWithColon(Collection strings) { return joinNempties(": ", strings); } static String commaCombine(Object... l) { return joinNemptiesWithComma(flattenCollectionsAndArrays(ll(l))); } static int boostHashCombine(int a, int b) { return a ^ (b + 0x9e3779b9 + (a << 6) + (a >>> 2)); // OLD (changed) 2022/3/10: ret a ^ (b + 0x9e3779b9 + (a << 6) + (a >> 2)); } static boolean contains(Collection c, Object o) { return c != null && c.contains(o); } static boolean contains(Iterable it, Object a) { if (it != null) for (Object o : it) if (eq(a, o)) return true; return false; } static boolean contains(Object[] x, Object o) { if (x != null) for (Object a : x) if (eq(a, o)) return true; return false; } static boolean contains(String s, char c) { return s != null && s.indexOf(c) >= 0; } static boolean contains(String s, String b) { return s != null && s.indexOf(b) >= 0; } static boolean contains(BitSet bs, int i) { return bs != null && bs.get(i); } static boolean contains(Producer p, A a) { if (p != null && a != null) while (true) { A x = p.next(); if (x == null) break; if (eq(x, a)) return true; } return false; } static boolean contains(Rect r, Pt p) { return rectContains(r, p); } static boolean rectContains(int x1, int y1, int w, int h, Pt p) { return p.x >= x1 && p.y >= y1 && p.x < x1+w && p.y < y1+h; } static boolean rectContains(Rect a, Rect b) { return b.x >= a.x && b.y >= a.y && b.x2() <= a.x2() && b.y2() <= a.y2(); } static boolean rectContains(Rect a, Rectangle b) { return rectContains(a, toRect(b)); } static boolean rectContains(Rect a, int x, int y) { return a != null && a.contains(x, y); } static boolean rectContains(Rect a, Pt p) { return a != null && p != null && a.contains(p); } static WidthAndHeight widthAndHeight(BufferedImage image) { return image == null ? null : widthAndHeight(image.getWidth(), image.getHeight()); } static WidthAndHeightImpl widthAndHeight(int w, int h) { return new WidthAndHeightImpl(w, h); } static short[] newShortArrayOrNull(int n) { return n <= 0 ? null : new short[n]; } static int min(int a, int b) { return Math.min(a, b); } static long min(long a, long b) { return Math.min(a, b); } static float min(float a, float b) { return Math.min(a, b); } static float min(float a, float b, float c) { return min(min(a, b), c); } static double min(double a, double b) { return Math.min(a, b); } static double min(double[] c) { double x = Double.MAX_VALUE; for (double d : c) x = Math.min(x, d); return x; } static float min(float[] c) { float x = Float.MAX_VALUE; for (float d : c) x = Math.min(x, d); return x; } static byte min(byte[] c) { byte x = 127; for (byte d : c) if (d < x) x = d; return x; } static short min(short[] c) { short x = 0x7FFF; for (short d : c) if (d < x) x = d; return x; } static int min(int[] c) { int x = Integer.MAX_VALUE; for (int d : c) if (d < x) x = d; return x; } static Rect rectFromPoints(int x1, int y1, int x2, int y2) { return pointsRect(x1, y1, x2, y2); } static Rect rectFromPoints(Pt a, Pt b) { return pointsRect(a.x, a.y, b.x, b.y); } static IntRange intRange(int start, int end) { return new IntRange(start, end); } static void arrayCopy(Object[] a, Object[] b) { arraycopy(a, b); } static void arrayCopy(Object src, Object dest, int destPos, int n) { arrayCopy(src, 0, dest, destPos, n); } static void arrayCopy(Object src, int srcPos, Object dest, int destPos, int n) { arraycopy(src, srcPos, dest, destPos, n); } static boolean intRangesOverlap(IntRange a, IntRange b) { return intersectIntRanges(a, b) != null; } static boolean intRangesOverlap(int a1, int a2, int b1, int b2) { return intRangesOverlap(intRange(a1, a2), intRange(b1, b2)); } static UnsupportedOperationException unsupportedOperation() { throw new UnsupportedOperationException(); } static DoubleRange doubleRange(double start, double end) { return new DoubleRange(start, end); } static DoubleRange growRange(DoubleRange r, double amount) { return r == null ? null : doubleRange(r.start-amount, r.end+amount); } static DoubleRange growRange(double amount, DoubleRange r) { return growRange(r, amount); } static Range intersectRanges(Range a, Range b) { float min = max(a.min, b.min); float max = min(a.max, b.max); return min <= max ? new Range(min, max) : null; } static DoubleRange intersectRanges(DoubleRange a, DoubleRange b) { return intersectDoubleRanges(a, b); } static BufferedReader bufferedReader(Reader r) { return bufferedReader(r, 8192); } static BufferedReader bufferedReader(Reader r, int bufSize) { if (r == null) return null; return r instanceof BufferedReader ? (BufferedReader) r : _registerIOWrap(new BufferedReader(r, bufSize), r); } static BufferedReader bufferedReader(File f) { return utf8bufferedReader(f); } static String readLineFromReader(BufferedReader r) { try { return r.readLine(); } catch (Exception __e) { throw rethrow(__e); } } static void close(AutoCloseable c) { _close(c); } static volatile boolean readLine_noReadLine = false; static String readLine_lastInput; static String readLine_prefix = "[] "; static String readLine() { if (readLine_noReadLine) return null; String s = readLineHidden(); if (s != null) { readLine_lastInput = s; print(readLine_prefix + s); } return s; } static boolean cleanUp_interruptThreads = false; // experimental static void cleanUp(Object c) { if (c == null) return; if (c instanceof AutoCloseable) { close_pcall((AutoCloseable) c); return; } if (c instanceof java.util.Timer) { ((java.util.Timer) c).cancel(); return; } if (c instanceof Collection) { cleanUp((Collection) c); return; } if (c instanceof Map) { for (Object o : keys((Map) c)) cleanUp(o); for (Object o : values((Map) c)) cleanUp(o); ((Map) c).clear(); return; } //if (!(c instanceof Class)) ret; try { // revoke license preCleanUp(c); // unpause setOpt_raw(c, "ping_pauseAll", false); // call custom cleanMeUp() and cleanMeUp_*() functions innerCleanUp(c); // Java spec says finalize should only be called by GC, // but we care to differ. // Edit: Not anymore (illegal access warnings) /*if (isTrue(vmMap_get('callFinalize))) pcallOpt(c, "finalize");*/ // remove all virtual bots (hope this works) List androids = (List) getOpt(c, "record_list"); for (Object android : unnull(androids)) pcallOpt(android, "dispose"); // heck we'll dispose anything // sub-cleanup List classes = (List) (getOpt(c, "hotwire_classes")); if (classes != null) for (WeakReference cc : classes) { try { cleanUp(cc.get()); } catch (Throwable __e) { printStackTrace(__e); }} // interrupt all threads (experimental, they might be doing cleanup?) if (cleanUp_interruptThreads) { List threads = registeredThreads(c); if (nempty(threads)) { print("cleanUp: Interrupting " + n2(threads, "thread") + ": " + joinWithComma(allToString(threads))); interruptThreads(threads); } } } catch (Throwable __e) { printStackTrace(__e); } setOpt_raw(c, "cleaningUp_flag" , false); if (c instanceof Class && ((Class) c).getName().equals("main")) retireClassLoader(((Class) c).getClassLoader()); } static void cleanUp(Collection l) { if (l == null) return; for (Object c : l) cleanUp(c); l.clear(); } static int lDoubleArray(double[] a) { return a == null ? 0 : a.length; } static double[] resizeDoubleArray(double[] a, int n) { if (n == l(a)) return a; double[] b = new double[n]; arraycopy(a, 0, b, 0, min(l(a), n)); return b; } static int toInt(Object o) { if (o == null) return 0; if (o instanceof Number) return ((Number) o).intValue(); if (o instanceof String) return parseInt((String) o); if (o instanceof Boolean) return boolToInt((Boolean) o); throw fail("woot not int: " + getClassName(o)); } static int toInt(long l) { if (l != (int) l) throw fail("Too large for int: " + l); return (int) l; } static int maximumSafeArraySize() { return Integer.MAX_VALUE-8; } static void add(BitSet bs, int i) { bs.set(i); } static boolean add(Collection c, A a) { return c != null && c.add(a); } static void add(Container c, Component x) { addToContainer(c, x); } static long add(AtomicLong l, long b) { return l.addAndGet(b); } static Object[] toArray(Collection c) { return toObjectArray(c); } static A[] toArray(Class type, Iterable c) { return toArray(c, type); } static A[] toArray(Class type, Collection c) { return toArray(c, type); } static A[] toArray(Collection c, Class type) { A[] a = arrayOfType(l(c), type); if (a.length == 0) return a; asList(c).toArray(a); return a; } static A[] toArray(Iterable c, Class type) { var c2 = asList(c); A[] a = arrayOfType(l(c2), type); if (a.length == 0) return a; c2.toArray(a); return a; } // array must have correct length and will be filled static A[] toArray(A[] array, Collection c) { if (array == null || c == null) return null; asList(c).toArray(array); return array; } static ArrayList doubleArrayToList(double[] a) { if (a == null) return null; return doubleArrayToList(a, 0, a.length); } // no range checking on from/to in the interest of speed static ArrayList doubleArrayToList(double[] a, int from, int to) { if (a == null) return null; ArrayList < Double > l = new ArrayList<>(to-from); for (int i = from; i < to; i++) l.add(a[i]); return l; } static List asVirtualList(A[] a) { return wrapArrayAsList(a); } static A set(A o, String field, Object value) { if (o == null) return null; if (o instanceof Class) set((Class) o, field, value); else try { Field f = set_findField(o.getClass(), field); makeAccessible(f); smartSet(f, o, value); } catch (Exception e) { throw new RuntimeException(e); } return o; } static void set(Class c, String field, Object value) { if (c == null) return; try { Field f = set_findStaticField(c, field); makeAccessible(f); smartSet(f, null, value); } catch (Exception e) { throw new RuntimeException(e); } } static Field set_findStaticField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field) && (f.getModifiers() & java.lang.reflect.Modifier.STATIC) != 0) return f; _c = _c.getSuperclass(); } while (_c != null); throw new RuntimeException("Static field '" + field + "' not found in " + c.getName()); } static Field set_findField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field)) return f; _c = _c.getSuperclass(); } while (_c != null); throw new RuntimeException("Field '" + field + "' not found in " + c.getName()); } static void set(BitSet bs, int idx) { { if (bs != null) bs.set(idx); } } static String squareBracket(String s) { return "[" + s + "]"; } static double[] subDoubleArray(double[] b, int start) { return subDoubleArray(b, start, l(b)); } static double[] subDoubleArray(double[] b, int start, int end) { start = max(start, 0); end = min(end, l(b)); if (start == 0 && end == l(b)) return b; if (start >= end) return new double[0]; double[] x = new double[end-start]; System.arraycopy(b, start, x, 0, end-start); return x; } static String shortClassName_dropNumberPrefix(Object o) { return dropNumberPrefix(shortClassName(o)); } static double sqrt(double x) { return Math.sqrt(x); } static Pt ptMinus(Pt a, Pt b) { if (b == null) return a; return new Pt(a.x-b.x, a.y-b.y); } static volatile int numberOfCores_value; static int numberOfCores() { if (numberOfCores_value == 0) numberOfCores_value = Runtime.getRuntime().availableProcessors(); return numberOfCores_value; } static Set createOrAddToSyncLinkedHashSet(Set set, A a) { if (set == null) set = syncLinkedHashSet(); set.add(a); return set; } static A pcallF_typed(F0 f) { try { return f == null ? null : f.get(); } catch (Throwable __e) { printStackTrace(__e); } return null; } static B pcallF_typed(F1 f, A a) { try { return f == null ? null : f.get(a); } catch (Throwable __e) { printStackTrace(__e); } return null; } static void pcallF_typed(VF1 f, A a) { try { { if (f != null) f.get(a); } } catch (Throwable __e) { printStackTrace(__e); } } static void pcallF_typed(IVF1 f, A a) { try { { if (f != null) f.get(a); } } catch (Throwable __e) { printStackTrace(__e); } } static void pcallF_typed(IVF2 f, A a, B b) { try { { if (f != null) f.get(a, b); } } catch (Throwable __e) { printStackTrace(__e); } } static Object pcallF_typed(Runnable r) { try { { if (r != null) r.run(); } } catch (Throwable __e) { printStackTrace(__e); } return null; } static A pcallF_typed(IF0 f) { try { return f == null ? null : f.get(); } catch (Throwable __e) { printStackTrace(__e); } return null; } static B pcallF_typed(IF1 f, A a) { try { return f == null ? null : f.get(a); } catch (Throwable __e) { printStackTrace(__e); } return null; } // runnable = Runnable or String (method name) static Thread newThread(Object runnable) { return new BetterThread(_topLevelErrorHandling(toRunnable(runnable))); } static Thread newThread(Object runnable, String name) { if (name == null) name = defaultThreadName(); return new BetterThread(_topLevelErrorHandling(toRunnable(runnable)), name); } static Thread newThread(String name, Object runnable) { return newThread(runnable, name); } static int random(int n) { return random(n, defaultRandomGenerator()); } static int random(int n, Random r) { return random(r, n); } static int random(Random r, int n) { return n <= 0 ? 0 : getRandomizer(r).nextInt(n); } static double random(double max) { return random()*max; } static double random() { return defaultRandomGenerator().nextInt(100001)/100000.0; } static double random(double min, double max) { return min+random()*(max-min); } // min <= value < max static int random(int min, int max) { return min+random(max-min); } static int random(int min, int max, Random r) { return random(r, min, max); } static int random(Random r, int min, int max) { return min+random(r, max-min); } static A random(List l) { return oneOf(l); } static A random(Collection c) { if (c instanceof List) return random((List) c); int i = random(l(c)); return collectionGet(c, i); } static int random(IntRange r) { return random(r.start, r.end); } static Pair random(Map map) { return entryToPair(random(entries(map))); } static A popFirst(List l) { if (empty(l)) return null; A a = first(l); l.remove(0); return a; } static A popFirst(Collection l) { if (empty(l)) return null; A a = first(l); l.remove(a); return a; } static Pair popFirst(Map map) { if (map == null) return null; var it = map.entrySet().iterator(); if (!it.hasNext()) return null; var p = mapEntryToPair(it.next()); it.remove(); return p; } static List popFirst(int n, List l) { List part = cloneSubList(l, 0, n); removeSubList(l, 0, n); return part; } static AppendableChain popFirst(AppendableChain a) { return a == null ? null : a.popFirst(); } // Yes the nomenclature is a bit illogical static Chain chainPlus(Chain chain, A a) { return new Chain(a, chain); } static Chain chainPlus(Chain chain, A... l) { for (A a : unnullForIteration(l)) chain = chainPlus(chain, a); return chain; } static ReverseChain chainPlus(ReverseChain chain, A a) { return new ReverseChain(chain, a); } static ReverseChain chainPlus(ReverseChain chain, A... l) { for (A a : unnullForIteration(l)) chain = chainPlus(chain, a); return chain; } static AppendableChain chainPlus(AppendableChain chain, A a) { if (chain == null) return new AppendableChain(a); chain.add(a); return chain; } static AppendableChain chainPlus(AppendableChain chain, A... l) { for (A a : unnullForIteration(l)) chain = chainPlus(chain, a); return chain; } static String n2(long l) { return formatWithThousands(l); } static String n2(AtomicLong l) { return n2(l.get()); } static String n2(Collection l) { return n2(l(l)); } static String n2(Map map) { return n2(l(map)); } static String n2(double l, String singular) { return empty(singular) ? str(l) : n2(l, singular, singular + "s"); } static String n2(double l, String singular, String plural) { if (fraction(l) == 0) return n2((long) l, singular, plural); else return l + " " + plural; } static String n2(long l, String singular, String plural) { return n_fancy2(l, singular, plural); } static String n2(long l, String singular) { return empty(singular) ? n2(l) : n_fancy2(l, singular, singular + "s"); } static String n2(Collection l, String singular) { return n2(l(l), singular); } static String n2(Collection l, String singular, String plural) { return n_fancy2(l, singular, plural); } static String n2(Map m, String singular, String plural) { return n_fancy2(m, singular, plural); } static String n2(Map m, String singular) { return n2(l(m), singular); } static String n2(long[] a, String singular) { return n2(l(a), singular); } static String n2(Object[] a, String singular) { return n2(l(a), singular); } static String n2(Object[] a, String singular, String plural) { return n_fancy2(a, singular, plural); } static String n2(IMultiMap mm, String singular) { return n2(mm, singular, singular + "s"); } static String n2(IMultiMap mm, String singular, String plural) { return n_fancy2(l(mm), singular, plural); } static String roundBracket(String s) { return "(" + s + ")"; } static String roundBracket(Object s) { return roundBracket(str(s)); } static void syncNotifyAll(Object o) { if (o != null) synchronized(o) { o.notifyAll(); } } static boolean stdEq2(Object a, Object b) { if (a == null) return b == null; if (b == null) return false; if (a.getClass() != b.getClass()) return false; for (String field : allFields(a)) if (neq(getOpt(a, field), getOpt(b, field))) return false; return true; } static int stdHash2(Object a) { if (a == null) return 0; return stdHash(a, toStringArray(allFields(a))); } static byte[] toASCII(String s) { return s.getBytes(java.nio.charset.StandardCharsets.US_ASCII); } static byte toASCII(char c) { return toASCII(str(new char[] {c}))[0]; } static byte toUByte(int i) { if (!isUByte(i)) throw fail("Not a u-byte: " + i); return (byte) i; } static StringWriter stringWriter() { return new StringWriter(); } static PrintWriter bufferedFileWriter(File f) { return filePrintWriter(f); } static void _close(AutoCloseable c) { if (c != null) try { c.close(); } catch (Throwable e) { // Some classes stupidly throw an exception on double-closing if (c instanceof javax.imageio.stream.ImageOutputStream) return; else throw rethrow(e); } } static Object load(String varName) { readLocally(varName); return get(mc(), varName); } static Object load(String progID, String varName) { readLocally(progID, varName); return get(mc(), varName); } static StringReader stringReader(String s) { return new StringReader(s); } static ByteArrayOutputStream byteArrayOutputStream() { return new ByteArrayOutputStream(); } static String toHexString(byte[] a) { return bytesToHex(a); } static String toHexString(List a) { return bytesToHex(byteListToArray(a)); } static byte[] toByteArray(ByteArrayOutputStream baos) { return baos == null ? null : baos.toByteArray(); } static byte[] toByteArray(Iterator it) { ByteBuffer buf = new ByteBuffer(); while (it.hasNext()) buf.add((byte) it.next().intValue()); return buf.toByteArray(); } static byte[] toByteArray(Collection it) { int n = l(it), i = 0; byte[] a = new byte[n]; for (var x : it) a[i++] = (byte) x.intValue(); return a; } static byte[] toByteArray(Object o) { if (o == null) return null; if (o instanceof byte[]) return ((byte[]) o); if (o instanceof Iterator) return toByteArray((Iterator) o); if (o instanceof Collection) return toByteArray((Collection) ((Collection) o)); // not sure what else to put here throw fail("toByteArray", o); } static BufferedOutputStream bufferedFileOutputStream(File f) { try { return bufferedOutputStream(newFileOutputStream(f)); } catch (Exception __e) { throw rethrow(__e); } } static int bufferedInputStream_bufferSize = 65536; static BufferedInputStream bufferedInputStream(int bufSize, File f) { try { return bufferedInputStream(bufSize, newFileInputStream(f)); } catch (Exception __e) { throw rethrow(__e); } } static BufferedInputStream bufferedInputStream(File f) { try { return bufferedInputStream(newFileInputStream(f)); } catch (Exception __e) { throw rethrow(__e); } } static BufferedInputStream bufferedInputStream(InputStream in) { return new BufferedInputStream(in, bufferedInputStream_bufferSize); } static BufferedInputStream bufferedInputStream(int bufSize, InputStream in) { return new BufferedInputStream(in, bufSize); } static java.util.Timer doLater(long delay, final Object r) { ping(); final java.util.Timer timer = new java.util.Timer(); timer.schedule(timerTask(r, timer), delay); return vmBus_timerStarted(timer); } static java.util.Timer doLater(double delaySeconds, final Object r) { return doLater(toMS(delaySeconds), r); } static Timestamp tsNow() { return new Timestamp(); } static int lIntArray(int[] a) { return a == null ? 0 : a.length; } static int[] resizeIntArray(int[] a, int n) { if (n == lIntArray(a)) return a; int[] b = new int[n]; arraycopy(a, 0, b, 0, Math.min(lIntArray(a), n)); return b; } static int getWidth(Component c) { return c == null ? 0 : (int) swingCall(c, "getWidth"); } static int getHeight(Component c) { return c == null ? 0 : (int) swingCall(c, "getHeight"); } static Rect rect(int x, int y, int w, int h) { return new Rect(x, y, w, h); } static Rect rect(Pt p, int w, int h) { return new Rect(p.x, p.y, w, h); } static Rect rect(int w, int h) { return new Rect(0, 0, w, h); } static long longMul(long a, long b) { return a*b; } static B firstValue(Map map) { return first(values(map)); } static B firstValue(MultiMap map) { return map == null ? null : first(firstValue(map.data)); } static A firstKey(Map map) { return first(keys(map)); } static A firstKey(IMultiMap map) { return map == null ? null : first(map.keySet()); } static long now_virtualTime; static long now() { return now_virtualTime != 0 ? now_virtualTime : System.currentTimeMillis(); } static String formatLocalDateWithSeconds(long time) { return localDateWithSeconds(time); } static String formatLocalDateWithSeconds() { return localDateWithSeconds(); } static BigInteger plus(BigInteger a, BigInteger b) { return a.add(b); } static BigInteger plus(BigInteger a, long b) { return a.add(bigint(b)); } static long plus(long a, long b) { return a+b; } static int plus(int a, int b) { return a+b; } static float plus(float a, float b) { return a+b; } static double plus(double a, double b) { return a+b; } static long toMS(double seconds) { return (long) (seconds*1000); } static long clockTimeToSystemTime(long now) { return now == 0 ? 0 : now + clockToSysTimeDiff(); } static List minus(Collection a, Object... b) { Set set = asSet(b); List l = new ArrayList(); for (Object s : unnull(a)) if (!set.contains(s)) l.add(s); return l; } static BigInteger minus(BigInteger a, BigInteger b) { return a.subtract(b); } static Complex minus(Complex c) { return c == null ? null : complex(-c.re(), -c.im()); } static int minus(int a, int b) { return a-b; } static double minus(double a, double b) { return a-b; } static long sysNow() { ping(); return System.nanoTime()/1000000; } static Thread startThread(Object runnable) { return startThread(defaultThreadName(), runnable); } static Thread startThread(String name, Runnable runnable) { runnable = wrapAsActivity(runnable); return startThread(newThread(runnable, name)); } static Thread startThread(String name, Object runnable) { runnable = wrapAsActivity(runnable); return startThread(newThread(toRunnable(runnable), name)); } static Thread startThread(Thread t) { _registerThread(t); t.start(); return t; } static java.util.Timer doLater_daemon(long delay, final Object r) { final java.util.Timer timer = new java.util.Timer(true); timer.schedule(timerTask(r, timer), delay); return timer; } static java.util.Timer doLater_daemon(double delaySeconds, final Object r) { return doLater_daemon(toMS(delaySeconds), r); } static void cancelTimer(javax.swing.Timer timer) { if (timer != null) timer.stop(); } static void cancelTimer(java.util.Timer timer) { if (timer != null) timer.cancel(); } static void cancelTimer(Object o) { if (o instanceof java.util.Timer) cancelTimer((java.util.Timer) o); else if (o instanceof javax.swing.Timer) cancelTimer((javax.swing.Timer) o); else if (o instanceof AutoCloseable) { try { ((AutoCloseable) o).close(); } catch (Throwable __e) { printStackTrace(__e); }} } static int seconds() { return seconds(java.util.Calendar.getInstance()); } static int seconds(java.util.Calendar c) { return c.get(java.util.Calendar.SECOND); } static String formatDouble(double d, int digits) { String format = digits <= 0 ? "0" : "0." + rep(digits, '#'); return decimalFormatEnglish(format, d); } static String formatDouble(double d) { return str(d); } static String formatDouble(DoubleRange r, int digits) { return r == null ? "null" : "[" + formatDouble(r.start, digits) + ";" + formatDouble(r.end, digits) + "]"; } static boolean eqOneOf(Object o, Object... l) { if (l != null) for (Object x : l) if (eq(o, x)) return true; return false; } static Method findMethod_cached(Object o, String method, Object... args) { try { if (o == null) return null; if (o instanceof Class) { _MethodCache cache = callOpt_getCache((Class) o); List methods = cache.cache.get(method); if (methods != null) for (Method m : methods) if (isStaticMethod(m) && findMethod_checkArgs(m, args, false)) return m; return null; } else { _MethodCache cache = callOpt_getCache(o.getClass()); List methods = cache.cache.get(method); if (methods != null) for (Method m : methods) if (findMethod_checkArgs(m, args, false)) return m; return null; } } catch (Exception __e) { throw rethrow(__e); } } static String unquoteSingleOrDoubleQuotes(String s) { if (s == null) return null; if (s.length() > 1) { char c = s.charAt(0); if (c == '\"' || c == '\'') { int l = endsWith(s, c) ? s.length()-1 : s.length(); StringBuilder sb = new StringBuilder(l-1); for (int i = 1; i < l; i++) { char ch = s.charAt(i); if (ch == '\\') { char nextChar = (i == l - 1) ? '\\' : s.charAt(i + 1); // Octal escape? if (nextChar >= '0' && nextChar <= '7') { String code = "" + nextChar; i++; if ((i < l - 1) && s.charAt(i + 1) >= '0' && s.charAt(i + 1) <= '7') { code += s.charAt(i + 1); i++; if ((i < l - 1) && s.charAt(i + 1) >= '0' && s.charAt(i + 1) <= '7') { code += s.charAt(i + 1); i++; } } sb.append((char) Integer.parseInt(code, 8)); continue; } switch (nextChar) { case '\"': ch = '\"'; break; case '\\': ch = '\\'; break; case 'b': ch = '\b'; break; case 'f': ch = '\f'; break; case 'n': ch = '\n'; break; case 'r': ch = '\r'; break; case 't': ch = '\t'; break; case '\'': ch = '\''; break; // Hex Unicode: u???? case 'u': if (i >= l - 5) { ch = 'u'; break; } int code = Integer.parseInt( "" + s.charAt(i + 2) + s.charAt(i + 3) + s.charAt(i + 4) + s.charAt(i + 5), 16); sb.append(Character.toChars(code)); i += 5; continue; default: ch = nextChar; // added by Stefan } i++; } sb.append(ch); } return sb.toString(); } } return s; // not quoted - return original } static String quote(Object o) { if (o == null) return "null"; return quote(str(o)); } static String quote(String s) { if (s == null) return "null"; StringBuilder out = new StringBuilder((int) (l(s)*1.5+2)); quote_impl(s, out); return out.toString(); } static void quote_impl(String s, StringBuilder out) { out.append('"'); int l = s.length(); for (int i = 0; i < l; i++) { char c = s.charAt(i); if (c == '\\' || c == '"') out.append('\\').append(c); else if (c == '\r') out.append("\\r"); else if (c == '\n') out.append("\\n"); else if (c == '\t') out.append("\\t"); else if (c == '\0') out.append("\\0"); else out.append(c); } out.append('"'); } static Color hi15ToColor_clean(short hi15) { return intToColorOpaque(hi15ToRGBInt_clean(hi15)); } static java.awt.Color awtColor(String hex) { byte[] b = bytesFromHex(dropPrefix("#", hex)); return new Color(ubyteToInt(b[0]), ubyteToInt(b[1]), ubyteToInt(b[2])); } static short rgbToHi15(RGB rgb) { return rgbIntToHi15(rgb.asInt()); } static short rgbToHi15(Color color) { return rgbIntToHi15(colorToInt(color)); } static short rgbToHi15(int rgb) { return rgbIntToHi15(rgb); } static IF0 ping_v3_pingSourceMaker_cache; static IF0 ping_v3_pingSourceMaker() { if (ping_v3_pingSourceMaker_cache == null) ping_v3_pingSourceMaker_cache = ping_v3_pingSourceMaker_load(); return ping_v3_pingSourceMaker_cache;} static IF0 ping_v3_pingSourceMaker_load() { return or((IF0) vm_generalMap_get("ping_v3_pingSourceMaker"), () -> null); } static List newSubListOrSame(List l, int startIndex) { return newSubListOrSame(l, startIndex, l(l)); } static List newSubListOrSame(List l, int startIndex, int endIndex) { if (l == null) return null; int n = l(l); startIndex = max(0, startIndex); endIndex = min(n, endIndex); if (startIndex >= endIndex) return ll(); if (startIndex == 0 && endIndex == n) return l; return cloneList(l.subList(startIndex, endIndex)); } static List newSubListOrSame(List l, IntRange r) { return newSubListOrSame(l, r.start, r.end); } static CharSequence subCharSequence(CharSequence s, int x) { return subCharSequence(s, x, s == null ? 0 : s.length()); } static CharSequence subCharSequence(CharSequence s, int x, int y) { if (s == null) return null; if (x < 0) x = 0; if (x >= s.length()) return ""; if (y < x) y = x; if (y > s.length()) y = s.length(); return s.subSequence(x, y); } static int[] takeFirstOfIntArray(int[] b, int n) { return subIntArray(b, 0, n); } static int[] takeFirstOfIntArray(int n, int[] b) { return takeFirstOfIntArray(b, n); } static short[] takeFirstOfShortArray(short[] b, int n) { return subShortArray(b, 0, n); } static short[] takeFirstOfShortArray(int n, short[] b) { return takeFirstOfShortArray(b, n); } static byte[] takeFirstOfByteArray(byte[] b, int n) { return subByteArray(b, 0, n); } static byte[] takeFirstOfByteArray(int n, byte[] b) { return takeFirstOfByteArray(b, n); } static double[] takeFirstOfDoubleArray(double[] b, int n) { return subDoubleArray(b, 0, n); } static double[] takeFirstOfDoubleArray(int n, double[] b) { return takeFirstOfDoubleArray(b, n); } static HashMap litmap(Object... x) { HashMap map = new HashMap(); litmap_impl(map, x); return map; } static void litmap_impl(Map map, Object... x) { if (x != null) for (int i = 0; i < x.length-1; i += 2) if (x[i+1] != null) map.put(x[i], x[i+1]); } static int lKeys(MultiMap mm) { return mm == null ? 0 : mm.keysSize(); } // This is a bit rough... finds static and non-static methods. static Method findMethodNamed(Object obj, String method) { if (obj == null) return null; if (obj instanceof Class) return findMethodNamed((Class) obj, method); return findMethodNamed(obj.getClass(), method); } static Method findMethodNamed(Class c, String method) { while (c != null) { for (Method m : c.getDeclaredMethods()) if (m.getName().equals(method)) { makeAccessible(m); return m; } c = c.getSuperclass(); } return null; } static int hashMap_internalHash(Object key) { int h; return (key == null) ? 0 : (h = key.hashCode()) ^ (h >>> 16); } static String hfulltag(String tag) { return hfulltag(tag, ""); } static String hfulltag(String tag, Object contents, Object... params) { return hopeningTag(tag, params) + str(contents) + ""; } static String tag(String tag) { return htag(tag); } static String tag(String tag, Object contents, Object... params) { return htag(tag, str(contents), params); } static String tag(String tag, StringBuilder contents, Object... params) { return htag(tag, contents, params); } static String tag(String tag, StringBuffer contents, Object... params) { return htag(tag, contents, params); } static String joinNemptiesWithComma(Object... strings) { return joinNempties(", ", strings); } static String joinNemptiesWithComma(Iterable strings) { return joinNempties(", ", strings); } static List flattenCollectionsAndArrays(Iterable a) { List l = new ArrayList(); for (Object x : a) if (x instanceof Collection) l.addAll(flattenCollectionsAndArrays((Collection) x)); else if (x instanceof Object[]) l.addAll(flattenCollectionsAndArrays(asList((Object[]) x))); else l.add(x); return l; } static Rect toRect(Rectangle r) { return r == null ? null : new Rect(r); } static Rect toRect(RectangularShape r) { return r == null ? null : toRect(r.getBounds()); } static Rect toRect(Rect r) { return r; } static Rect pointsRect(int x1, int y1, int x2, int y2) { return new Rect(x1, y1, x2-x1, y2-y1); } static IntRange intersectIntRanges(IntRange a, IntRange b) { int start = max(a.start, b.start); int end = min(a.end, b.end); return start <= end ? new IntRange(start, end) : null; } static List intersectIntRanges(Iterable l, IntRange b) { return map(l, r -> intersectIntRanges(r, b)); } static DoubleRange intersectDoubleRanges(DoubleRange a, DoubleRange b) { double start = max(a.start, b.start); double end = min(a.end, b.end); return start <= end ? new DoubleRange(start, end) : null; } static A _registerIOWrap(A wrapper, Object wrapped) { return wrapper; } static BufferedReader utf8bufferedReader(InputStream in) { try { return in == null ? null : bufferedReader(_registerIOWrap(new InputStreamReader(in, "UTF-8"), in)); } catch (Exception __e) { throw rethrow(__e); } } static BufferedReader utf8bufferedReader(File f) { try { return utf8bufferedReader(newFileInputStream(f)); } catch (Exception __e) { throw rethrow(__e); } } static String readLineHidden() { try { if (get(javax(), "readLine_reader") == null) set(javax(), "readLine_reader" , new BufferedReader(new InputStreamReader(System.in, "UTF-8"))); try { return ((BufferedReader) get(javax(), "readLine_reader")).readLine(); } finally { consoleClearInput(); } } catch (Exception __e) { throw rethrow(__e); } } static void close_pcall(AutoCloseable c) { if (c != null) { try { c.close(); } catch (Throwable __e) { printStackTrace(__e); }} } static void preCleanUp(Object c) { if (c instanceof Collection) { for (Object o : ((Collection) c)) preCleanUp(o); return; } callOpt(c, "licensed_off"); setOpt_raw(c, "ping_anyActions" , true); // so ping notices setOpt_raw(c, "cleaningUp_flag" , true); } // TODO: optimize (use getOpt_cache) static void setOpt_raw(Object o, String field, Object value) { try { if (o == null) return; if (o instanceof Class) setOpt_raw((Class) o, field, value); else { Field f = setOpt_raw_findField(o.getClass(), field); if (f != null) { makeAccessible(f); smartSet(f, o, value); } } } catch (Exception __e) { throw rethrow(__e); } } static void setOpt_raw(Class c, String field, Object value) { try { if (c == null) return; Field f = setOpt_raw_findStaticField(c, field); if (f != null) { makeAccessible(f); smartSet(f, null, value); } } catch (Exception __e) { throw rethrow(__e); } } static Field setOpt_raw_findStaticField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field) && (f.getModifiers() & java.lang.reflect.Modifier.STATIC) != 0) return f; _c = _c.getSuperclass(); } while (_c != null); return null; } static Field setOpt_raw_findField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field)) return f; _c = _c.getSuperclass(); } while (_c != null); return null; } static void innerCleanUp(Object c) { // call custom cleanMeUp() and cleanMeUp_*() functions if (!isFalse(pcallOpt(c, "cleanMeUp"))) for (String name : sorted(methodsStartingWith(c, "cleanMeUp_"))) try { callOpt(c, name); } catch (Throwable e) { print("Error cleaning up: " + programID(c)); _handleException(e); } } static void innerCleanUp() { innerCleanUp(mc()); } static Object pcallOpt(Object o, String method, Object... args) { try { return callOpt(o, method, args); } catch (Throwable __e) { printStackTrace(__e); } return null; } static List registeredThreads(Object o) { Map map = (Map) (getOpt(o, "_registerThread_threads")); if (map == null) return ll(); map.size(); // force clean-up synchronized(map) { return asList(keys(map)); } } static List registeredThreads() { _registerThread_threads.size(); // force clean-up return asList(keys(_registerThread_threads)); } static List allToString(Iterable c) { List l = new ArrayList(); for (Object o : unnull(c)) l.add(str(o)); return l; } static List allToString(Object[] c) { List l = new ArrayList(); for (Object o : unnull(c)) l.add(str(o)); return l; } static void interruptThreads(Collection threads) { for (Thread t : unnull(threads)) interruptThread(t); } static void interruptThreads(Class mainClass) { interruptThreads(registeredThreads(mainClass)); } static void retireClassLoader(ClassLoader cl) { try { if (isJavaXClassLoader(cl)) setOptAll(cl, "retired" , true, "retiredMarker" , new DefunctClassLoader()); } catch (Throwable __e) { printStackTrace(__e); } } static int boolToInt(boolean b) { return b ? 1 : 0; } static void addToContainer(Container a, Component... b) { if (a == null) return; { swing(() -> { for (Component c : unnullForIteration(b)) if (c != null) a.add(c); }); } } // binary legacy signature static Object[] toObjectArray(Collection c) { return toObjectArray((Iterable) c); } static Object[] toObjectArray(Iterable c) { List l = asList(c); return l.toArray(new Object[l.size()]); } static A[] arrayOfType(Class type, int n) { return makeArray(type, n); } static A[] arrayOfType(int n, Class type) { return arrayOfType(type, n); } static List wrapArrayAsList(A[] a) { return a == null ? null : Arrays.asList(a); } static void smartSet(Field f, Object o, Object value) throws Exception { try { f.set(o, value); } catch (Exception e) { Class type = f.getType(); // take care of common case (long to int) if (type == int.class && value instanceof Long) { f.set(o, ((Long) value).intValue()); return; } if (type == boolean.class && value instanceof String) { f.set(o, isTrueOrYes(((String) value))); return; } if (type == LinkedHashMap.class && value instanceof Map) { f.set(o, asLinkedHashMap((Map) value)); return; } throw e; } } static String dropNumberPrefix(String s) { return dropFirst(s, indexOfNonDigit(s)); } static String shortClassName(Object o) { if (o == null) return null; Class c = o instanceof Class ? (Class) o : o.getClass(); String name = c.getName(); return shortenClassName(name); } static Set syncLinkedHashSet() { return synchroLinkedHashSet(); } static Runnable _topLevelErrorHandling(Runnable r) { if (r == null) return null; // maybe we don't want this anymore. just dm_current_generic() Object info = _threadInfo(); Object mod = dm_current_generic(); Runnable r2 = r; if (info != null || mod == null) r2 = new Runnable() { public void run() { try { AutoCloseable __1 = (AutoCloseable) (rcall("enter", mod)); try { _threadInheritInfo(info); r.run(); } finally { _close(__1); }} catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "temp (AutoCloseable) rcall enter(mod);\r\n _threadInheritInfo(info);\r\n ..."; }}; r2 = rPcall(r2); return r2; } static String defaultThreadName_name; static String defaultThreadName() { if (defaultThreadName_name == null) defaultThreadName_name = "A thread by " + programID(); return defaultThreadName_name; } static Random defaultRandomGenerator() { { Random r = customRandomizerForThisThread(); if (r != null) return r; } return ThreadLocalRandom.current(); } static Random getRandomizer(Random r) { return r != null ? r : defaultRandomGenerator(); } static A oneOf(List l) { if (empty(l)) return null; int n = l.size(); return n == 1 ? first(l) : l.get(defaultRandomizer().nextInt(n)); } static char oneOf(String s) { return empty(s) ? '?' : s.charAt(random(l(s))); } static A oneOf(A... l) { return oneOf(asList(l)); } static A collectionGet(Collection c, int idx) { if (c == null || idx < 0 || idx >= l(c)) return null; if (c instanceof List) return listGet((List) c, idx); Iterator it = c.iterator(); for (int i = 0; i < idx; i++) if (it.hasNext()) it.next(); else return null; return it.hasNext() ? it.next() : null; } static Pair entryToPair(Map.Entry e) { return mapEntryToPair(e); } static Set> entries(Map map) { return _entrySet(map); } static List cloneSubList(List l, int startIndex, int endIndex) { return newSubList(l, startIndex, endIndex); } static List cloneSubList(List l, int startIndex) { return newSubList(l, startIndex); } static void removeSubList(List l, int from, int to) { if (l != null) subList(l, from, to).clear(); } static void removeSubList(List l, int from) { if (l != null) subList(l, from).clear(); } static String formatWithThousands(long l) { return formatWithThousandsSeparator(l); } static double fraction(double d) { return d % 1; } static String n_fancy2(long l, String singular, String plural) { return formatWithThousandsSeparator(l) + " " + trim(l == 1 ? singular : plural); } static String n_fancy2(Collection l, String singular, String plural) { return n_fancy2(l(l), singular, plural); } static String n_fancy2(Map m, String singular, String plural) { return n_fancy2(l(m), singular, plural); } static String n_fancy2(Object[] a, String singular, String plural) { return n_fancy2(l(a), singular, plural); } static Map> allFields_cache = weakHashMap(); static Set allFields(Object o) { if (o == null) return emptySet(); Class _c = _getClass(o); Set fields = allFields_cache.get(_c); if (fields == null) allFields_cache.put(_c, fields = asTreeSet(keys(getOpt_getFieldMap(o)))); return fields; } static int stdHash(Object a, String... fields) { if (a == null) return 0; int hash = getClassName(a).hashCode(); for (String field : fields) hash = boostHashCombine(hash, hashCode(getOpt(a, field))); return hash; } static String[] toStringArray(Collection c) { String[] a = new String[l(c)]; Iterator it = c.iterator(); for (int i = 0; i < l(a); i++) a[i] = it.next(); return a; } static String[] toStringArray(Object o) { if (o instanceof String[]) return (String[]) o; else if (o instanceof Collection) return toStringArray((Collection) o); else throw fail("Not a collection or array: " + getClassName(o)); } static boolean isUByte(int i) { return (i & 0xFF) == i; } static PrintWriter filePrintWriter(File f) { return printWriter(bufferedFileOutputStream(f)); } static void readLocally(String progID, String varNames) { readLocally2(mc(), progID, varNames); } static void readLocally(String varNames) { readLocally2(mc(), programID(), varNames); } static void readLocally2(Object obj, String varNames) { readLocally2(obj, programID(), varNames); } static int readLocally_stringLength; static ThreadLocal readLocally2_allDynamic = new ThreadLocal(); static ThreadLocal readLocally2_classFinder = new ThreadLocal(); // read a string variable from standard storage // does not overwrite variable contents if there is no file static void readLocally2(Object obj, String progID, String varNames) { try { boolean allDynamic = isTrue(getAndClearThreadLocal(readLocally2_allDynamic)); for (String variableName : javaTokC(varNames)) { File textFile = new File(programDir(progID), variableName + ".text"); String value = loadTextFile(textFile); if (value != null) set(main.class, variableName, value); else { File structureFile = new File(programDir(progID), variableName + ".structure"); value = loadTextFile(structureFile); if (value == null) { File structureGZFile = new File(programDir(progID), variableName + ".structure.gz"); if (!structureGZFile.isFile()) return; //value = loadGZTextFile(structureGZFile); InputStream fis = new FileInputStream(structureGZFile); try { GZIPInputStream gis = newGZIPInputStream(fis); InputStreamReader reader = new InputStreamReader(gis, "UTF-8"); BufferedReader bufferedReader = new BufferedReader(reader); //O o = unstructure_reader(bufferedReader); Object o = unstructure_tok(javaTokC_noMLS_onReader(bufferedReader), allDynamic, readLocally2_classFinder.get()); readLocally_set(obj, variableName, o); return; } finally { _close(fis); }} readLocally_stringLength = l(value); if (nempty(value)) readLocally_set(obj, variableName, unstructure(value, allDynamic, readLocally2_classFinder.get())); } } } catch (Exception __e) { throw rethrow(__e); } } static void readLocally_set(Object c, String varName, Object value) { Object oldValue = get(c, varName); if (oldValue instanceof List && !(oldValue instanceof ArrayList) && value != null) { // Assume it's a synchroList. value = synchroList((List) value); } set(c, varName, value); } public static String bytesToHex(byte[] bytes) { return bytesToHex(bytes, 0, bytes.length); } public static String bytesToHex(byte[] bytes, int ofs, int len) { StringBuilder stringBuilder = new StringBuilder(len*2); for (int i = 0; i < len; i++) { String s = "0" + Integer.toHexString(bytes[ofs+i]); stringBuilder.append(s.substring(s.length()-2, s.length())); } return stringBuilder.toString(); } static byte[] byteListToArray(List l) { if (l == null) return null; int n = l(l), i = 0; byte[] a = new byte[n]; for (var x : l) a[i++] = x; return a; } static BufferedOutputStream bufferedOutputStream(OutputStream out) { if (out == null) return null; if (out instanceof BufferedOutputStream) return ((BufferedOutputStream) out); return new BufferedOutputStream(out, defaultBufferedOutputStreamSize()); } static FileOutputStream newFileOutputStream(File path) throws IOException { return newFileOutputStream(path.getPath()); } static FileOutputStream newFileOutputStream(String path) throws IOException { return newFileOutputStream(path, false); } static FileOutputStream newFileOutputStream(File path, boolean append) throws IOException { return newFileOutputStream(path.getPath(), append); } static FileOutputStream newFileOutputStream(String path, boolean append) throws IOException { mkdirsForFile(path); FileOutputStream f = new FileOutputStream(path, append); _registerIO(f, path, true); return f; } static FileInputStream newFileInputStream(File path) throws IOException { return newFileInputStream(path.getPath()); } static FileInputStream newFileInputStream(String path) throws IOException { FileInputStream f = new FileInputStream(path); _registerIO(f, path, true); return f; } static TimerTask timerTask(final Object r, final java.util.Timer timer) { return new TimerTask() { public void run() { if (!licensed()) timer.cancel(); else pcallF(r); } }; } static A vmBus_timerStarted(A timer) { vmBus_send("timerStarted", timer, costCenter()); return timer; } static Object swingCall(final Object o, final String method, final Object... args) { return swing(new F0() { public Object get() { try { return call(o, method, args); } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "return call(o, method, args);"; }}); } static String localDateWithSeconds(long time) { SimpleDateFormat format = simpleDateFormat_local("yyyy/MM/dd HH:mm:ss"); return format.format(time); } static String localDateWithSeconds() { return localDateWithSeconds(now()); } static BigInteger bigint(String s) { return new BigInteger(s); } static BigInteger bigint(long l) { return BigInteger.valueOf(l); } static long clockToSysTimeDiff() { return sysNow()-now(); } static Set asSet(Object[] array) { HashSet set = new HashSet(); for (Object o : array) if (o != null) set.add(o); return set; } static Set asSet(String[] array) { TreeSet set = new TreeSet(); for (String o : array) if (o != null) set.add(o); return set; } static Set asSet(Iterable l) { if (l instanceof Set) return (Set) l; HashSet set = new HashSet(); for (A o : unnull(l)) if (o != null) set.add(o); return set; } static Complex complex(double re, double im) { return new Complex(re, im); } static Complex complex(double re) { return new Complex(re, 0.0); } static Complex complex(double[] reIm) { if (empty(reIm)) return null; if (l(reIm) != 2) throw fail("Need 2 doubles to make complex number"); return complex(reIm[0], reIm[1]); } static Runnable wrapAsActivity(Object r) { if (r == null) return null; Runnable r2 = toRunnable(r); Object mod = dm_current_generic(); if (mod == null) return r2; return new Runnable() { public void run() { try { AutoCloseable c = (AutoCloseable) (rcall("enter", mod)); AutoCloseable __1 = c; try { r2.run(); } finally { _close(__1); }} catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "AutoCloseable c = (AutoCloseable) (rcall enter(mod));\r\n temp c;\r\n r2.r..."; }}; } static Map _registerThread_threads; static Object _onRegisterThread; // voidfunc(Thread) static Thread _registerThread(Thread t) { if (_registerThread_threads == null) _registerThread_threads = newWeakHashMap(); _registerThread_threads.put(t, true); vm_generalWeakSubMap("thread2mc").put(t, weakRef(mc())); callF(_onRegisterThread, t); return t; } static void _registerThread() { _registerThread(Thread.currentThread()); } static String rep(int n, char c) { return repeat(c, n); } static String rep(char c, int n) { return repeat(c, n); } static List rep(A a, int n) { return repeat(a, n); } static List rep(int n, A a) { return repeat(n, a); } static String decimalFormatEnglish(String format, double d) { return decimalFormatEnglish(format).format(d); } static java.text.DecimalFormat decimalFormatEnglish(String format) { return new java.text.DecimalFormat(format, new java.text.DecimalFormatSymbols(Locale.ENGLISH)); } static boolean endsWith(String a, String b) { return a != null && a.endsWith(b); } static boolean endsWith(String a, char c) { return nempty(a) && lastChar(a) == c; } static boolean endsWith(String a, String b, Matches m) { if (!endsWith(a, b)) return false; m.m = new String[] {dropLast(l(b), a)}; return true; } static Color intToColorOpaque(int rgb) { return new Color(rgb); } static int hi15ToRGBInt_clean(short hi15) { int r = (hi15 >> 10) & 0x1F; int g = (hi15 >> 5) & 0x1F; int b = hi15 & 0x1F; double factor = 255.0/31; r = iround(r*factor); g = iround(g*factor); b = iround(b*factor); return (r << 16) | (g << 8) | b; } static byte[] bytesFromHex(String s) { return hexToBytes(s); } static String dropPrefix(String prefix, String s) { return s == null ? null : s.startsWith(prefix) ? s.substring(l(prefix)) : s; } static int ubyteToInt(byte b) { return b & 0x0FF; } static int ubyteToInt(char c) { return c & 0x0FF; } static short rgbIntToHi15(int rgb) { int r = (rgb >> 16) & 0xFF; int g = (rgb >> 8) & 0xFF; int b = rgb & 0xFF; r >>= 3; g >>= 3; b >>= 3; return (short) ((r << 10) | (g << 5) | b); } static int colorToInt(Color c) { return c.getRGB() & 0xFFFFFF; } static int[] subIntArray(int[] b, int start) { return subIntArray(b, start, l(b)); } static int[] subIntArray(int[] b, int start, int end) { start = max(start, 0); end = min(end, l(b)); if (start == 0 && end == l(b)) return b; if (start >= end) return new int[0]; int[] x = new int[end-start]; System.arraycopy(b, start, x, 0, end-start); return x; } static int[] subIntArray(int[] a, IntRange r) { return r == null ? null : subIntArray(a, r.start, r.end); } static short[] subShortArray(short[] b, int start, int end) { start = max(start, 0); end = min(end, l(b)); if (start == 0 && end == l(b)) return b; if (start >= end) return new short[0]; short[] x = new short[end-start]; System.arraycopy(b, start, x, 0, end-start); return x; } static byte[] subByteArray(byte[] b, int start) { return subByteArray(b, start, l(b)); } static byte[] subByteArray(byte[] b, int start, int end) { start = max(start, 0); end = min(end, l(b)); if (start == 0 && end == l(b)) return b; if (start >= end) return new byte[0]; byte[] x = new byte[end-start]; System.arraycopy(b, start, x, 0, end-start); return x; } static byte[] subByteArray(byte[] b, IntRange r) { return r == null ? null : subByteArray(b, r.start, r.end); } static String hopeningTag(String tag, Map params) { return hopeningTag(tag, mapToParams(params)); } static String hopeningTag(String tag, Object... params) { StringBuilder buf = new StringBuilder(); buf.append("<" + tag); params = unrollParams(params); for (int i = 0; i < l(params); i += 2) { String name = (String) get(params, i); Object val = get(params, i+1); if (nempty(name) && val != null) { if (eqOneOf(val, html_valueLessParam(), true)) buf.append(" " + name); else { String s = str(val); if (!empty(s)) buf.append(" " + name + "=" + htmlQuote(s)); } } } buf.append(">"); return str(buf); } static String htag(String tag) { return htag(tag, ""); } static String htag(String tag, Object contents, Object... params) { String openingTag = hopeningTag(tag, params); String s = str(contents); if (empty(s) && neqic(tag, "script")) return dropLast(openingTag) + "/>"; return openingTag + s + ""; } static List map(Iterable l, Object f) { return map(f, l); } static List map(Object f, Iterable l) { List x = emptyList(l); if (l != null) for (Object o : l) { ping(); x.add(callF(f, o)); } return x; } // map: func(key, value) -> list element static List map(Map map, Object f) { List x = new ArrayList(); if (map != null) for (Object _e : map.entrySet()) { ping(); Map.Entry e = (Map.Entry) _e; x.add(callF(f, e.getKey(), e.getValue())); } return x; } static List map(Object f, Object[] l) { return map(f, asList(l)); } static List map(Object[] l, Object f) { return map(f, l); } static List map(Object f, Map map) { return map(map, f); } static List map(Iterable l, F1 f) { return map(f, l); } static List map(F1 f, Iterable l) { List x = emptyList(l); if (l != null) for (A o : l) { ping(); x.add(callF(f, o)); } return x; } static List map(IF1 f, Iterable l) { return map(l, f); } static List map(Iterable l, IF1 f) { List x = emptyList(l); if (l != null) for (A o : l) { ping(); x.add(f.get(o)); } return x; } static List map(IF1 f, A[] l) { return map(l, f); } static List map(A[] l, IF1 f) { List x = emptyList(l); if (l != null) for (A o : l) { ping(); x.add(f.get(o)); } return x; } static List map(Map map, IF2 f) { List x = new ArrayList(); if (map != null) for (Map.Entry e : map.entrySet()) { ping(); x.add(f.get(e.getKey(), e.getValue())); } return x; } // new magic alias for mapLL - does it conflict? static List map(IF1 f, A data1, A... moreData) { List x = emptyList(l(moreData)+1); x.add(f.get(data1)); if (moreData != null) for (A o : moreData) { ping(); x.add(f.get(o)); } return x; } static void consoleClearInput() { consoleSetInput(""); } static Object callOpt(Object o) { return callF(o); } static Object callOpt(Object o, String method, Object... args) { return callOpt_withVarargs(o, method, args); } static List sorted(Collection c, Object comparator) { List l = cloneList(c); sort(l, makeComparator(comparator)); return l; } static List sorted(Collection c) { List l = cloneList(c); sort(l); return l; } static List sorted(Comparator comparator, Collection c) { List l = cloneList(c); sort(l, comparator); return l; } static List methodsStartingWith(Object o, final String prefix) { return filter(allMethodNames(o), new F1() { public Object get(String s) { try { return startsWith(s, prefix); } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "startsWith(s, prefix)"; }}); } static String programID() { return getProgramID(); } static String programID(Object o) { return getProgramID(o); } static volatile PersistableThrowable _handleException_lastException; static List _handleException_onException = synchroList(ll((IVF1) (__1 -> printStackTrace2(__1)))); static boolean _handleException_showThreadCancellations = false; static void _handleException(Throwable e) { _handleException_lastException = persistableThrowable(e); Throwable e2 = innerException(e); if (e2.getClass() == RuntimeException.class && eq(e2.getMessage(), "Thread cancelled.") || e2 instanceof InterruptedException) { if (_handleException_showThreadCancellations) System.out.println(getStackTrace_noRecord(e2)); return; } for (Object f : cloneList(_handleException_onException)) try { callF(f, e); } catch (Throwable e3) { try { printStackTrace2(e3); // not using pcall here - it could lead to endless loops } catch (Throwable e4) { System.out.println(getStackTrace(e3)); System.out.println(getStackTrace(e4)); } } } static boolean interruptThread_verbose = false; static void interruptThread(Thread t) { if (t == null) return; if (interruptThread_verbose) print("Interrupting thread " + t); // note reason in global map vm_threadInterruptionReasonsMap().put(t, getStackTrace()); t.interrupt(); URLConnection c = (URLConnection) (vm_generalSubMap("URLConnection per thread").get(t)); if (c != null) { try { print("Closing URLConnection of interrupted thread."); call(c, "disconnect"); } catch (Throwable __e) { printStackTrace(__e); }} } static boolean isJavaXClassLoader(ClassLoader cl) { return startsWithOneOf(className(cl), "main$JavaXClassLoader", "x30$JavaXClassLoader"); } static void setOptAll(Object o, Map fields) { if (fields == null) return; for (String field : keys(fields)) setOpt/*_flex*/(o, field, fields.get(field)); } static void setOptAll(Object o, Object... values) { //values = expandParams(c.getClass(), values); warnIfOddCount(values); for (int i = 0; i+1 < l(values); i += 2) { String field = (String) values[i]; Object value = values[i+1]; setOpt(o, field, value); } } static A[] makeArray(Class type, int n) { return (A[]) Array.newInstance(type, n); } static boolean isTrueOrYes(Object o) { return isTrueOpt(o) || o instanceof String && (eqicOneOf(((String) o), "1", "t", "true") || isYes(((String) o))); } static LinkedHashMap asLinkedHashMap(Map map) { if (map instanceof LinkedHashMap) return (LinkedHashMap) map; LinkedHashMap m = new LinkedHashMap(); if (map != null) synchronized(collectionMutex(map)) { m.putAll(map); } return m; } static String[] dropFirst(int n, String[] a) { return drop(n, a); } static String[] dropFirst(String[] a) { return drop(1, a); } static Object[] dropFirst(Object[] a) { return drop(1, a); } static List dropFirst(List l) { return dropFirst(1, l); } static List dropFirst(int n, Iterable i) { return dropFirst(n, toList(i)); } static List dropFirst(Iterable i) { return dropFirst(toList(i)); } static List dropFirst(int n, List l) { return n <= 0 ? l : new ArrayList(l.subList(Math.min(n, l.size()), l.size())); } static List dropFirst(List l, int n) { return dropFirst(n, l); } static String dropFirst(int n, String s) { return substring(s, n); } static String dropFirst(String s, int n) { return substring(s, n); } static String dropFirst(String s) { return substring(s, 1); } static Chain dropFirst(Chain c) { return c == null ? null : c.next; } static int indexOfNonDigit(String s) { int n = l(s); for (int i = 0; i < n; i++) if (!isDigit(s.charAt(i))) return i; return -1; } static String shortenClassName(String name) { if (name == null) return null; int i = lastIndexOf(name, "$"); if (i < 0) i = lastIndexOf(name, "."); return i < 0 ? name : substring(name, i+1); } // BREAKING CHANGE! // Also NOTE: Iterators of these sync-wrapped collections // after generally NOT thread-safe! // TODO: change that? static Set synchroLinkedHashSet() { return synchronizedSet(new CompactLinkedHashSet()); } static Object dm_current_generic() { return getWeakRef(dm_current_generic_tl().get()); } static Object rcall(String method, Object o, Object... args) { return call_withVarargs(o, method, args); } static Runnable rPcall(Runnable r) { return r == null ? null : () -> { try { r.run(); } catch (Throwable __e) { printStackTrace(__e); } }; } static Random customRandomizerForThisThread() { return customRandomizerForThisThread_tl().get(); } static Random defaultRandomizer() { return defaultRandomGenerator(); } static A listGet(List l, int idx) { return l != null && idx >= 0 && idx < l.size() ? l.get(idx) : null; } static List newSubList(List l, int startIndex, int endIndex) { return cloneList(subList(l, startIndex, endIndex)); } static List newSubList(List l, int startIndex) { return cloneList(subList(l, startIndex)); } static List subList(List l, int startIndex) { return subList(l, startIndex, l(l)); } static List subList(int startIndex, List l) { return subList(l, startIndex); } static List subList(int startIndex, int endIndex, List l) { return subList(l, startIndex, endIndex); } static List subList(List l, int startIndex, int endIndex) { if (l == null) return null; int n = l(l); startIndex = Math.max(0, startIndex); endIndex = Math.min(n, endIndex); if (startIndex > endIndex) return ll(); if (startIndex == 0 && endIndex == n) return l; return l.subList(startIndex, endIndex); } static List subList(List l, IntRange r) { return subList(l, r.start, r.end); } static String formatWithThousandsSeparator(long l) { return NumberFormat.getInstance(new Locale("en_US")).format(l); } static String trim(String s) { return s == null ? null : s.trim(); } static String trim(StringBuilder buf) { return buf.toString().trim(); } static String trim(StringBuffer buf) { return buf.toString().trim(); } static Map weakHashMap() { return newWeakHashMap(); } static Set emptySet() { return new HashSet(); } static TreeSet asTreeSet(Collection set) { return set == null ? null : set instanceof TreeSet ? (TreeSet) set : new TreeSet(set); } static int hashCode(Object a) { return a == null ? 0 : a.hashCode(); } static int hashCode(long l) { return Long.hashCode(l); } static int hashCode(double d) { return Double.hashCode(d); } static PrintWriter printWriter(OutputStream out) { return newPrintWriter(out); } static PrintWriter printWriter(Writer out) { return newPrintWriter(out); } static A getAndClearThreadLocal(ThreadLocal tl) { A a = tl.get(); tl.set(null); return a; } static List javaTokC(String s) { if (s == null) return null; int l = s.length(); ArrayList tok = new ArrayList(); int i = 0; while (i < l) { int j = i; char c, d; // scan for whitespace while (j < l) { c = s.charAt(j); d = j+1 >= l ? '\0' : s.charAt(j+1); if (c == ' ' || c == '\t' || c == '\r' || c == '\n') ++j; else if (c == '/' && d == '*') { do ++j; while (j < l && !s.substring(j, Math.min(j+2, l)).equals("*/")); j = Math.min(j+2, l); } else if (c == '/' && d == '/') { do ++j; while (j < l && "\r\n".indexOf(s.charAt(j)) < 0); } else break; } i = j; if (i >= l) break; c = s.charAt(i); d = i+1 >= l ? '\0' : s.charAt(i+1); // scan for non-whitespace if (c == '\'' || c == '"') { char opener = c; ++j; while (j < l) { if (s.charAt(j) == opener || s.charAt(j) == '\n') { // end at \n to not propagate unclosed string literal errors ++j; break; } else if (s.charAt(j) == '\\' && j+1 < l) j += 2; else ++j; } } else if (Character.isJavaIdentifierStart(c)) do ++j; while (j < l && (Character.isJavaIdentifierPart(s.charAt(j)) || "'".indexOf(s.charAt(j)) >= 0)); // for stuff like "don't" else if (Character.isDigit(c)) { do ++j; while (j < l && Character.isDigit(s.charAt(j))); if (j < l && s.charAt(j) == 'L') ++j; // Long constants like 1L } else if (c == '[' && d == '[') { do ++j; while (j+1 < l && !s.substring(j, j+2).equals("]]")); j = Math.min(j+2, l); } else if (c == '[' && d == '=' && i+2 < l && s.charAt(i+2) == '[') { do ++j; while (j+2 < l && !s.substring(j, j+3).equals("]=]")); j = Math.min(j+3, l); } else ++j; tok.add(javaTok_substringC(s, i, j)); i = j; } return tok; } static File programDir_mine; // set this to relocate program's data static File programDir() { return programDir(getProgramID()); } static File programDir(String snippetID) { boolean me = sameSnippetID(snippetID, programID()); if (programDir_mine != null && me) return programDir_mine; File dir = new File(javaxDataDir(), formatSnippetIDOpt(snippetID)); if (me) { String c = caseID(); if (nempty(c)) dir = newFile(dir, c); } return dir; } static File programDir(String snippetID, String subPath) { return new File(programDir(snippetID), subPath); } static String loadTextFile(String fileName) { return loadTextFile(fileName, null); } static String loadTextFile(File f, String defaultContents) { return loadTextFile(f, defaultContents, "UTF-8"); } static String loadTextFile(File f, String defaultContents, String encoding) { try { checkFileNotTooBigToRead(f); if (f == null || !f.exists()) return defaultContents; FileInputStream fileInputStream = new FileInputStream(f); InputStreamReader inputStreamReader = new InputStreamReader(fileInputStream, encoding); return loadTextFile(inputStreamReader); } catch (Exception __e) { throw rethrow(__e); } } public static String loadTextFile(File fileName) { return loadTextFile(fileName, null); } static String loadTextFile(String fileName, String defaultContents) { return fileName == null ? defaultContents : loadTextFile(newFile(fileName), defaultContents); } static String loadTextFile(Reader reader) throws IOException { StringBuilder builder = new StringBuilder(); try { char[] buffer = new char[1024]; int n; while (-1 != (n = reader.read(buffer))) builder.append(buffer, 0, n); } finally { reader.close(); } return str(builder); } static GZIPInputStream newGZIPInputStream(File f) { return gzInputStream(f); } static GZIPInputStream newGZIPInputStream(InputStream in) { return gzInputStream(in); } // TODO: cyclic structures involving certain lists & sets static Object unstructure(String text) { return unstructure(text, false); } static Object unstructure(String text, boolean allDynamic) { return unstructure(text, allDynamic, null); } static Object unstructure(String text, IF1 classFinder) { return unstructure(text, false, classFinder); } static int structure_internStringsLongerThan = 50; static int unstructure_unquoteBufSize = 100; static int unstructure_tokrefs; // stats abstract static class unstructure_Receiver { abstract void set(Object o); } // classFinder: func(name) -> class (optional) static Object unstructure(String text, boolean allDynamic, Object classFinder) { if (text == null) return null; return unstructure_tok(javaTokC_noMLS_iterator(text), allDynamic, classFinder); } static Object unstructure_reader(BufferedReader reader) { return unstructure_tok(javaTokC_noMLS_onReader(reader), false, null); } interface unstructure_Handler { void parse(int refID, int tokIndex, unstructure_Receiver out); } static Object unstructure_tok(final Producer tok, final boolean allDynamic, final Object _classFinder) { final boolean debug = unstructure_debug; final class X { int i = -1; final Object classFinder = _classFinder != null ? _classFinder : _defaultClassFinder(); String mcDollar = actualMCDollar(); // use Eclipse primitive collection if possible (smaller & hopefully faster?) HashMap refs = new HashMap(); HashMap tokrefs = new HashMap(); HashSet concepts = new HashSet(); List stack = new ArrayList(); Map baseClassMap = new HashMap(); HashMap innerClassConstructors = new HashMap(); String curT; char[] unquoteBuf = new char[unstructure_unquoteBufSize]; // value is a class or a Handler final HashMap handlers = new HashMap(); X() { try { Class mc = (Class) (callF(_classFinder, "
")); if (mc != null) mcDollar = mc.getName() + "$"; } catch (Throwable __e) { printStackTrace(__e); } makeHandlers(); } void makeHandlers() { unstructure_Handler h; handlers.put("bigint", (unstructure_Handler) (refID, tokIndex, out) -> out.set(parseBigInt())); handlers.put("d", (unstructure_Handler) (refID, tokIndex, out) -> out.set(parseDouble())); handlers.put("fl", (unstructure_Handler) (refID, tokIndex, out) -> out.set(parseFloat())); handlers.put("sh", (unstructure_Handler) (refID, tokIndex, out) -> { consume(); String t = tpp(); if (t.equals("-")) { t = tpp(); out.set((short) (-parseInt(t))); return; } out.set((short) parseInt(t)); }); handlers.put("enum", (unstructure_Handler) (refID, tokIndex, out) -> { consume(); String t = tpp(); assertTrue(isJavaIdentifier(t)); String fullClassName = mcDollar + t; Class _c = findAClass(fullClassName); if (_c == null) throw fail("Enum class not found: " + fullClassName); int ordinal = parseInt(tpp()); out.set(_c.getEnumConstants()[ordinal]); }); handlers.put("false", h = (unstructure_Handler) (refID, tokIndex, out) -> { consume(); out.set(false); }); handlers.put("f", h); handlers.put("true", h = (unstructure_Handler) (refID, tokIndex, out) -> { consume(); out.set(true); }); handlers.put("t", h); handlers.put("{", (unstructure_Handler) (refID, tokIndex, out) -> parseMap(out)); handlers.put("[", (unstructure_Handler) (refID, tokIndex, out) -> { ArrayList l = new ArrayList(); if (refID >= 0) refs.put(refID, l); this.parseList(l, out); }); handlers.put("bitset", (unstructure_Handler) (refID, tokIndex, out) -> parseBitSet(out)); handlers.put("array", h = (unstructure_Handler) (refID, tokIndex, out) -> parseArray(out)); handlers.put("intarray", h); handlers.put("dblarray", h); } // end of makeHandlers - add more handlers here Class findAClass(String fullClassName) { try { return classFinder != null ? (Class) callF(classFinder, fullClassName) : findClass_fullName(fullClassName); } catch (Throwable __e) { return null; } } String unquote(String s) { return unquoteUsingCharArray(s, unquoteBuf); } // look at current token String t() { return curT; } // get current token, move to next String tpp() { String t = curT; consume(); return t; } void parse(final unstructure_Receiver out) { String t = t(); int refID; if (structure_isMarker(t, 0, l(t))) { refID = parseInt(t.substring(1)); consume(); } else refID = -1; // if (debug) print("parse: " + quote(t)); final int tokIndex = i; parse_inner(refID, tokIndex, new unstructure_Receiver() { void set(Object o) { if (refID >= 0) refs.put(refID, o); if (o != null) tokrefs.put(tokIndex, o); out.set(o); } }); } void parse_inner(int refID, int tokIndex, unstructure_Receiver out) { String t = t(); // if (debug) print("parse_inner: " + quote(t)); Object handler = handlers.get(t); if (handler instanceof unstructure_Handler) { ((unstructure_Handler) handler).parse(refID, tokIndex, out); return; } Class c = (Class) handler; if (c == null) { if (t.startsWith("\"")) { String s = internIfLongerThan(unquote(tpp()), structure_internStringsLongerThan); out.set(s); return; } if (t.startsWith("'")) { out.set(unquoteCharacter(tpp())); return; } if (t.equals("-")) { consume(); t = tpp(); out.set(isLongConstant(t) ? (Object) (-parseLong(t)) : (Object) (-parseInt(t))); return; } if (isInteger(t) || isLongConstant(t)) { consume(); //if (debug) print("isLongConstant " + quote(t) + " => " + isLongConstant(t)); if (isLongConstant(t)) { out.set(parseLong(t)); return; } long l = parseLong(t); boolean isInt = l == (int) l; out.set(isInt ? (Object) Integer.valueOf((int) l) : (Object) Long.valueOf(l)); return; } if (t.equals("-")) { consume(); t = tpp(); out.set(isLongConstant(t) ? (Object) (-parseLong(t)) : (Object) (-parseInt(t))); return; } if (isInteger(t) || isLongConstant(t)) { consume(); //if (debug) print("isLongConstant " + quote(t) + " => " + isLongConstant(t)); if (isLongConstant(t)) { out.set(parseLong(t)); return; } long l = parseLong(t); boolean isInt = l == (int) l; out.set(isInt ? (Object) Integer.valueOf((int) l) : (Object) Long.valueOf(l)); return; } if (t.equals("File")) { consume(); File f = new File(unquote(tpp())); out.set(f); return; } if (t.startsWith("r") && isInteger(t.substring(1))) { consume(); int ref = Integer.parseInt(t.substring(1)); Object o = refs.get(ref); if (o == null) warn("unsatisfied back reference " + ref); out.set(o); return; } if (t.startsWith("t") && isInteger(t.substring(1))) { consume(); int ref = Integer.parseInt(t.substring(1)); Object o = tokrefs.get(ref); if (o == null) warn("unsatisfied token reference " + ref + " at " + tokIndex); out.set(o); return; } if (t.equals("hashset")) { parseHashSet(out); return; } if (t.equals("lhs")) { parseLinkedHashSet(out); return; } if (t.equals("treeset")) { parseTreeSet(out); return; } if (t.equals("ciset")) { parseCISet(out); return; } if (eqOneOf(t, "hashmap", "hm")) { consume(); parseMap(new HashMap(), out); return; } if (t.equals("lhm")) { consume(); parseMap(new LinkedHashMap(), out); return; } if (t.equals("tm")) { consume(); parseMap(new TreeMap(), out); return; } if (t.equals("cimap")) { consume(); parseMap(ciMap(), out); return; } if (t.equals("ll")) { consume(); LinkedList l = new LinkedList(); if (refID >= 0) refs.put(refID, l); { parseList(l, out); return; } } if (t.equals("syncLL")) { // legacy consume(); { parseList(synchroLinkedList(), out); return; } } if (t.equals("sync")) { consume(); { parse(new unstructure_Receiver() { void set(Object value) { if (value instanceof Map) { // Java 7 if (value instanceof NavigableMap) { out.set(synchroNavigableMap((NavigableMap) value)); return; } if (value instanceof SortedMap) { out.set(synchroSortedMap((SortedMap) value)); return; } { out.set(synchroMap((Map) value)); return; } } else { out.set(synchroList((List) value)); return; } } }); return; } } if (t.equals("ba")) { consume(); String hex = unquote(tpp()); out.set(hexToBytes(hex)); return; } if (t.equals("boolarray")) { consume(); int n = parseInt(tpp()); String hex = unquote(tpp()); out.set(boolArrayFromBytes(hexToBytes(hex), n)); return; } if (t.equals("class")) { out.set(parseClass()); return; } if (t.equals("l")) { parseLisp(out); return; } if (t.equals("null")) { consume(); out.set(null); return; } if (eq(t, "c")) { consume(); t = t(); assertTrue(isJavaIdentifier(t)); concepts.add(t); } // custom deserialization (new static method method) if (eq(t, "cu")) { consume(); t = tpp(); assertTrue(isJavaIdentifier(t)); String fullClassName = mcDollar + t; Class _c = findAClass(fullClassName); if (_c == null) throw fail("Class not found: " + fullClassName); parse(new unstructure_Receiver() { void set(Object value) { out.set(call(_c, "_deserialize", value)); } }); return; } } if (eq(t, "j")) { consume(); out.set(parseJava()); return; } if (eq(t, "bc")) { consume(); String c1 = tpp(); String c2 = tpp(); baseClassMap.put(c1, c2); { parse_inner(refID, i, out); return; } } // add more tokens here // Now we want to find our target class c // Have we failed to look up the class before? //bool seenBefore = handlers.containsKey(cname); // If we have seen the class before, we skip all of this // and simply leave c as null // TODO - how do we fill className? //if (!seenBefore) { if (c == null && !isJavaIdentifier(t)) throw new RuntimeException("Unknown token " + (i+1) + ": " + quote(t)); // any other class name (or package name) consume(); String className, fullClassName; // Is it a package name? if (eq(t(), ".")) { className = t; do { consume(); className += "." + assertIdentifier(tpp()); } while (eq(t(), ".")); fullClassName = className; } else { className = t; fullClassName = mcDollar + t; } if (c == null && !allDynamic) { // First, find class c = findAClass(fullClassName); handlers.put(className, c); } // check for existing base class if (c == null && !allDynamic) { Set seen = new HashSet(); String parent = className; while (true) { String baseName = baseClassMap.get(parent); if (baseName == null) break; if (!seen.add(baseName)) throw fail("Cyclic superclass info: " + baseName); c = findAClass(mcDollar + baseName); if (c == null) print("Base class " + baseName + " of " + parent + " doesn't exist either"); else if (isAbstract(c)) print("Can't instantiate abstract base class: " + c); else { printVars_str("Reverting to base class", "className", className, "baseName", baseName, "c", c); handlers.put(className, c); break; } parent = baseName; } } //} // Check if it has an outer reference boolean hasBracket = eq(t(), "("); if (hasBracket) consume(); boolean hasOuter = hasBracket && startsWith(t(), "this$"); DynamicObject dO = null; Object o = null; final String thingName = t; try { if (c != null) { if (hasOuter) try { Constructor ctor = innerClassConstructors.get(c); if (ctor == null) innerClassConstructors.put(c, ctor = nuStubInnerObject_findConstructor(c, classFinder)); o = ctor.newInstance(new Object[] {null}); } catch (Exception e) { print("Error deserializing " + c + ": " + e); o = nuEmptyObject(c); } else o = nuEmptyObject(c); if (o instanceof DynamicObject) dO = (DynamicObject) o; } else { if (concepts.contains(t) && (c = findAClass(mcDollar + "Concept")) != null) o = dO = (DynamicObject) nuEmptyObject(c); else dO = new DynamicObject(); dO.className = className; } } catch (Throwable __e) { printStackTrace(__e); } // end of pcall // Creating instance failed? Use DynamicObject if (o == null && dO == null) dO = new DynamicObject(); // Save in references list early because contents of object // might link back to main object if (refID >= 0) refs.put(refID, o != null ? o : dO); tokrefs.put(tokIndex, o != null ? o : dO); // NOW parse the fields! HashMap fields = new HashMap(); // no longer preserving order (why did we do this?) Object _o = o; DynamicObject _dO = dO; if (hasBracket) { stack.add(new Runnable() { public void run() { try { if (eq(t(), ",")) consume(); if (eq(t(), ")")) { consume(")"); objRead(_o, _dO, fields, hasOuter); out.set(_o != null ? _o : _dO); } else { final String key = unquote(tpp()); String t = tpp(); if (!eq(t, "=")) throw fail("= expected, got " + t + " after " + quote(key) + " in object " + thingName /*+ " " + sfu(fields)*/); stack.add(this); parse(new unstructure_Receiver() { void set(Object value) { fields.put(key, value); /*ifdef unstructure_debug print("Got field value " + value + ", next token: " + t()); endifdef*/ //if (eq(t(), ",")) consume(); } }); } } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "ifdef unstructure_debug\r\n print(\"in object values, token: \" + t())..."; }}); } else { objRead(o, dO, fields, hasOuter); out.set(o != null ? o : dO); } } void objRead(Object o, DynamicObject dO, Map fields, boolean hasOuter) { // translate between diferent compilers (this$0 vs this$1) Object outer = fields.get("this$0"); if (outer != null) fields.put("this$1", outer); else { outer = fields.get("this$1"); if (outer != null) fields.put("this$0", outer); } if (o != null) { if (dO != null) { setOptAllDyn_pcall(dO, fields); } else { setOptAll_pcall(o, fields); } if (hasOuter) fixOuterRefs(o); } else for (Map.Entry e : fields.entrySet()) setDynObjectValue(dO, intern(e.getKey()), e.getValue()); if (o != null) pcallOpt_noArgs(o, "_doneLoading"); } void parseSet(final Set set, final unstructure_Receiver out) { this.parseList(new ArrayList(), new unstructure_Receiver() { void set(Object o) { set.addAll((List) o); out.set(set); } }); } void parseLisp(final unstructure_Receiver out) { throw fail("class Lisp not included"); } void parseBitSet(final unstructure_Receiver out) { consume("bitset"); consume("{"); final BitSet bs = new BitSet(); stack.add(new Runnable() { public void run() { try { if (eq(t(), "}")) { consume("}"); out.set(bs); } else { stack.add(this); parse(new unstructure_Receiver() { void set(Object o) { bs.set((Integer) o); if (eq(t(), ",")) consume(); } }); } } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "if (eq(t(), \"}\")) {\r\n consume(\"}\");\r\n out.set(bs);\r\n ..."; }}); } void parseList(final List list, final unstructure_Receiver out) { tokrefs.put(i, list); consume("["); stack.add(new Runnable() { public void run() { try { if (eq(t(), "]")) { consume(); out.set(list); } else { stack.add(this); parse(new unstructure_Receiver() { void set(Object o) { //if (debug) print("List element type: " + getClassName(o)); list.add(o); if (eq(t(), ",")) consume(); } }); } } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "if (eq(t(), \"]\")) {\r\n consume();\r\n ifdef unstructure_debug\r..."; }}); } void parseArray(unstructure_Receiver out) { String _type = tpp(); int dims; if (eq(t(), "S")) { // string array _type = "S"; consume(); } if (eq(t(), "/")) { // multi-dimensional array consume(); dims = parseInt(tpp()); } else dims = 1; consume("{"); List list = new ArrayList(); String type = _type; stack.add(new Runnable() { public void run() { try { if (eq(t(), "}")) { consume("}"); if (dims > 1) { Class atype; if (type.equals("intarray")) atype = int.class; else if (type.equals("S")) atype = String.class; else throw todo("multi-dimensional arrays of other types"); out.set(list.toArray((Object[]) newMultiDimensionalOuterArray(atype, dims, l(list)))); } else out.set( type.equals("intarray") ? toIntArray(list) : type.equals("dblarray") ? toDoubleArray(list) : type.equals("S") ? toStringArray(list) : list.toArray()); } else { stack.add(this); parse(new unstructure_Receiver() { void set(Object o) { list.add(o); if (eq(t(), ",")) consume(); } }); } } catch (Exception __e) { throw rethrow(__e); } } public String toString() { return "if (eq(t(), \"}\")) {\r\n consume(\"}\");\r\n if (dims > 1) {\r\n ..."; }}); } Object parseClass() { consume("class"); consume("("); String name = unquote(tpp()); consume(")"); Class c = allDynamic ? null : findAClass(name); if (c != null) return c; DynamicObject dO = new DynamicObject(); dO.className = "java.lang.Class"; name = dropPrefix(mcDollar, name); dO.fieldValues.put("name", name); return dO; } Object parseBigInt() { consume("bigint"); consume("("); String val = tpp(); if (eq(val, "-")) val = "-" + tpp(); consume(")"); return new BigInteger(val); } Object parseDouble() { consume("d"); consume("("); String val = unquote(tpp()); consume(")"); return Double.parseDouble(val); } Object parseFloat() { consume("fl"); String val; if (eq(t(), "(")) { consume("("); val = unquote(tpp()); consume(")"); } else { val = unquote(tpp()); } return Float.parseFloat(val); } void parseHashSet(unstructure_Receiver out) { consume("hashset"); parseSet(new HashSet(), out); } void parseLinkedHashSet(unstructure_Receiver out) { consume("lhs"); parseSet(new LinkedHashSet(), out); } void parseTreeSet(unstructure_Receiver out) { consume("treeset"); parseSet(new TreeSet(), out); } void parseCISet(unstructure_Receiver out) { consume("ciset"); parseSet(ciSet(), out); } void parseMap(unstructure_Receiver out) { parseMap(new TreeMap(), out); } Object parseJava() { String j = unquote(tpp()); Matches m = new Matches(); if (jmatch("java.awt.Color[r=*,g=*,b=*]", j, m)) return nuObject("java.awt.Color", parseInt(m.unq(0)), parseInt(m.unq(1)), parseInt(m.unq(2))); else { warn("Unknown Java object: " + j); return null; } } void parseMap(final Map map, final unstructure_Receiver out) { consume("{"); stack.add(new Runnable() { boolean v = false; Object key; public void run() { if (v) { v = false; stack.add(this); if (!eq(tpp(), "=")) throw fail("= expected, got " + t() + " in map of size " + l(map)); parse(new unstructure_Receiver() { void set(Object value) { map.put(key, value); if (eq(t(), ",")) consume(); } }); } else { if (eq(t(), "}")) { consume("}"); out.set(map); } else { v = true; stack.add(this); parse(new unstructure_Receiver() { void set(Object o) { key = o; } }); } } // if v else } // run() }); } /*void parseSub(unstructure_Receiver out) { int n = l(stack); parse(out); while (l(stack) > n) stack }*/ void consume() { curT = tok.next(); ++i; } void consume(String s) { if (!eq(t(), s)) { /*S prevToken = i-1 >= 0 ? tok.get(i-1) : ""; S nextTokens = join(tok.subList(i, Math.min(i+2, tok.size()))); fail(quote(s) + " expected: " + prevToken + " " + nextTokens + " (" + i + "/" + tok.size() + ")");*/ throw fail(quote(s) + " expected, got " + quote(t())); } consume(); } // outer wrapper function getting first token and unwinding the stack void parse_initial(unstructure_Receiver out) { consume(); // get first token parse(out); while (nempty(stack)) popLast(stack).run(); } } ThreadLocal tlLoading = dynamicObjectIsLoading_threadLocal(); Boolean b = tlLoading.get(); tlLoading.set(true); try { final Var v = new Var(); X x = new X(); x.parse_initial(new unstructure_Receiver() { void set(Object o) { v.set(o); } }); unstructure_tokrefs = x.tokrefs.size(); return v.get(); } finally { tlLoading.set(b); } } static boolean unstructure_debug = false; static Producer javaTokC_noMLS_onReader(final BufferedReader r) { final class X implements Producer { StringBuilder buf = new StringBuilder(); // stores from "i" char c, d, e = 'x'; // just not '\0' X() { // fill c, d and e nc(); nc(); nc(); } // get next character(s) into c, d and e void nc() { try { c = d; d = e; if (e == '\0') return; int i = r.read(); e = i < 0 ? '\0' : i == '\0' ? '_' // shouldn't happen anymore : (char) i; } catch (Exception __e) { throw rethrow(__e); } } void ncSave() { if (c != '\0') { buf.append(c); nc(); } } public String next() { // scan for whitespace while (c != '\0') { if (c == ' ' || c == '\t' || c == '\r' || c == '\n') nc(); else if (c == '/' && d == '*') { do nc(); while (c != '\0' && !(c == '*' && d == '/')); nc(); nc(); } else if (c == '/' && d == '/') { do nc(); while (c != '\0' && "\r\n".indexOf(c) < 0); } else break; } if (c == '\0') return null; // scan for non-whitespace if (c == '\'' || c == '"') { char opener = c; ncSave(); while (c != '\0') { if (c == opener || c == '\n') { // end at \n to not propagate unclosed string literal errors ncSave(); break; } else if (c == '\\') { ncSave(); ncSave(); } else ncSave(); } } else if (Character.isJavaIdentifierStart(c)) do ncSave(); while (Character.isJavaIdentifierPart(c) || c == '\''); // for stuff like "don't" else if (Character.isDigit(c)) { do ncSave(); while (Character.isDigit(c)); if (c == 'L') ncSave(); // Long constants like 1L } else ncSave(); String t = buf.toString(); buf.setLength(0); return t; } } return new X(); } static int defaultBufferedOutputStreamSize() { return 65536; } public static File mkdirsForFile(File file) { File dir = file.getParentFile(); if (dir != null) { // is null if file is in current dir dir.mkdirs(); if (!dir.isDirectory()) if (dir.isFile()) throw fail("Please delete the file " + f2s(dir) + " - it is supposed to be a directory!"); else throw fail("Unknown IO exception during mkdirs of " + f2s(file)); } return file; } public static String mkdirsForFile(String path) { mkdirsForFile(new File(path)); return path; } static void _registerIO(Object object, String path, boolean opened) { } static Object costCenter() { return mc(); } static SimpleDateFormat simpleDateFormat_local(String format) { SimpleDateFormat sdf = new SimpleDateFormat(format); sdf.setTimeZone(localTimeZone()); return sdf; } static Map vm_generalWeakSubMap(Object name) { synchronized(vm_generalMap()) { Map map = (Map) (vm_generalMap_get(name)); if (map == null) vm_generalMap_put(name, map = newWeakMap()); return map; } } static WeakReference weakRef(A a) { return newWeakReference(a); } static String repeat(char c, int n) { n = Math.max(n, 0); char[] chars = new char[n]; for (int i = 0; i < n; i++) chars[i] = c; return new String(chars); } static List repeat(A a, int n) { n = Math.max(n, 0); List l = new ArrayList(n); for (int i = 0; i < n; i++) l.add(a); return l; } static List repeat(int n, A a) { return repeat(a, n); } static char lastChar(String s) { return empty(s) ? '\0' : s.charAt(l(s)-1); } static A[] dropLast(A[] a) { return dropLast(a, 1); } static A[] dropLast(A[] a, int n) { if (a == null) return null; n = Math.min(n, a.length); A[] b = arrayOfSameType(a, a.length-n); System.arraycopy(a, 0, b, 0, b.length); return b; } static List dropLast(List l) { return subList(l, 0, l(l)-1); } static List dropLast(int n, List l) { return subList(l, 0, l(l)-n); } static List dropLast(Iterable l) { return dropLast(asList(l)); } static String dropLast(String s) { return substring(s, 0, l(s)-1); } static String dropLast(String s, int n) { return substring(s, 0, l(s)-n); } static String dropLast(int n, String s) { return dropLast(s, n); } static byte[] hexToBytes(String s) { if (odd(l(s))) throw fail("Hex string has odd length: " + quote(shorten(10, s))); int n = l(s) / 2; byte[] bytes = new byte[n]; for (int i = 0; i < n; i++) { int a = parseHexChar(s.charAt(i*2)); int b = parseHexChar(s.charAt(i*2+1)); if (a < 0 || b < 0) throw fail("Bad hex byte: " + quote(substring(s, i*2, i*2+2)) + " at " + i*2 + "/" + l(s)); bytes[i] = (byte) ((a << 4) | b); } return bytes; } static Object[] mapToParams(Map map) { return mapToObjectArray(map); } static Object[] unrollParams(Object[] params) { if (l(params) == 1 && params[0] instanceof Map) return mapToParams((Map) params[0]); return params; } static Object html_valueLessParam_cache; static Object html_valueLessParam() { if (html_valueLessParam_cache == null) html_valueLessParam_cache = html_valueLessParam_load(); return html_valueLessParam_cache;} static Object html_valueLessParam_load() { return new Object(); } static String htmlQuote(String s) { return "\"" + htmlencode_forParams(s) + "\""; } static boolean neqic(String a, String b) { return !eqic(a, b); } static boolean neqic(char a, char b) { return !eqic(a, b); } static void consoleSetInput(final String text) { if (headless()) return; setTextAndSelectAll(consoleInputField(), text); focusConsole(); } static Object callOpt_withVarargs(Object o, String method, Object... args) { try { if (o == null) return null; if (o instanceof Class) { Class c = (Class) o; _MethodCache cache = callOpt_getCache(c); Method me = cache.findMethod(method, args); if (me == null) { // TODO: varargs return null; } if ((me.getModifiers() & Modifier.STATIC) == 0) return null; return invokeMethod(me, null, args); } else { Class c = o.getClass(); _MethodCache cache = callOpt_getCache(c); Method me = cache.findMethod(method, args); if (me != null) return invokeMethod(me, o, args); // try varargs List methods = cache.cache.get(method); if (methods != null) methodSearch: for (Method m : methods) { { if (!(m.isVarArgs())) continue; } Object[] newArgs = massageArgsForVarArgsCall(m, args); if (newArgs != null) return invokeMethod(m, o, newArgs); } return null; } } catch (Exception __e) { throw rethrow(__e); } } static void sort(T[] a, Comparator c) { if (a != null) Arrays.sort(a, c); } static void sort(T[] a) { if (a != null) Arrays.sort(a); } static void sort(int[] a) { if (a != null) Arrays.sort(a); } static void sort(List a, Comparator c) { if (a != null) Collections.sort(a, c); } static void sort(List a) { if (a != null) Collections.sort(a); } static Comparator makeComparator(final Object f) { if (f instanceof Comparator) return (Comparator) f; return new Comparator() { public int compare(Object a, Object b) { return (Integer) callF(f, a, b); } }; } static List filter(Iterable c, Object pred) { if (pred instanceof F1) return filter(c, (F1) pred); List x = new ArrayList(); if (c != null) for (Object o : c) if (isTrue(callF(pred, o))) x.add(o); return x; } static List filter(Object pred, Iterable c) { return filter(c, pred); } static List filter(Iterable c, F1 pred) { List x = new ArrayList(); if (c != null) for (B o : c) if (pred.get(o)) x.add(o); return x; } static List filter(F1 pred, Iterable c) { return filter(c, pred); } //ifclass IF1 static List filter(Iterable c, IF1 pred) { List x = new ArrayList(); if (c != null) for (B o : c) if (pred.get(o)) x.add(o); return x; } static List filter(B[] c, IF1 pred) { List x = new ArrayList(); if (c != null) for (B o : c) if (pred.get(o)) x.add(o); return x; } static List filter(IF1 pred, Iterable c) { return filter(c, pred); } //endif static List allMethodNames(Object o) { Class c = _getClass(o); TreeSet names = new TreeSet(); while (c != null) { for (Method m : c.getDeclaredMethods()) names.add(m.getName()); c = c.getSuperclass(); } return asList(names); } static String programID; static String getProgramID() { return nempty(programID) ? formatSnippetIDOpt(programID) : "?"; } // TODO: ask JavaX instead static String getProgramID(Class c) { String id = (String) getOpt(c, "programID"); if (nempty(id)) return formatSnippetID(id); return "?"; } static String getProgramID(Object o) { return getProgramID(getMainClass(o)); } static Throwable printStackTrace2(Throwable e) { // we go to system.out now - system.err is nonsense print(getStackTrace2(e)); return e; } static void printStackTrace2() { printStackTrace2(new Throwable()); } static void printStackTrace2(String msg) { printStackTrace2(new Throwable(msg)); } static Throwable innerException(Throwable e) { return getInnerException(e); } static Map vm_threadInterruptionReasonsMap() { return vm_generalWeakSubMap("Thread interruption reasons"); } static Map vm_generalSubMap(Object name) { synchronized(vm_generalMap()) { Map map = (Map) (vm_generalMap_get(name)); if (map == null) vm_generalMap_put(name, map = synchroMap()); return map; } } static Field setOpt_findField(Class c, String field) { HashMap map; synchronized(getOpt_cache) { map = getOpt_cache.get(c); if (map == null) map = getOpt_makeCache(c); } return map.get(field); } static void setOpt(Object o, String field, Object value) { try { if (o == null) return; Class c = o.getClass(); HashMap map; if (getOpt_cache == null) map = getOpt_makeCache(c); // in class init else synchronized(getOpt_cache) { map = getOpt_cache.get(c); if (map == null) map = getOpt_makeCache(c); } if (map == getOpt_special) { if (o instanceof Class) { setOpt((Class) o, field, value); return; } // It's probably a subclass of Map. Use raw method. TODO: huh? setOpt_raw(o, field, value); return; } Field f = map.get(field); if (f != null) { smartSet(f, o, value); return; } // possible improvement: skip setAccessible if (o instanceof DynamicObject) { setDyn(((DynamicObject) o), field, value); return; } if (o instanceof IMeta) setDyn(((IMeta) o), field, value); } catch (Exception __e) { throw rethrow(__e); } } static void setOpt(Class c, String field, Object value) { if (c == null) return; try { Field f = setOpt_findStaticField(c, field); // TODO: optimize if (f != null) smartSet(f, null, value); } catch (Exception e) { throw new RuntimeException(e); } } static Field setOpt_findStaticField(Class c, String field) { Class _c = c; do { for (Field f : _c.getDeclaredFields()) if (f.getName().equals(field) && (f.getModifiers() & java.lang.reflect.Modifier.STATIC) != 0) { makeAccessible(f); return f; } _c = _c.getSuperclass(); } while (_c != null); return null; } static void warnIfOddCount(Object... list) { if (odd(l(list))) printStackTrace("Odd list size: " + list); } static boolean isTrueOpt(Object o) { if (o instanceof Boolean) return ((Boolean) o).booleanValue(); return false; } static boolean isTrueOpt(String field, Object o) { return isTrueOpt(getOpt(field, o)); } static boolean eqicOneOf(String s, String... l) { for (String x : l) if (eqic(s, x)) return true; return false; } static List isYes_yesses = litlist("y", "yes", "yeah", "y", "yup", "yo", "corect", "sure", "ok", "afirmative"); // << collapsed words, so "corect" means "correct" static boolean isYes(String s) { return isYes_yesses.contains(collapseWord(toLowerCase(firstWord2(s)))); } static String[] drop(int n, String[] a) { n = Math.min(n, a.length); String[] b = new String[a.length-n]; System.arraycopy(a, n, b, 0, b.length); return b; } static Object[] drop(int n, Object[] a) { n = Math.min(n, a.length); Object[] b = new Object[a.length-n]; System.arraycopy(a, n, b, 0, b.length); return b; } static boolean isDigit(char c) { return Character.isDigit(c); } static int lastIndexOf(String a, String b) { return a == null || b == null ? -1 : a.lastIndexOf(b); } static int lastIndexOf(String a, char b) { return a == null ? -1 : a.lastIndexOf(b); } // starts searching from i-1 static int lastIndexOf(List l, int i, A a) { if (l == null) return -1; for (i = min(l(l), i)-1; i >= 0; i--) if (eq(l.get(i), a)) return i; return -1; } static int lastIndexOf(List l, A a) { if (l == null) return -1; for (int i = l(l)-1; i >= 0; i--) if (eq(l.get(i), a)) return i; return -1; } static A getWeakRef(Reference ref) { return ref == null ? null : ref.get(); } static x30_pkg.x30_util.BetterThreadLocal dm_current_generic_tl; static x30_pkg.x30_util.BetterThreadLocal dm_current_generic_tl() { if (dm_current_generic_tl == null) dm_current_generic_tl = vm_generalMap_getOrCreate("currentModule", () -> new x30_pkg.x30_util.BetterThreadLocal()); return dm_current_generic_tl; } static ThreadLocal customRandomizerForThisThread_tl = new ThreadLocal(); static ThreadLocal customRandomizerForThisThread_tl() { return customRandomizerForThisThread_tl; } static PrintWriter newPrintWriter(OutputStream out) { return new PrintWriter(outputStreamToWriter(out)); } static PrintWriter newPrintWriter(Writer out) { return new PrintWriter(out); } static String javaTok_substringC(String s, int i, int j) { return s.substring(i, j); } static boolean sameSnippetID(String a, String b) { if (!isSnippetID(a) || !isSnippetID(b)) return false; return parseSnippetID(a) == parseSnippetID(b); } static File javaxDataDir_dir; // can be set to work on different base dir static File javaxDataDir() { return javaxDataDir_dir != null ? javaxDataDir_dir : new File(userHome(), "JavaX-Data"); } static File javaxDataDir(String... subs) { return newFile(javaxDataDir(), subs); } static String formatSnippetIDOpt(String s) { return isSnippetID(s) ? formatSnippetID(s) : s; } static volatile String caseID_caseID; static String caseID() { return caseID_caseID; } static void caseID(String id) { caseID_caseID = id; } static File newFile(File base, String... names) { for (String name : names) base = new File(base, name); return base; } static File newFile(String name) { return name == null ? null : new File(name); } static File newFile(String base, String... names) { return newFile(newFile(base), names); } static ThreadLocal> checkFileNotTooBigToRead_tl = new ThreadLocal(); static void checkFileNotTooBigToRead(File f) { callF(checkFileNotTooBigToRead_tl.get(), f); } static int gzInputStream_defaultBufferSize = 65536; static GZIPInputStream gzInputStream(File f) { try { return gzInputStream(new FileInputStream(f)); } catch (Exception __e) { throw rethrow(__e); } } static GZIPInputStream gzInputStream(File f, int bufferSize) { try { return gzInputStream(new FileInputStream(f), bufferSize); } catch (Exception __e) { throw rethrow(__e); } } static GZIPInputStream gzInputStream(InputStream in) { return gzInputStream(in, gzInputStream_defaultBufferSize); } static GZIPInputStream gzInputStream(InputStream in, int bufferSize) { try { return _registerIOWrap(new GZIPInputStream(in, gzInputStream_defaultBufferSize), in); } catch (Exception __e) { throw rethrow(__e); } } static Producer javaTokC_noMLS_iterator(final String s) { return javaTokC_noMLS_iterator(s, 0); } static Producer javaTokC_noMLS_iterator(final String s, final int startIndex) { return new Producer() { final int l = s.length(); int i = startIndex; public String next() { if (i >= l) return null; int j = i; char c, d; // scan for whitespace while (j < l) { c = s.charAt(j); d = j+1 >= l ? '\0' : s.charAt(j+1); if (c == ' ' || c == '\t' || c == '\r' || c == '\n') ++j; else if (c == '/' && d == '*') { do ++j; while (j < l && !s.substring(j, Math.min(j+2, l)).equals("*/")); j = Math.min(j+2, l); } else if (c == '/' && d == '/') { do ++j; while (j < l && "\r\n".indexOf(s.charAt(j)) < 0); } else break; } i = j; if (i >= l) return null; c = s.charAt(i); d = i+1 >= l ? '\0' : s.charAt(i+1); // scan for non-whitespace if (c == '\'' || c == '"') { char opener = c; ++j; while (j < l) { if (s.charAt(j) == opener || s.charAt(j) == '\n') { // end at \n to not propagate unclosed string literal errors ++j; break; } else if (s.charAt(j) == '\\' && j+1 < l) j += 2; else ++j; } } else if (Character.isJavaIdentifierStart(c)) do ++j; while (j < l && Character.isJavaIdentifierPart(s.charAt(j))); else if (Character.isDigit(c)) { do ++j; while (j < l && Character.isDigit(s.charAt(j))); if (j < l && s.charAt(j) == 'L') ++j; // Long constants like 1L } else ++j; String t = quickSubstring(s, i, j); i = j; return t; } }; } static Object _defaultClassFinder_value = defaultDefaultClassFinder(); static Object _defaultClassFinder() { return _defaultClassFinder_value; } static String actualMCDollar() { return actualMC().getName() + "$"; } static BigInteger parseBigInt(String s) { return new BigInteger(s); } static float parseFloat(String s) { return Float.parseFloat(s); } static boolean isJavaIdentifier(String s) { if (empty(s) || !Character.isJavaIdentifierStart(s.charAt(0))) return false; for (int i = 1; i < s.length(); i++) if (!Character.isJavaIdentifierPart(s.charAt(i))) return false; return true; } static HashMap findClass_fullName_cache = new HashMap(); // returns null on not found // this is the simple version that is not case-tolerant static Class findClass_fullName(String name) { synchronized(findClass_fullName_cache) { if (findClass_fullName_cache.containsKey(name)) return findClass_fullName_cache.get(name); Class c; try { c = Class.forName(name); } catch (ClassNotFoundException e) { c = null; } findClass_fullName_cache.put(name, c); return c; } } static String unquoteUsingCharArray(String s, char[] buf) { if (s == null) return null; if (startsWith(s, '[')) { int i = 1; while (i < s.length() && s.charAt(i) == '=') ++i; if (i < s.length() && s.charAt(i) == '[') { String m = s.substring(1, i); if (s.endsWith("]" + m + "]")) return s.substring(i+1, s.length()-i-1); } } if (s.length() > 1) { char c = s.charAt(0); if (c == '\"' || c == '\'') { int l = endsWith(s, c) ? s.length()-1 : s.length(); if (l > buf.length) return unquote(s); // fallback int n = 0; for (int i = 1; i < l; i++) { char ch = s.charAt(i); if (ch == '\\') { char nextChar = (i == l - 1) ? '\\' : s.charAt(i + 1); // Octal escape? if (nextChar >= '0' && nextChar <= '7') { String code = "" + nextChar; i++; if ((i < l - 1) && s.charAt(i + 1) >= '0' && s.charAt(i + 1) <= '7') { code += s.charAt(i + 1); i++; if ((i < l - 1) && s.charAt(i + 1) >= '0' && s.charAt(i + 1) <= '7') { code += s.charAt(i + 1); i++; } } buf[n++] = (char) Integer.parseInt(code, 8); continue; } switch (nextChar) { case '\"': ch = '\"'; break; case '\\': ch = '\\'; break; case 'b': ch = '\b'; break; case 'f': ch = '\f'; break; case 'n': ch = '\n'; break; case 'r': ch = '\r'; break; case 't': ch = '\t'; break; case '\'': ch = '\''; break; // Hex Unicode: u???? case 'u': if (i >= l - 5) { ch = 'u'; break; } int code = Integer.parseInt( "" + s.charAt(i + 2) + s.charAt(i + 3) + s.charAt(i + 4) + s.charAt(i + 5), 16); char[] x = Character.toChars(code); int lx = x.length; for (int j = 0; j < lx; j++) buf[n++] = x[j]; i += 5; continue; default: ch = nextChar; // added by Stefan } i++; } buf[n++] = ch; } return new String(buf, 0, n); } } return s; // not quoted - return original } static boolean structure_isMarker(String s, int i, int j) { if (i >= j) return false; if (s.charAt(i) != 'm') return false; ++i; while (i < j) { char c = s.charAt(i); if (c < '0' || c > '9') return false; ++i; } return true; } static String internIfLongerThan(String s, int l) { return s == null ? null : l(s) >= l ? intern(s) : s; } static char unquoteCharacter(String s) { assertTrue(s.startsWith("'") && s.length() > 1); return unquote("\"" + s.substring(1, s.endsWith("'") ? s.length()-1 : s.length()) + "\"").charAt(0); } static boolean isLongConstant(String s) { if (!s.endsWith("L")) return false; s = s.substring(0, l(s)-1); return isInteger(s); } static long parseLong(String s) { if (empty(s)) return 0; return Long.parseLong(dropSuffix("L", s)); } static long parseLong(Object s) { return Long.parseLong((String) s); } static boolean isInteger(String s) { int n = l(s); if (n == 0) return false; int i = 0; if (s.charAt(0) == '-') if (++i >= n) return false; while (i < n) { char c = s.charAt(i); if (c < '0' || c > '9') return false; ++i; } return true; } static boolean warn_on = true; static ThreadLocal> warn_warnings = new ThreadLocal(); static void warn(String s) { if (warn_on) print("Warning: " + s); } static void warn(String s, List warnings) { warn(s); if (warnings != null) warnings.add(s); addToCollection(warn_warnings.get(), s); } static TreeMap ciMap() { return caseInsensitiveMap(); } static List parseList(String s) { return (List) safeUnstructure(s); } static List synchroLinkedList() { return synchroList(new LinkedList()); } static NavigableMap synchroNavigableMap(NavigableMap map) { return Collections.synchronizedNavigableMap(map); } static SortedMap synchroSortedMap(SortedMap map) { return Collections.synchronizedSortedMap(map); } static boolean[] boolArrayFromBytes(byte[] a, int n) { boolean[] b = new boolean[n]; int m = min(n, l(a)*8); for (int i = 0; i < m; i++) b[i] = (a[i/8] & 1 << (i & 7)) != 0; return b; } static String assertIdentifier(String s) { return assertIsIdentifier(s); } static String assertIdentifier(String msg, String s) { return assertIsIdentifier(msg, s); } // Use like this: printVars_str(+x, +y); // Or: printVars("bla", +x); // Or: printVars bla(+x); static void printVars_str(Object... params) { print(renderVars_str(params)); } static Constructor nuStubInnerObject_findConstructor(Class c) { return nuStubInnerObject_findConstructor(c, null); } static Constructor nuStubInnerObject_findConstructor(Class c, Object classFinder) { try { Class outerType = getOuterClass(c, classFinder); Constructor m = c.getDeclaredConstructor(outerType); makeAccessible(m); return m; } catch (Exception __e) { throw rethrow(__e); } } static Map nuEmptyObject_cache = newDangerousWeakHashMap(); static A nuEmptyObject(Class c) { try { Constructor ctr; synchronized(nuEmptyObject_cache) { ctr = nuEmptyObject_cache.get(c); if (ctr == null) { nuEmptyObject_cache.put(c, ctr = nuEmptyObject_findConstructor(c)); makeAccessible(ctr); } } try { return (A) ctr.newInstance(); } catch (InstantiationException e) { if (empty(e.getMessage())) if ((c.getModifiers() & Modifier.ABSTRACT) != 0) throw fail("Can't instantiate abstract class " + className(c), e); else throw fail("Can't instantiate " + className(c), e); else throw rethrow(e); } } catch (Exception __e) { throw rethrow(__e); } } static Constructor nuEmptyObject_findConstructor(Class c) { for (Constructor m : getDeclaredConstructors_cached(c)) if (m.getParameterTypes().length == 0) return m; throw fail("No default constructor declared in " + c.getName()); } static void setOptAllDyn_pcall(DynamicObject o, Map fields) { if (fields == null || o == null) return; HashMap fieldMap = instanceFieldsMap(o); for (Map.Entry e : fields.entrySet()) { try { String field = e.getKey(); Object val = e.getValue(); Field f = fieldMap.get(field); if (f != null) smartSet(f, o, val); else { dynamicObject_setRawFieldValue(o, intern(field), val); } } catch (Throwable __e) { printStackTrace(__e); }} } static void setOptAll_pcall(Object o, Map fields) { if (fields == null) return; for (String field : keys(fields)) try { setOpt(o, field, fields.get(field)); } catch (Throwable __e) { print(exceptionToStringShort(__e)); } } static void setOptAll_pcall(Object o, Object... values) { //values = expandParams(c.getClass(), values); warnIfOddCount(values); for (int i = 0; i+1 < l(values); i += 2) { String field = (String) values[i]; Object value = values[i+1]; try { setOpt(o, field, value); } catch (Throwable __e) { print(exceptionToStringShort(__e)); } } } static void fixOuterRefs(Object o) { try { if (o == null) return; Field[] l = thisDollarOneFields(o.getClass()); if (l.length <= 1) return; Object father = null; for (Field f : l) { father = f.get(o); if (father != null) break; } if (father == null) return; for (Field f : l) f.set(o, father); } catch (Exception __e) { throw rethrow(__e); } } static void setDynObjectValue(DynamicObject o, String field, Object value) { dynamicObject_setRawFieldValue(o, field, value); } static String intern(String s) { return fastIntern(s); } static void pcallOpt_noArgs(Object o, String method) { try { callOpt_noArgs(o, method); } catch (Throwable __e) { printStackTrace(__e); } } static RuntimeException todo() { throw new RuntimeException("TODO"); } static RuntimeException todo(Object msg) { throw new RuntimeException("TODO: " + msg); } static Object newMultiDimensionalOuterArray(Class elementType, int dimensions, int length) { int[] dims = new int[dimensions]; dims[0] = length; return Array.newInstance(elementType, dims); } static int[] toIntArray(Collection l) { int[] a = new int[l(l)]; int i = 0; if (a.length != 0) for (int x : l) a[i++] = x; return a; } static TreeSet ciSet() { return caseInsensitiveSet(); } // DIFFERENCES to jfind: always ignores case, doesn't recognize etc // You probably want jmatch2 static boolean jmatch(String pat, String s) { return jmatch(pat, s, null); } static boolean jmatch(String pat, String s, Matches matches) { if (s == null) return false; return jmatch(pat, javaTok(s), matches); } static boolean jmatch(String pat, List toks) { return jmatch(pat, toks, null); } static boolean jmatch(String pat, List toks, Matches matches) { List tokpat = javaTok(pat); String[] m = match2(tokpat, toks); //print(structure(tokpat) + " on " + structure(toks) + " => " + structure(m)); if (m == null) return false; else { if (matches != null) matches.m = m; return true; } } static Object nuObject(String className, Object... args) { try { return nuObject(classForName(className), args); } catch (Exception __e) { throw rethrow(__e); } } // too ambiguous - maybe need to fix some callers /*static O nuObject(O realm, S className, O... args) { ret nuObject(_getClass(realm, className), args); }*/ static A nuObject(Class c, Object... args) { try { if (args == null || args.length == 0) return nuObjectWithoutArguments(c); // cached! Constructor m = nuObject_findConstructor(c, args); makeAccessible(m); return (A) m.newInstance(args); } catch (Exception __e) { throw rethrow(__e); } } static Constructor nuObject_findConstructor(Class c, Object... args) { for (Constructor m : getDeclaredConstructors_cached(c)) { if (!nuObject_checkArgs(m.getParameterTypes(), args, false)) continue; return m; } throw fail("Constructor " + c.getName() + getClasses(args) + " not found" + (args.length == 0 && (c.getModifiers() & java.lang.reflect.Modifier.STATIC) == 0 ? " - hint: it's a non-static class!" : "")); } static boolean nuObject_checkArgs(Class[] types, Object[] args, boolean debug) { if (types.length != args.length) { if (debug) System.out.println("Bad parameter length: " + args.length + " vs " + types.length); return false; } for (int i = 0; i < types.length; i++) if (!(args[i] == null || isInstanceX(types[i], args[i]))) { if (debug) System.out.println("Bad parameter " + i + ": " + args[i] + " vs " + types[i]); return false; } return true; } static A popLast(List l) { return liftLast(l); } static List popLast(int n, List l) { return liftLast(n, l); } static double popLast(DoubleBuffer l) { return l.popLast(); } static ThreadLocal DynamicObject_loading = or((ThreadLocal) get(getClass("x30_pkg.x30_util"), "DynamicObject_loading"), new ThreadLocal()); static ThreadLocal dynamicObjectIsLoading_threadLocal() { return DynamicObject_loading; } static String f2s(File f) { return f == null ? null : f.getAbsolutePath(); } static String f2s(String s) { return f2s(newFile(s)); } static String f2s(java.nio.file.Path p) { return p == null ? null : f2s(p.toFile()); } static TimeZone localTimeZone() { return getTimeZone(standardTimeZone()); // TimeZone.getDefault()? } static Map newWeakMap() { return newWeakHashMap(); } static WeakReference newWeakReference(A a) { return a == null ? null : new WeakReference(a); } static A[] arrayOfSameType(A[] a, int n) { return newObjectArrayOfSameType(a, n); } static boolean odd(int i) { return (i & 1) != 0; } static boolean odd(long i) { return (i & 1) != 0; } static boolean odd(BigInteger i) { return odd(toInt(i)); } static int shorten_default = 100; static String shorten(CharSequence s) { return shorten(s, shorten_default); } static String shorten(CharSequence s, int max) { return shorten(s, max, "..."); } static String shorten(CharSequence s, int max, String shortener) { if (s == null) return ""; if (max < 0) return str(s); return s.length() <= max ? str(s) : subCharSequence(s, 0, min(s.length(), max-l(shortener))) + shortener; } static String shorten(int max, CharSequence s) { return shorten(s, max); } static int parseHexChar(char c) { if (c >= '0' && c <= '9') return charDiff(c, '0'); if (c >= 'a' && c <= 'f') return charDiff(c, 'a')+10; if (c >= 'A' && c <= 'F') return charDiff(c, 'A')+10; return -1; } static Object[] mapToObjectArray(Map map) { List l = new ArrayList(); for (Object o : keys(map)) { l.add(o); l.add(map.get(o)); } return toObjectArray(l); } static Object[] mapToObjectArray(Object f, Collection l) { int n = l(l); Object[] array = new Object[n]; if (n != 0) { Iterator it = iterator(l); for (int i = 0; i < n; i++) array[i] = callF(f, it.next()); } return array; } static Object[] mapToObjectArray(Object f, Object[] l) { int n = l(l); Object[] array = new Object[n]; for (int i = 0; i < n; i++) array[i] = callF(f, l[i]); return array; } static Object[] mapToObjectArray(Collection l, IF1 f) { return mapToObjectArray(f, l); } static Object[] mapToObjectArray(A[] l, IF1 f) { return mapToObjectArray(f, l); } static Object[] mapToObjectArray(IF1 f, A[] l) { int n = l(l); Object[] array = new Object[n]; for (int i = 0; i < n; i++) array[i] = f.get(l[i]); return array; } static Object[] mapToObjectArray(IF1 f, Collection l) { int n = l(l); Object[] array = new Object[n]; if (n != 0) { Iterator it = iterator(l); for (int i = 0; i < n; i++) array[i] = callF(f, it.next()); } return array; } // this should be on by default now I think, but it may break // legacy code... static ThreadLocal htmlencode_forParams_useV2 = new ThreadLocal(); static String htmlencode_forParams(String s) { if (s == null) return ""; if (isTrue(htmlencode_forParams_useV2.get())) return htmlencode_forParams_v2(s); StringBuilder out = new StringBuilder(Math.max(16, s.length())); for (int i = 0; i < s.length(); i++) { char c = s.charAt(i); if (c > 127 || c == '"' || c == '<' || c == '>') { out.append("&#"); out.append((int) c); out.append(';'); } else out.append(c); } return out.toString(); } static boolean headless() { return isHeadless(); } static JTextField setTextAndSelectAll(final JTextField tf, final String text) { if (tf != null) { swing(() -> { tf.setText(text); tf.selectAll(); }); } return tf; } static JTextField consoleInputField() { Object console = get(getJavaX(), "console"); return (JTextField) getOpt(console, "tfInput"); } static void focusConsole(String s) { setConsoleInput(s); focusConsole(); } static void focusConsole() { JComponent tf = consoleInputFieldOrComboBox(); if (tf != null) { //print("Focusing console"); tf.requestFocus(); } } static String formatSnippetID(String id) { return "#" + parseSnippetID(id); } static String formatSnippetID(long id) { return "#" + id; } static Class getMainClass() { return mc(); } static Class getMainClass(Object o) { try { if (o == null) return null; if (o instanceof Class && eq(((Class) o).getName(), "x30")) return (Class) o; ClassLoader cl = (o instanceof Class ? (Class) o : o.getClass()).getClassLoader(); if (cl == null) return null; String name = mainClassNameForClassLoader(cl); return loadClassFromClassLoader_orNull(cl, name); } catch (Exception __e) { throw rethrow(__e); } } static String getStackTrace2(Throwable e) { return hideCredentials(getStackTrace(unwrapTrivialExceptionWraps(e)) + replacePrefix("java.lang.RuntimeException: ", "FAIL: ", hideCredentials(str(innerException2(e)))) + "\n"); } static Throwable getInnerException(Throwable e) { if (e == null) return null; while (e.getCause() != null) e = e.getCause(); return e; } static Throwable getInnerException(Runnable r) { return getInnerException(getException(r)); } static A setDyn(A o, String key, Object value) { setDynObjectValue(o, key, value); return o; } static void setDyn(IMeta o, String key, Object value) { metaMapPut(o, key, value); } static ArrayList litlist(A... a) { ArrayList l = new ArrayList(a.length); for (A x : a) l.add(x); return l; } static String collapseWord(String s) { if (s == null) return ""; StringBuilder buf = new StringBuilder(); for (int i = 0; i < l(s); i++) if (i == 0 || !charactersEqualIC(s.charAt(i), s.charAt(i-1))) buf.append(s.charAt(i)); return buf.toString(); } static List toLowerCase(List strings) { List x = new ArrayList(); for (String s : strings) x.add(s.toLowerCase()); return x; } static String[] toLowerCase(String[] strings) { String[] x = new String[l(strings)]; for (int i = 0; i < l(strings); i++) x[i] = strings[i].toLowerCase(); return x; } static String toLowerCase(String s) { return s == null ? "" : s.toLowerCase(); } static String firstWord2(String s) { s = xltrim(s); if (empty(s)) return ""; if (isLetterOrDigit(first(s))) return takeCharsWhile(__38 -> isLetterOrDigit(__38), s); else return "" + first(s); } static Writer outputStreamToWriter(OutputStream out) { try { return new OutputStreamWriter(out, "UTF-8"); } catch (Exception __e) { throw rethrow(__e); } } public static boolean isSnippetID(String s) { try { parseSnippetID(s); return true; } catch (RuntimeException e) { return false; } } public static long parseSnippetID(String snippetID) { long id = Long.parseLong(shortenSnippetID(snippetID)); if (id == 0) throw fail("0 is not a snippet ID"); return id; } static String _userHome; static String userHome() { if (_userHome == null) return actualUserHome(); return _userHome; } static File userHome(String path) { return new File(userDir(), path); } static String quickSubstring(String s, int i, int j) { if (i >= j) return ""; return s.substring(i, j); } static Object defaultDefaultClassFinder() { return new F1() { public Class get(String name) { // Fix some buggy concepts files out there name = replacePrefix("main$main$", "main$", name); Class c = get2(name); return c; } Class get2(String name) { // special invocation to find main class irrelevant of name if (eq(name, "
")) return mc(); { Class c = findClass_fullName(name); if (c != null) return c; } if (startsWithAny(name, "loadableUtils.utils$", "main$", mcDollar())) for (String pkg : ll("loadableUtils.utils$", mcDollar())) { String newName = pkg + afterDollar(name); { Class c = findClass_fullName(newName); if (c != null) return c; } } return null; } }; } static Class actualMC() { return or((Class) realMC(), mc()); } static String dropSuffix(String suffix, String s) { return nempty(suffix) && endsWith(s, suffix) ? s.substring(0, l(s)-l(suffix)) : s; } static boolean addToCollection(Collection c, A a) { return c != null && c.add(a); } static TreeMap caseInsensitiveMap() { return new TreeMap(caseInsensitiveComparator()); } static Object safeUnstructure(String s) { return unstructure(s, true); } static Object safeUnstructure(File f) { return safeUnstructureGZFile(f); } static String assertIsIdentifier(String s) { if (!isIdentifier(s)) throw fail("Not an identifier: " + quote(s)); return s; } static String assertIsIdentifier(String msg, String s) { if (!isIdentifier(s)) throw fail(msg + " - Not an identifier: " + quote(s)); return s; } // Use like this: renderVars(+x, +y) // Or like this: renderVars("bla", +x, +y) static String renderVars_str(Object... params) { List l = new ArrayList(); int i = 0; if (odd(l(params))) { l.add(strOrNull(first(params))); ++i; } for (; i+1 < l(params); i += 2) l.add(params[i] + "=" + params[i+1]); return trim(joinWithComma(l)); } static Class getOuterClass(Class c) { return getOuterClass(c, null); } static Class getOuterClass(Class c, Object classFinder) { try { String s = c.getName(); int i = s.lastIndexOf('$'); String name = substring(s, 0, i); return classForName(name, classFinder); } catch (Exception __e) { throw rethrow(__e); } } static Class getOuterClass(Object o) { return getOuterClass(o, null); } static Class getOuterClass(Object o, Object classFinder) { return getOuterClass(_getClass(o), classFinder); } // TODO: convert to regularly cleared normal map static Map getDeclaredConstructors_cached_cache = newDangerousWeakHashMap(); static Constructor[] getDeclaredConstructors_cached(Class c) { Constructor[] ctors; synchronized(getDeclaredConstructors_cached_cache) { ctors = getDeclaredConstructors_cached_cache.get(c); if (ctors == null) { getDeclaredConstructors_cached_cache.put(c, ctors = c.getDeclaredConstructors()); for (var ctor : ctors) makeAccessible(ctor); } } return ctors; } static HashMap instanceFieldsMap(Object o) { return (HashMap) getOpt_getFieldMap(o); } static void dynamicObject_setRawFieldValue(DynamicObject o, Object key, Object value) { if (o == null) return; // double sync, but should be OK here because of locking order o > o.fieldValues synchronized(o) { o.fieldValues = syncMapPut2_createLinkedHashMap((LinkedHashMap) o.fieldValues, key, value); } } static String exceptionToStringShort(Throwable e) { try { lastException(e); e = getInnerException(e); String msg = hideCredentials(unnull(e.getMessage())); if (msg.indexOf("Error") < 0 && msg.indexOf("Exception") < 0) return baseClassName(e) + prependIfNempty(": ", msg); else return msg; } catch (Throwable _e) { printStackTrace(_e); return "Error in exceptionToStringShort"; } } static Map thisDollarOneFields_cache = newDangerousWeakHashMap(); static Field[] thisDollarOneFields(Class c) { synchronized(thisDollarOneFields_cache) { Field[] l = thisDollarOneFields_cache.get(c); if (l == null) thisDollarOneFields_cache.put(c, l = thisDollarOneFields_uncached(c)); return l; } } static Field[] thisDollarOneFields_uncached(Class c) { List fields = new ArrayList(); do { for (Field f : c.getDeclaredFields()) if (f.getName().startsWith("this$")) fields.add(makeAccessible(f)); c = c.getSuperclass(); } while (c != null); return toArray(new Field[l(fields)], fields); } static Method fastIntern_method; static String fastIntern(String s) { try { if (s == null) return null; if (fastIntern_method == null) { fastIntern_method = findMethodNamed(javax(), "internPerProgram"); if (fastIntern_method == null) upgradeJavaXAndRestart(); } return (String) fastIntern_method.invoke(null, s); } catch (Exception __e) { throw rethrow(__e); } } static Map> callOpt_noArgs_cache = newDangerousWeakHashMap(); static Object callOpt_noArgs(Object o, String method) { try { if (o == null) return null; if (o instanceof Class) return callOpt(o, method); // not optimized Class c = o.getClass(); HashMap map; synchronized(callOpt_noArgs_cache) { map = callOpt_noArgs_cache.get(c); if (map == null) map = callOpt_noArgs_makeCache(c); } Method m = map.get(method); return m != null ? m.invoke(o) : null; } catch (Exception __e) { throw rethrow(__e); } } // used internally - we are in synchronized block static HashMap callOpt_noArgs_makeCache(Class c) { HashMap map = new HashMap(); Class _c = c; do { for (Method m : c.getDeclaredMethods()) if (m.getParameterTypes().length == 0 && !reflection_isForbiddenMethod(m)) { makeAccessible(m); String name = m.getName(); if (!map.containsKey(name)) map.put(name, m); } _c = _c.getSuperclass(); } while (_c != null); callOpt_noArgs_cache.put(c, map); return map; } static TreeSet caseInsensitiveSet() { return caseInsensitiveSet_treeSet(); } static TreeSet caseInsensitiveSet(Collection c) { return caseInsensitiveSet_treeSet(c); } // TODO: extended multi-line strings static int javaTok_n, javaTok_elements; static boolean javaTok_opt = false; static List javaTok(String s) { ++javaTok_n; ArrayList tok = new ArrayList(); int l = s == null ? 0 : s.length(); int i = 0; while (i < l) { int j = i; char c, d; // scan for whitespace while (j < l) { c = s.charAt(j); d = j+1 >= l ? '\0' : s.charAt(j+1); if (c == ' ' || c == '\t' || c == '\r' || c == '\n') ++j; else if (c == '/' && d == '*') { do ++j; while (j < l && !regionMatches(s, j, "*/")); j = Math.min(j+2, l); } else if (c == '/' && d == '/') { do ++j; while (j < l && "\r\n".indexOf(s.charAt(j)) < 0); } else break; } tok.add(javaTok_substringN(s, i, j)); i = j; if (i >= l) break; c = s.charAt(i); d = i+1 >= l ? '\0' : s.charAt(i+1); // scan for non-whitespace // Special JavaX syntax: 'identifier if (c == '\'' && Character.isJavaIdentifierStart(d) && i+2 < l && "'\\".indexOf(s.charAt(i+2)) < 0) { j += 2; while (j < l && Character.isJavaIdentifierPart(s.charAt(j))) ++j; } else if (c == '\'' || c == '"') { char opener = c; ++j; while (j < l) { int c2 = s.charAt(j); if (c2 == opener || c2 == '\n' && opener == '\'') { // allow multi-line strings, but not for ' ++j; break; } else if (c2 == '\\' && j+1 < l) j += 2; else ++j; } } else if (Character.isJavaIdentifierStart(c)) do ++j; while (j < l && (Character.isJavaIdentifierPart(s.charAt(j)) || s.charAt(j) == '\'')); // for stuff like "don't" else if (Character.isDigit(c)) { do ++j; while (j < l && Character.isDigit(s.charAt(j))); if (j < l && s.charAt(j) == 'L') ++j; // Long constants like 1L } else if (c == '[' && d == '[') { do ++j; while (j < l && !regionMatches(s, j, "]]")); j = Math.min(j+2, l); } else if (c == '[' && d == '=' && i+2 < l && s.charAt(i+2) == '[') { do ++j; while (j+2 < l && !regionMatches(s, j, "]=]")); j = Math.min(j+3, l); } else ++j; tok.add(javaTok_substringC(s, i, j)); i = j; } if ((tok.size() % 2) == 0) tok.add(""); javaTok_elements += tok.size(); return tok; } static List javaTok(List tok) { return javaTokWithExisting(join(tok), tok); } // match2 matches multiple "*" (matches a single token) wildcards and zero or one "..." wildcards (matches multiple tokens) static String[] match2(List pat, List tok) { // standard case (no ...) int i = pat.indexOf("..."); if (i < 0) return match2_match(pat, tok); pat = new ArrayList(pat); // We're modifying it, so copy first pat.set(i, "*"); while (pat.size() < tok.size()) { pat.add(i, "*"); pat.add(i+1, ""); // doesn't matter } return match2_match(pat, tok); } static String[] match2_match(List pat, List tok) { List result = new ArrayList(); if (pat.size() != tok.size()) { return null; } for (int i = 1; i < pat.size(); i += 2) { String p = pat.get(i), t = tok.get(i); if (eq(p, "*")) result.add(t); else if (!equalsIgnoreCase(unquote(p), unquote(t))) // bold change - match quoted and unquoted now. TODO: should remove return null; } return result.toArray(new String[result.size()]); } static Map classForName_cache = synchroHashMap(); static Class classForName(String name) { return classForName(name, null); } static Class classForName(String name, Object classFinder) { // first clause is when we're in class init if (classForName_cache == null || classFinder != null) return classForName_uncached(name, classFinder); Class c = classForName_cache.get(name); if (c == null) classForName_cache.put(name, c = classForName_uncached(name, null)); return c; } static Class classForName_uncached(String name, Object classFinder) { try { if (classFinder != null) return (Class) callF(classFinder, name); return Class.forName(name); } catch (Exception __e) { throw rethrow(__e); } } static Map nuObjectWithoutArguments_cache = newDangerousWeakHashMap(); static Object nuObjectWithoutArguments(String className) { try { return nuObjectWithoutArguments(classForName(className)); } catch (Exception __e) { throw rethrow(__e); } } static A nuObjectWithoutArguments(Class c) { try { if (nuObjectWithoutArguments_cache == null) // in class init return (A) nuObjectWithoutArguments_findConstructor(c).newInstance(); Constructor m = nuObjectWithoutArguments_cache.get(c); if (m == null) nuObjectWithoutArguments_cache.put(c, m = nuObjectWithoutArguments_findConstructor(c)); return (A) m.newInstance(); } catch (Exception __e) { throw rethrow(__e); } } static Constructor nuObjectWithoutArguments_findConstructor(Class c) { for (Constructor m : getDeclaredConstructors_cached(c)) if (empty(m.getParameterTypes())) { makeAccessible(m); return m; } throw fail("No default constructor found in " + c.getName()); } static A liftLast(List l) { if (empty(l)) return null; int i = l(l)-1; A a = l.get(i); l.remove(i); return a; } static List liftLast(int n, List l) { int i = l(l)-n; List part = cloneSubList(l, i); removeSubList(l, i); return part; } static TimeZone getTimeZone(String name) { return TimeZone.getTimeZone(name); } static String standardTimeZone_name = "Europe/Berlin"; static String standardTimeZone() { return standardTimeZone_name; } static A[] newObjectArrayOfSameType(A[] a) { return newObjectArrayOfSameType(a, a.length); } static A[] newObjectArrayOfSameType(A[] a, int n) { return (A[]) Array.newInstance(a.getClass().getComponentType(), n); } static int charDiff(char a, char b) { return (int) a-(int) b; } static int charDiff(String a, char b) { return charDiff(stringToChar(a), b); } static String htmlencode_forParams_v2(String s) { if (s == null) return ""; StringBuilder out = new StringBuilder(Math.max(16, s.length())); for (int i = 0; i < s.length(); i++) { char c = s.charAt(i); if (c > 127 || c == '"' || c == '<' || c == '>' || c == '&') { out.append("&#"); out.append((int) c); out.append(';'); } else out.append(c); } return out.toString(); } static void setConsoleInput(String text) { consoleSetInput(text); } static JComponent consoleInputFieldOrComboBox() { Object console = get(getJavaX(), "console"); JComboBox cb = (JComboBox) (getOpt(console, "cbInput")); if (cb != null) return cb; return (JTextField) getOpt(console, "tfInput"); } static String mainClassNameForClassLoader(ClassLoader cl) { return or((String) callOpt(cl, "mainClassName"), "main"); } static Class loadClassFromClassLoader_orNull(ClassLoader cl, String name) { try { return cl == null ? null : cl.loadClass(name); } catch (ClassNotFoundException e) { return null; } } static Throwable unwrapTrivialExceptionWraps(Throwable e) { if (e == null) return e; while (e.getClass() == RuntimeException.class && e.getCause() != null && eq(e.getMessage(), str(e.getCause()))) e = e.getCause(); return e; } static String replacePrefix(String prefix, String replacement, String s) { if (!startsWith(s, prefix)) return s; return replacement + substring(s, l(prefix)); } static Throwable innerException2(Throwable e) { if (e == null) return null; while (empty(e.getMessage()) && e.getCause() != null) e = e.getCause(); return e; } static Throwable getException(Runnable r) { try { callF(r); return null; } catch (Throwable e) { return e; } } static void metaMapPut(IMeta o, Object key, Object value) { { if (o != null) o.metaPut(key, value); } } static void metaMapPut(Object o, Object key, Object value) { var meta = initIMeta(o); { if (meta != null) meta.metaPut(key, value); } } static boolean charactersEqualIC(char c1, char c2) { if (c1 == c2) return true; char u1 = Character.toUpperCase(c1); char u2 = Character.toUpperCase(c2); if (u1 == u2) return true; return Character.toLowerCase(u1) == Character.toLowerCase(u2); } static String xltrim(String s) { int i = 0, n = l(s); while (i < n && contains(" \t\r\n", s.charAt(i))) ++i; return substr(s, i); } static boolean isLetterOrDigit(char c) { return Character.isLetterOrDigit(c); } // pred: char -> bool static String takeCharsWhile(String s, Object pred) { int i = 0; while (i < l(s) && isTrue(callF(pred, s.charAt(i)))) ++i; return substring(s, 0, i); } static String takeCharsWhile(IF1 f, String s) { return takeCharsWhile(s, f); } static String shortenSnippetID(String snippetID) { if (snippetID.startsWith("#")) snippetID = snippetID.substring(1); String httpBlaBla = "http://tinybrain.de/"; if (snippetID.startsWith(httpBlaBla)) snippetID = snippetID.substring(httpBlaBla.length()); return "" + parseLong(snippetID); } static String actualUserHome_value; static String actualUserHome() { if (actualUserHome_value == null) { if (isAndroid()) actualUserHome_value = "/storage/emulated/0/"; else actualUserHome_value = System.getProperty("user.home"); } return actualUserHome_value; } static File actualUserHome(String sub) { return newFile(new File(actualUserHome()), sub); } static File userDir() { return new File(userHome()); } static File userDir(String path) { return new File(userHome(), path); } static Object get2(Object o, String field1, String field2) { return get(get(o, field1), field2); } static boolean startsWithAny(String a, Collection b) { for (String prefix : unnullForIteration(b)) if (startsWith(a, prefix)) return true; return false; } static boolean startsWithAny(String a, String... b) { if (b != null) for (String prefix : unnullForIteration(b)) if (startsWith(a, prefix)) return true; return false; } static boolean startsWithAny(String a, Collection b, Matches m) { for (String prefix : unnullForIteration(b)) if (startsWith(a, prefix, m)) return true; return false; } static String mcDollar() { return mcName() + "$"; } static String afterDollar(String s) { return substring(s, smartIndexOf(s, '$')+1); } static Object realMC() { return getThreadLocal(realMC_tl()); } static Comparator caseInsensitiveComparator() { return betterCIComparator(); } static Object safeUnstructureGZFile(File f) { try { if (!fileExists(f)) return null; BufferedReader reader = utf8BufferedReader(gzInputStream(f)); return unstructure_tok(javaTokC_noMLS_onReader(reader), true, null); } catch (Exception __e) { throw rethrow(__e); } } static boolean isIdentifier(String s) { return isJavaIdentifier(s); } static LinkedHashMap syncMapPut2_createLinkedHashMap(LinkedHashMap map, A key, B value) { if (key != null) if (value != null) { if (map == null) map = new LinkedHashMap(); synchronized(collectionMutex(map)) { map.put(key, value); } } else if (map != null) synchronized(collectionMutex(map)) { map.remove(key); } return map; } static String baseClassName(String className) { return substring(className, className.lastIndexOf('.')+1); } static String baseClassName(Object o) { return baseClassName(getClassName(o)); } static String prependIfNempty(String prefix, String s) { return empty(s) ? unnull(s) : prefix + s; } static void upgradeJavaXAndRestart() { run("#1001639"); restart(); sleep(); } static TreeSet caseInsensitiveSet_treeSet() { return new TreeSet(caseInsensitiveComparator()); } static TreeSet caseInsensitiveSet_treeSet(Collection c) { return toCaseInsensitiveSet_treeSet(c); } static boolean regionMatches(String a, int offsetA, String b, int offsetB, int len) { return a != null && b != null && a.regionMatches(offsetA, b, offsetB, len); } static boolean regionMatches(String a, int offsetA, String b) { return regionMatches(a, offsetA, b, 0, l(b)); } static String javaTok_substringN(String s, int i, int j) { if (i == j) return ""; if (j == i+1 && s.charAt(i) == ' ') return " "; return s.substring(i, j); } static List javaTokWithExisting(String s, List existing) { ++javaTok_n; int nExisting = javaTok_opt && existing != null ? existing.size() : 0; ArrayList tok = existing != null ? new ArrayList(nExisting) : new ArrayList(); int l = s.length(); int i = 0, n = 0; while (i < l) { int j = i; char c, d; // scan for whitespace while (j < l) { c = s.charAt(j); d = j+1 >= l ? '\0' : s.charAt(j+1); if (c == ' ' || c == '\t' || c == '\r' || c == '\n') ++j; else if (c == '/' && d == '*') { do ++j; while (j < l && !s.substring(j, Math.min(j+2, l)).equals("*/")); j = Math.min(j+2, l); } else if (c == '/' && d == '/') { do ++j; while (j < l && "\r\n".indexOf(s.charAt(j)) < 0); } else break; } if (n < nExisting && javaTokWithExisting_isCopyable(existing.get(n), s, i, j)) tok.add(existing.get(n)); else tok.add(javaTok_substringN(s, i, j)); ++n; i = j; if (i >= l) break; c = s.charAt(i); d = i+1 >= l ? '\0' : s.charAt(i+1); // scan for non-whitespace // Special JavaX syntax: 'identifier if (c == '\'' && Character.isJavaIdentifierStart(d) && i+2 < l && "'\\".indexOf(s.charAt(i+2)) < 0) { j += 2; while (j < l && Character.isJavaIdentifierPart(s.charAt(j))) ++j; } else if (c == '\'' || c == '"') { char opener = c; ++j; while (j < l) { if (s.charAt(j) == opener /*|| s.charAt(j) == '\n'*/) { // allow multi-line strings ++j; break; } else if (s.charAt(j) == '\\' && j+1 < l) j += 2; else ++j; } } else if (Character.isJavaIdentifierStart(c)) do ++j; while (j < l && (Character.isJavaIdentifierPart(s.charAt(j)) || "'".indexOf(s.charAt(j)) >= 0)); // for stuff like "don't" else if (Character.isDigit(c)) { do ++j; while (j < l && Character.isDigit(s.charAt(j))); if (j < l && s.charAt(j) == 'L') ++j; // Long constants like 1L } else if (c == '[' && d == '[') { do ++j; while (j+1 < l && !s.substring(j, j+2).equals("]]")); j = Math.min(j+2, l); } else if (c == '[' && d == '=' && i+2 < l && s.charAt(i+2) == '[') { do ++j; while (j+2 < l && !s.substring(j, j+3).equals("]=]")); j = Math.min(j+3, l); } else ++j; if (n < nExisting && javaTokWithExisting_isCopyable(existing.get(n), s, i, j)) tok.add(existing.get(n)); else tok.add(javaTok_substringC(s, i, j)); ++n; i = j; } if ((tok.size() % 2) == 0) tok.add(""); javaTok_elements += tok.size(); return tok; } static boolean javaTokWithExisting_isCopyable(String t, String s, int i, int j) { return t.length() == j-i && s.regionMatches(i, t, 0, j-i); // << could be left out, but that's brave } static boolean equalsIgnoreCase(String a, String b) { return eqic(a, b); } static boolean equalsIgnoreCase(char a, char b) { return eqic(a, b); } static char stringToChar(String s) { if (l(s) != 1) throw fail("bad stringToChar: " + s); return firstChar(s); } static IMeta initIMeta(Object o) { if (o == null) return null; if (o instanceof IMeta) return ((IMeta) o); if (o instanceof JComponent) return initMetaOfJComponent((JComponent) o); // This is not really used. Try to use BufferedImageWithMeta instead if (o instanceof BufferedImage) return optCast(IMeta.class, ((BufferedImage) o).getProperty("meta")); return null; } static String substr(String s, int x) { return substring(s, x); } static String substr(String s, int x, int y) { return substring(s, x, y); } static String mcName() { return mc().getName(); } // returns l(s) if not found static int smartIndexOf(String s, String sub, int i) { if (s == null) return 0; i = s.indexOf(sub, min(i, l(s))); return i >= 0 ? i : l(s); } static int smartIndexOf(String s, int i, char c) { return smartIndexOf(s, c, i); } static int smartIndexOf(String s, char c, int i) { if (s == null) return 0; i = s.indexOf(c, min(i, l(s))); return i >= 0 ? i : l(s); } static int smartIndexOf(String s, String sub) { return smartIndexOf(s, sub, 0); } static int smartIndexOf(String s, char c) { return smartIndexOf(s, c, 0); } static int smartIndexOf(List l, A sub) { return smartIndexOf(l, sub, 0); } static int smartIndexOf(List l, int start, A sub) { return smartIndexOf(l, sub, start); } static int smartIndexOf(List l, A sub, int start) { int i = indexOf(l, sub, start); return i < 0 ? l(l) : i; } static ThreadLocal realMC_tl_tl = new ThreadLocal(); static ThreadLocal realMC_tl() { return realMC_tl_tl; } static betterCIComparator_C betterCIComparator_instance; static betterCIComparator_C betterCIComparator() { if (betterCIComparator_instance == null) betterCIComparator_instance = new betterCIComparator_C(); return betterCIComparator_instance; } final static class betterCIComparator_C implements Comparator { public int compare(String s1, String s2) { if (s1 == null) return s2 == null ? 0 : -1; if (s2 == null) return 1; int n1 = s1.length(); int n2 = s2.length(); int min = Math.min(n1, n2); for (int i = 0; i < min; i++) { char c1 = s1.charAt(i); char c2 = s2.charAt(i); if (c1 != c2) { c1 = Character.toUpperCase(c1); c2 = Character.toUpperCase(c2); if (c1 != c2) { c1 = Character.toLowerCase(c1); c2 = Character.toLowerCase(c2); if (c1 != c2) { // No overflow because of numeric promotion return c1 - c2; } } } } return n1 - n2; } } static boolean fileExists(String path) { return path != null && new File(path).exists(); } static boolean fileExists(File f) { return f != null && f.exists(); } static BufferedReader utf8BufferedReader(InputStream in) { return utf8bufferedReader(in); } static BufferedReader utf8BufferedReader(File f) { return utf8bufferedReader(f); } static Class run(String progID, String... args) { Class main = hotwire(progID); callMain(main, args); return main; } static void restart() { Object j = getJavaX(); call(j, "cleanRestart", get(j, "fullArgs")); } static volatile boolean sleep_noSleep = false; static void sleep(long ms) { ping(); if (ms < 0) return; // allow spin locks if (isAWTThread() && ms > 100) throw fail("Should not sleep on AWT thread"); try { Thread.sleep(ms); } catch (Exception e) { throw new RuntimeException(e); } } static void sleep() { try { if (sleep_noSleep) throw fail("nosleep"); print("Sleeping."); sleepQuietly(); } catch (Exception __e) { throw rethrow(__e); } } static TreeSet toCaseInsensitiveSet_treeSet(Iterable c) { if (isCISet(c)) return (TreeSet) c; TreeSet set = caseInsensitiveSet_treeSet(); addAll(set, c); return set; } static TreeSet toCaseInsensitiveSet_treeSet(String... x) { TreeSet set = caseInsensitiveSet_treeSet(); addAll(set, x); return set; } static char firstChar(String s) { return s.charAt(0); } static IMeta initMetaOfJComponent(JComponent c) { if (c == null) return null; IMeta meta = (IMeta) (c.getClientProperty(IMeta.class)); if (meta == null) c.putClientProperty(IMeta.class, meta = new Meta()); return meta; } static A optCast(Class c, Object o) { return isInstance(c, o) ? (A) o : null; } // custom mainClass only works with hotwire_here static Class hotwire(String src) { return hotwire(src, __1 -> mainClassNameForClassLoader(__1)); } static Class hotwire(String src, IF1 calculateMainClass) { assertFalse(_inCore()); Class j = getJavaX(); if (isAndroid()) { synchronized(j) { // hopefully this goes well... List libraries = new ArrayList(); File srcDir = (File) call(j, "transpileMain", src, libraries); if (srcDir == null) throw fail("transpileMain returned null (src=" + quote(src) + ")"); Object androidContext = get(j, "androidContext"); return (Class) call(j, "loadx2android", srcDir, src); } } else { Class c = (Class) (call(j, "hotwire", src)); hotwire_copyOver(c); return c; } } static A callMain(A c, String... args) { callOpt(c, "main", new Object[] {args}); return c; } static void callMain() { callMain(mc()); } static Object sleepQuietly_monitor = new Object(); static void sleepQuietly() { try { assertFalse(isAWTThread()); synchronized(sleepQuietly_monitor) { sleepQuietly_monitor.wait(); } } catch (Exception __e) { throw rethrow(__e); } } static boolean isCISet(Iterable l) { return l instanceof TreeSet && ((TreeSet) l).comparator() == caseInsensitiveComparator(); } static boolean isInstance(Class type, Object arg) { return type.isInstance(arg); } static void assertFalse(Object o) { if (!(eq(o, false) /*|| isFalse(pcallF(o))*/)) throw fail(str(o)); } static boolean assertFalse(boolean b) { if (b) throw fail("oops"); return b; } static boolean assertFalse(String msg, boolean b) { if (b) throw fail(msg); return b; } static boolean _inCore() { return false; } static List hotwire_copyOver_after = synchroList(); static void hotwire_copyOver(Class c) { // TODO: make a mechanism for making such "inheritable" fields for (String field : ll("print_log", "print_silent", "androidContext", "_userHome")) setOptIfNotNull(c, field, getOpt(mc(), field)); setOptIfNotNull(c, "mainBot" , getMainBot()); setOpt(c, "creator_class" , new WeakReference(mc())); pcallFAll(hotwire_copyOver_after, c); } static void setOptIfNotNull(Object o, String field, Object value) { if (value != null) setOpt(o, field, value); } static Object mainBot; static Object getMainBot() { return mainBot; } static class Chain implements Iterable { A element; Chain next; int size; Chain() {} Chain(A element) { this.element = element; size = 1; } Chain(A element, Chain next) { this.next = next; this.element = element; size = next != null ? next.size+1 : 1; } public String toString() { return str(toList()); } ArrayList toList() { ArrayList l = emptyList(size); Chain c = this; while (c != null) { l.add(c.element); c = c.next; } return l; } // TODO: optimize public Iterator iterator() { return toList().iterator(); } } // Meta - a "minimal" approach to adding meta-level to Java objects static class Meta implements IMeta { // Meta - a "minimal" approach to adding meta-level to Java objects // (implementing the interface IMeta) // We allocate one extra field for each Java object to make it // reasoning-compatible (reasoning-compatible = extensible with // fields of any name at runtime). // // We couldn't go for 0 extra fields (meta values must be linked // directly from the object) and there are no half fields in // Java... so there you go. // // Also, if you don't use any meta data, you are probably not // reasoning about anything. The point of reasoning in JavaX is // to attach information to objects directly used in the program. // Possible information contained in the meta field: // Origin, destination, security level, sender, cost center, // purpose, list of reifications, ... // So here it is. THE FIELD YOU HAVE BEEN WAITING FOR! // [We also have IMeta to retrofit foreign classes (rare but // probably useful).] ////////////////////// // The "meta" field // ////////////////////// // Generic meta value of any kind, but the typical case is it's a // Map with extra field values for the object etc. // "meta" is volatile to avoid synchronization; but you can also synchronize on // _tempMetaMutex() which is usually the object itself. Collections // and maps are exempt from using the collections's monitor as the meta // mutex because their monitor tends to be held for long operations // (e.g. cloneList). For those we use a substantially more complex // algorithm using a weakMap. Probably overkill. I may reconsider. volatile Object meta; // The meta field is not transient, thus by default it will be // persisted like anything else unless you customize your object // to suppress or modulate this. // ...and the interface methods public void _setMeta(Object meta) { this.meta = meta; } public Object _getMeta() { return meta; } // MOST functions are implemented in IMeta (default implementations) // Scaffolding convenience functions final boolean scaffolding(){ return scaffoldingEnabled(); } boolean scaffoldingEnabled() { return main.scaffoldingEnabled(this); } boolean scaffoldingEnabled(Object o) { return main.scaffoldingEnabled(o); } } static interface IMeta { // see class "Meta" for the bla bla public void _setMeta(Object meta); public Object _getMeta(); default public IAutoCloseableF0 _tempMetaMutex() { return new IAutoCloseableF0() { public Object get() { return IMeta.this; } public void close() {} }; } // actually query another object default public Object getMeta(Object obj, Object key){ return metaGet(obj, key); } default public Object metaGet(Object obj, Object key) { // call global function return metaMapGet(obj, key); } default public Object metaGet(String key, Object obj) { // call global function return metaMapGet(obj, key); } default public Object getMeta(Object key){ return metaGet(key); } default public Object metaGet(Object key) { if (key == null) return null; Object meta = _getMeta(); if (meta instanceof Map) return ((Map) meta).get(key); return null; } default public void metaSet(IMeta obj, Object key, Object value){ metaPut(obj, key, value); } default public void metaPut(IMeta obj, Object key, Object value) { // call global function metaMapPut(obj, key, value); } default public void metaSet(Object key, Object value){ metaPut(key, value); } default public void metaPut(Object key, Object value) { if (key == null) return; Map map = convertObjectMetaToMap(this); syncMapPutOrRemove(map, key, value); } } static class DefunctClassLoader {} // a variant of thread where you can get the Runnable target later. // Also notes its existence on the VM bus. // We should use this exclusively instead of Thread. static class BetterThread extends Thread { Runnable target; BetterThread(Runnable target) { this.target = target; _created(); } BetterThread(Runnable target, String name) { super(name); this.target = target; _created(); } void _created() { vmBus_send("threadCreated", this); } public void run() { try { try { vmBus_send("threadStarted", this); if (target != null) target.run(); } finally { vmBus_send("threadEnded", this); } } catch (Exception __e) { throw rethrow(__e); } } Runnable getTarget() { return target; } } static class WidthAndHeightImpl extends Meta implements WidthAndHeight , ByteIO , IFieldsToList{ int width; int height; WidthAndHeightImpl() {} WidthAndHeightImpl(int width, int height) { this.height = height; this.width = width;}public Object[] _fieldsToList() { return new Object[] {width, height}; } public int getWidth() { return width; } public int getHeight() { return height; } public String toString() { return n2(width) + "*" + n2(height) + " px"; } public void readWrite(ByteHead head) { head.exchangeInt(() -> width(), w -> width = w); head.exchangeInt(() -> height(), h -> height = h); } } static class RGB { // usually in range [0, 1] public float r, g, b; // can't be final cause persistence RGB() {} public RGB(float r, float g, float b) { this.r = r; this.g = g; this.b = b; } public RGB(double r, double g, double b) { this.r = (float) r; this.g = (float) g; this.b = (float) b; } public RGB(double[] rgb) { this(rgb[0], rgb[1], rgb[2]); } public RGB(int rgb) { r = rgbRed(rgb)/255f; g = rgbGreen(rgb)/255f; b = rgbBlue(rgb)/255f; } public RGB(double brightness) { this.r = this.g = this.b = max(0f, min(1f, (float) brightness)); } public RGB(Color color) { r = color.getRed()/255f; g = color.getGreen()/255f; b = color.getBlue()/255f; } // TODO: 3-char version public RGB(String hex) { int i = l(hex)-6; r = Integer.parseInt(hex.substring(i, i+2), 16)/255f; g = Integer.parseInt(hex.substring(i+2, i+4), 16)/255f; b = Integer.parseInt(hex.substring(i+4, i+6), 16)/255f; } public float getComponent(int i) { return i == 0 ? r : i == 1 ? g : b; } public int getInt(int i) { return i == 0 ? redInt() : i == 1 ? greenInt() : blueInt(); } public Color getColor() { return new Color(r, g, b); } public static RGB newSafe(float r, float g, float b) { return new RGB(Math.max(0, Math.min(1, r)), Math.max(0, Math.min(1, g)), Math.max(0, Math.min(1, b))); } int asInt() { return getColor().getRGB() & 0xFFFFFF; } int getInt() { return getColor().getRGB() & 0xFFFFFF; } int asIntWithAlpha() { return rgbInt(redInt(), greenInt(), blueInt()) | 0xFF000000; } public float getBrightness() { return (r+g+b)/3.0f; } public String getHexString() { return Integer.toHexString(asInt() | 0xFF000000).substring(2).toUpperCase(); } @Override public boolean equals(Object o) { if (this == o) return true; if (!(o instanceof RGB)) return false; RGB rgb = (RGB) o; if (Float.compare(rgb.b, b) != 0) return false; if (Float.compare(rgb.g, g) != 0) return false; if (Float.compare(rgb.r, r) != 0) return false; return true; } @Override public int hashCode() { int result = (r != +0.0f ? Float.floatToIntBits(r) : 0); result = 31 * result + (g != +0.0f ? Float.floatToIntBits(g) : 0); result = 31 * result + (b != +0.0f ? Float.floatToIntBits(b) : 0); return result; } public boolean isBlack() { return r == 0f && g == 0f && b == 0f; } public boolean isWhite() { return r == 1f && g == 1f && b == 1f; } public String toString() { return getHexString(); } int redInt() { return iround(r*255); } int greenInt() { return iround(g*255); } int blueInt() { return iround(b*255); } static float brightnessToFloat(int brightness) { return brightness/255f; } } static class Range { float min = 1f, max = 0f; // indicates no range Range() {} Range(float x) { min = max = x; } Range(float min, float max) { this.max = max; this.min = min;} boolean empty() { return min > max; } float length() { return max(0f, max-min); } } static class ByteBuffer implements Iterable { byte[] data; int size; ByteBuffer() {} ByteBuffer(int size) { if (size != 0) data = new byte[size]; } ByteBuffer(Iterable l) { if (l instanceof Collection) allocate(((Collection) l).size()); addAll(l); } ByteBuffer(byte[] data) { this.data = data; size = l(data); } // TODO *(ByteBuffer buf) { ... } void add(int idx, int i) { add(0); arraycopy(data, idx, data, idx+1, size-(idx+1)); data[idx] = (byte) i; } void add(int i) { add((byte) i); } void add(byte i) { if (size >= lByteArray(data)) { allocate(Math.max(1, toInt(Math.min(maximumSafeArraySize(), lByteArray(data)*2L)))); if (size >= data.length) throw fail("ByteBuffer too large: " + size); } data[size++] = i; } void allocate(int n) { data = resizeByteArray(data, max(n, size())); } void addAll(Iterable l) { if (l != null) for (byte i : l) add(i); } final byte[] toByteArray(){ return toArray(); } byte[] toArray() { return size == 0 ? null : resizeByteArray(data, size); } List toList() { return byteArrayToList(data, 0, size); } List asVirtualList() { return new RandomAccessAbstractList() { public int size() { return size; } public Byte get(int i) { return ByteBuffer.this.get(i); } public Byte set(int i, Byte val) { Byte a = get(i); data[i] = val; return a; } }; } void reset() { size = 0; } void clear() { reset(); } int size() { return size; } boolean isEmpty() { return size == 0; } byte get(int idx) { if (idx >= size) throw fail("Index out of range: " + idx + "/" + size); return data[idx]; } void set(int idx, byte value) { if (idx >= size) throw fail("Index out of range: " + idx + "/" + size); data[idx] = value; } byte popLast() { if (size == 0) throw fail("empty buffer"); return data[--size]; } // unefficient byte popFirst() { if (size == 0) throw fail("empty buffer"); byte b = data[0]; arraycopy(data, 1, 0, --size); return b; } byte last() { return data[size-1]; } byte nextToLast() { return data[size-2]; } public String toString() { return squareBracket(joinWithSpace(toList())); } public Iterator iterator() { return new IterableIterator() { int i = 0; public boolean hasNext() { return i < size; } public Byte next() { //if (!hasNext()) fail("Index out of bounds: " + i); return data[i++]; } }; } /*public ByteIterator byteIterator() { ret new ByteIterator { int i = 0; public bool hasNext() { ret i < size; } public int next() { //if (!hasNext()) fail("Index out of bounds: " + i); ret data[i++]; } toString { ret "Iterator@" + i + " over " + ByteBuffer.this; } }; }*/ void trimToSize() { data = resizeByteArray(data, size); } int indexOf(byte b) { for (int i = 0; i < size; i++) if (data[i] == b) return i; return -1; } byte[] subArray(int start, int end) { return subByteArray(data, start, min(end, size)); } } static class Complex implements IFieldsToList{ static final String _fieldOrder = "re im"; double re; double im; Complex() {} Complex(double re, double im) { this.im = im; this.re = re;} public boolean equals(Object o) { if (!(o instanceof Complex)) return false; Complex __1 = (Complex) o; return re == __1.re && im == __1.im; } public int hashCode() { int h = -1679819632; h = boostHashCombine(h, _hashCode(re)); h = boostHashCombine(h, _hashCode(im)); return h; } public Object[] _fieldsToList() { return new Object[] {re, im}; } double abs() { return sqrt(re*re+im*im); } double re() { return re; } double im() { return im; } final double angle(){ return phase(); } double phase() { return Math.atan2(im, re); } double fracAngle() { return fracNonNeg(angle()/twoPi()); } // angle as 0 to 1 public String toString() { if (im != 0) return re == 0 ? im + "i" : re + plusPrefixUnlessMinus(str(im)) + "i"; else return str(re); } } static interface IF2 { C get(A a, B b); } static interface Producer { public A next(); // null when end } // Note: This does have the values problem (complicated values can cause memory leaks) static class BetterThreadLocal { Map map = newWeakHashMap(); BetterThreadLocal() {} BetterThreadLocal(A value) { set(value); } boolean isSet() { return map.containsKey(currentThread()); } A get() { if (map.containsKey(currentThread())) return map.get(currentThread()); A value = initialValue(); set(value); return value; } A get(Thread thread) { return thread == null ? null : map.get(thread); } void set(A a) { map.put(currentThread(), a); } public A initialValue() { return null; } } static class ReverseChain implements Iterable { A element; ReverseChain prev; int size; ReverseChain() {} ReverseChain(ReverseChain prev, A element) { this.element = element; this.prev = prev; if (prev == null) size = 1; else { prev.check(); size = prev.size+1; } } void check() { if (size < 1) throw fail("You called the ReverseChain default constructor. Don't do that"); } public String toString() { return str(toList()); } ArrayList toList() { check(); ArrayList l = emptyList(size); for (int i = 0; i < size; i++) l.add(null); int i = size; ReverseChain c = this; while (c != null) { l.set(--i, c.element); c = c.prev; } return l; } public Iterator iterator() { return toList().iterator(); } } // -has fast nextElement() and prevElement() // -design allows for more functions like reordering the list // -Saves up to 34% in space over LinkedHashSet // (e.g. 22% for a set of 1,000 Ints) static class CompactLinkedHashSet extends AbstractSet { UnsynchronizedCompactHashSet> entries = new UnsynchronizedCompactHashSet(); Entry head, tail; static class Entry { A value; Entry prev, next; public int hashCode() { return _hashCode(value); } // "magic" equals function for CompactHashSet lookup without temp object public boolean equals(Object o) { return o == this || eq(value, o); } } public boolean add(A a) { if (entries.contains(a)) return false; Entry n = new Entry(); n.value = a; n.prev = tail; if (tail != null) tail.next = n; tail = n; if (head == null) head = n; entries.add(n); return true; } public boolean remove(Object a) { return remove(entries.find(a)); } public boolean remove(Entry node) { if (node == null) return false; if (node.next != null) node.next.prev = node.prev; else tail = node.prev; if (node.prev != null) node.prev.next = node.next; else head = node.next; entries.remove(node); return true; } public int size() { return entries.size(); } public IterableIterator iterator() { return new IterableIterator() { Entry entry = head, prev = null; public boolean hasNext() { return entry != null; } public A next() { A a = entry.value; prev = entry; entry = entry.next; return a; } // untested public void remove() { if (prev == null) throw new IllegalStateException(); CompactLinkedHashSet.this.remove(prev); prev = null; } }; } public void clear() { entries.clear(); head = tail = null; } public boolean contains(Object a) { return entries.contains(a); } public A find(Object o) { Entry e = entries.find(o); return e == null ? null : e.value; } public A prevElement(A a) { Entry e = entries.find(a); if (e == null || e.prev == null) return null; return e.prev.value; } public A nextElement(A a) { Entry e = entries.find(a); if (e == null || e.next == null) return null; return e.next.value; } public A first() { return head == null ? null : head.value; } public A last() { return tail == null ? null : tail.value; } boolean removeIfSame(Object o) { A value = find(o); if (value == o) { remove(value); return true; } return false; } } static interface IVF2 { void get(A a, B b); } static interface IAutoCloseableF0 extends IF0, AutoCloseable {} /* * #! * Ontopia Engine * #- * Copyright (C) 2001 - 2013 The Ontopia Project * #- * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * !# */ // modified by Stefan Reich // Implements the Set interface more compactly than // java.util.HashSet by using a closed hashtable. // Note: equals is always called on the _stored_ object, not the one // passed as an argument to find(), contains() etc. // (In case you want to put special magic in your equals() function) static class UnsynchronizedCompactHashSet extends java.util.AbstractSet { protected final static int INITIAL_SIZE = 3; public final static double LOAD_FACTOR = 0.75; protected final static Object nullObject = new Object(); protected final static Object deletedObject = new Object(); protected int elements; protected int freecells; protected A[] objects; protected int modCount; UnsynchronizedCompactHashSet() { this(INITIAL_SIZE); } UnsynchronizedCompactHashSet(int size) { // NOTE: If array size is 0, we get a // "java.lang.ArithmeticException: / by zero" in add(Object). objects = (A[]) new Object[(size==0 ? 1 : size)]; elements = 0; freecells = objects.length; modCount = 0; } UnsynchronizedCompactHashSet(Collection c) { this(c.size()); addAll(c); } @Override public Iterator iterator() { return new CompactHashIterator(); } @Override public int size() { return elements; } @Override public boolean isEmpty() { return elements == 0; } @Override public boolean contains(Object o) { return find(o) != null; } A find(Object o) { if (o == null) o = nullObject; int hash = o.hashCode(); int index = (hash & 0x7FFFFFFF) % objects.length; int offset = 1; // search for the object (continue while !null and !this object) while(objects[index] != null && !(objects[index].hashCode() == hash && objects[index].equals(o))) { index = ((index + offset) & 0x7FFFFFFF) % objects.length; offset = offset*2 + 1; if (offset == -1) offset = 2; } return objects[index]; } boolean removeIfSame(Object o) { A value = find(o); if (value == o) { remove(value); return true; } return false; } @Override public boolean add(Object o) { if (o == null) o = nullObject; int hash = o.hashCode(); int index = (hash & 0x7FFFFFFF) % objects.length; int offset = 1; int deletedix = -1; // search for the object (continue while !null and !this object) while(objects[index] != null && !(objects[index].hashCode() == hash && objects[index].equals(o))) { // if there's a deleted object here we can put this object here, // provided it's not in here somewhere else already if (objects[index] == deletedObject) deletedix = index; index = ((index + offset) & 0x7FFFFFFF) % objects.length; offset = offset*2 + 1; if (offset == -1) offset = 2; } if (objects[index] == null) { // wasn't present already if (deletedix != -1) // reusing a deleted cell index = deletedix; else freecells--; modCount++; elements++; // here we face a problem regarding generics: // add(A o) is not possible because of the null Object. We cant do 'new A()' or '(A) new Object()' // so adding an empty object is a problem here // If (! o instanceof A) : This will cause a class cast exception // If (o instanceof A) : This will work fine objects[index] = (A) o; // do we need to rehash? if (1 - (freecells / (double) objects.length) > LOAD_FACTOR) rehash(); return true; } else // was there already return false; } @Override public boolean remove(Object o) { if (o == null) o = nullObject; int hash = o.hashCode(); int index = (hash & 0x7FFFFFFF) % objects.length; int offset = 1; // search for the object (continue while !null and !this object) while(objects[index] != null && !(objects[index].hashCode() == hash && objects[index].equals(o))) { index = ((index + offset) & 0x7FFFFFFF) % objects.length; offset = offset*2 + 1; if (offset == -1) offset = 2; } // we found the right position, now do the removal if (objects[index] != null) { // we found the object // same problem here as with add objects[index] = (A) deletedObject; modCount++; elements--; return true; } else // we did not find the object return false; } @Override public void clear() { elements = 0; for (int ix = 0; ix < objects.length; ix++) objects[ix] = null; freecells = objects.length; modCount++; } @Override public Object[] toArray() { Object[] result = new Object[elements]; Object[] objects = this.objects; int pos = 0; for (int i = 0; i < objects.length; i++) if (objects[i] != null && objects[i] != deletedObject) { if (objects[i] == nullObject) result[pos++] = null; else result[pos++] = objects[i]; } // unchecked because it should only contain A return result; } // not sure if this needs to have generics @Override public T[] toArray(T[] a) { int size = elements; if (a.length < size) a = (T[])java.lang.reflect.Array.newInstance( a.getClass().getComponentType(), size); A[] objects = this.objects; int pos = 0; for (int i = 0; i < objects.length; i++) if (objects[i] != null && objects[i] != deletedObject) { if (objects[i] == nullObject) a[pos++] = null; else a[pos++] = (T) objects[i]; } return a; } protected void rehash() { int garbagecells = objects.length - (elements + freecells); if (garbagecells / (double) objects.length > 0.05) // rehash with same size rehash(objects.length); else // rehash with increased capacity rehash(objects.length*2 + 1); } protected void rehash(int newCapacity) { int oldCapacity = objects.length; @SuppressWarnings("unchecked") A[] newObjects = (A[]) new Object[newCapacity]; for (int ix = 0; ix < oldCapacity; ix++) { Object o = objects[ix]; if (o == null || o == deletedObject) continue; int hash = o.hashCode(); int index = (hash & 0x7FFFFFFF) % newCapacity; int offset = 1; // search for the object while(newObjects[index] != null) { // no need to test for duplicates index = ((index + offset) & 0x7FFFFFFF) % newCapacity; offset = offset*2 + 1; if (offset == -1) offset = 2; } newObjects[index] = (A) o; } objects = newObjects; freecells = objects.length - elements; } private class CompactHashIterator implements Iterator { private int index; private int lastReturned = -1; private int expectedModCount; @SuppressWarnings("empty-statement") public CompactHashIterator() { for (index = 0; index < objects.length && (objects[index] == null || objects[index] == deletedObject); index++) ; expectedModCount = modCount; } @Override public boolean hasNext() { return index < objects.length; } @SuppressWarnings("empty-statement") @Override public T next() { /*if (modCount != expectedModCount) throw new ConcurrentModificationException();*/ int length = objects.length; if (index >= length) { lastReturned = -2; throw new NoSuchElementException(); } lastReturned = index; for (index += 1; index < length && (objects[index] == null || objects[index] == deletedObject); index++) ; if (objects[lastReturned] == nullObject) return null; else return (T) objects[lastReturned]; } @Override public void remove() { if (modCount != expectedModCount) throw new ConcurrentModificationException(); if (lastReturned == -1 || lastReturned == -2) throw new IllegalStateException(); // delete object if (objects[lastReturned] != null && objects[lastReturned] != deletedObject) { objects[lastReturned] = (A) deletedObject; elements--; modCount++; expectedModCount = modCount; // this is expected; we made the change } } } int capacity() { return objects.length; } // returns true if there was a shrink boolean shrinkToFactor(double factor) { if (factor > LOAD_FACTOR) throw fail("Shrink factor must be equal to or smaller than load factor: " + factor + " / " + LOAD_FACTOR); int newCapacity = max(INITIAL_SIZE, iround(size()/factor)); if (newCapacity >= capacity()) return false; rehash(newCapacity); return true; } } static Object metaGet(IMeta o, Object key) { return metaMapGet(o, key); } static Object metaGet(Object o, Object key) { return metaMapGet(o, key); } static Object metaGet(String key, IMeta o) { return metaMapGet(o, key); } static Object metaGet(String key, Object o) { return metaMapGet(o, key); } static Object metaMapGet(IMeta o, Object key) { return o == null ? null : o.metaGet(key); // We now let the object itself do it (overridable!) } static Object metaMapGet(Object o, Object key) { return metaMapGet(toIMeta(o), key); } static void metaPut(IMeta o, Object key, Object value) { metaMapPut(o, key, value); } static void metaPut(Object o, Object key, Object value) { metaMapPut(o, key, value); } static Map convertObjectMetaToMap(IMeta o) { return convertObjectMetaToMap(o, () -> makeObjectMetaMap()); } static Map convertObjectMetaToMap(IMeta o, IF0 createEmptyMap) { if (o == null) return null; // The following shortcut depends on the assumption that a meta field never reverts // to null when it was a map Object meta = o._getMeta(); if (meta instanceof Map) return ((Map) meta); // non-shortcut path (create meta) var mutex = tempMetaMutex(o); try { var actualMutex = mutex.get(); synchronized(actualMutex) { meta = o._getMeta(); if (meta instanceof Map) return ((Map) meta); Map map = createEmptyMap.get(); if (meta != null) map.put("previousMeta" , meta); o._setMeta(map); return map; } } finally { _close(mutex); }} static void syncMapPutOrRemove(Map map, A key, B value) { syncMapPut2(map, key, value); } static int rgbRed(int rgb) { return (rgb >> 16) & 0xFF; } static int rgbGreen(int rgb) { return (rgb >> 8) & 0xFF; } static int rgbBlue(int rgb) { return rgb & 0xFF; } static Color getColor(BufferedImage img, int x, int y) { return colorFromRGBA(img.getRGB(x, y)); } static Color getColor(BufferedImage img, Pt p) { return colorFromRGBA(img.getRGB(p.x, p.y)); } static int rgbInt(int r, int g, int b) { return (clamp(r, 0, 255) << 16) | (clamp(g, 0, 255) << 8) | clamp(b, 0, 255); } static int rgbInt(byte r, byte g, byte b) { return (ubyteToInt(r) << 16) | (ubyteToInt(g) << 8) | ubyteToInt(b); } static int asInt(Object o) { return toInt(o); } static int lByteArray(byte[] a) { return a == null ? 0 : a.length; } static byte[] resizeByteArray(byte[] a, int n) { if (n == l(a)) return a; byte[] b = new byte[n]; arraycopy(a, 0, b, 0, min(l(a), n)); return b; } static ArrayList byteArrayToList(byte[] a) { if (a == null) return null; return byteArrayToList(a, 0, a.length); } // no range checking on from/to in the interest of speed static ArrayList byteArrayToList(byte[] a, int from, int to) { if (a == null) return null; ArrayList < Byte > l = new ArrayList<>(to-from); for (int i = from; i < to; i++) l.add(a[i]); return l; } static A nextToLast(List l) { return get(l, l(l)-2); } static double fracNonNeg(double d) { return frac_nonNeg(d); } static double twoPi() { return Math.PI*2; } static String plusPrefixUnlessMinus(String s) { return startsWith(s, "-") ? s : "+" + s; } static String find(String pattern, String text) { Matcher matcher = Pattern.compile(pattern).matcher(text); if (matcher.find()) return matcher.group(1); return null; } static A find(Collection c, Object... data) { for (A x : c) if (checkFields(x, data)) return x; return null; } static IMeta toIMeta(Object o) { return initIMeta(o); } static Map makeObjectMetaMap() { //ret synchroLinkedHashMap(); return new CompactHashMap(); } static IAutoCloseableF0 tempMetaMutex(IMeta o) { return o == null ? null : o._tempMetaMutex(); } static void syncMapPut2(Map map, A key, B value) { if (map != null && key != null) synchronized(collectionMutex(map)) { if (value != null) map.put(key, value); else map.remove(key); } } static Color colorFromRGBA(int rgba) { return new Color(rgba, true); } static float clamp(float x, float a, float b) { return x < a ? a : x > b ? b : x; } static double clamp(double x, double a, double b) { return x < a ? a : x > b ? b : x; } static int clamp(int x, int a, int b) { return x < a ? a : x > b ? b : x; } static long clamp(long x, long a, long b) { return x < a ? a : x > b ? b : x; } static double frac_nonNeg(double d) { return mod(d, 1); } static boolean checkFields(Object x, Object... data) { for (int i = 0; i < l(data); i += 2) if (neq(getOpt(x, (String) data[i]), data[i+1])) return false; return true; } // better modulo that gives positive numbers always static int mod(int n, int m) { return (n % m + m) % m; } static long mod(long n, long m) { return (n % m + m) % m; } static BigInteger mod(BigInteger n, int m) { return n.mod(bigint(m)); } static double mod(double n, double m) { return (n % m + m) % m; } // size: // 64 bytes for 0 to 1 elements // 96 bytes for 2 to 4 elements /* * #! * Ontopia Engine * #- * Copyright (C) 2001 - 2013 The Ontopia Project * #- * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * !# */ static class CompactHashMap extends CompactAbstractMap { final static int INITIAL_SIZE = 3; final static double LOAD_FACTOR = 0.6; // This object is used to represent a null KEY (null value are kept as is) final static Object nullObject = new Object(); /** * When a key is deleted this object is put into the hashtable in * its place, so that other entries with the same key (collisions) * further down the hashtable are not lost after we delete an object * in the collision chain. */ final static Object deletedObject = new Object(); int elements; int freecells; Object[] table; // key, value, key, value, ... //int modCount; CompactHashMap() { this(INITIAL_SIZE); } CompactHashMap(int size) { table = new Object[(size==0 ? 1 : size)*2]; elements = 0; freecells = tableSize(); //modCount = 0; } // TODO: allocate smarter CompactHashMap(Map map) { this(0); if (map != null) putAll(map); } // ===== MAP IMPLEMENTATION ============================================= /** * Returns the number of key/value mappings in this map. */ public synchronized int size() { return elements; } /** * Returns true if this map contains no mappings. */ public synchronized boolean isEmpty() { return elements == 0; } /** * Removes all key/value mappings in the map. */ public synchronized void clear() { elements = 0; for (int ix = 0; ix < tableSize(); ix++) { key(ix, null); value(ix, null); } freecells = tableSize(); //modCount++; } /** * Returns true if this map contains the specified key. */ public synchronized boolean containsKey(Object k) { return key(findKeyIndex(k)) != null; } /** * Returns true if this map contains the specified value. */ public synchronized boolean containsValue(Object v) { if (v == null) v = (V)nullObject; for (int ix = 0; ix < tableSize(); ix++) if (value(ix) != null && value(ix).equals(v)) return true; return false; } /** * Returns a read-only set view of the map's keys. */ public synchronized Set> entrySet() { return new EntrySet(); } /** * Removes the mapping with key k, if there is one, and returns its * value, if there is one, and null if there is none. */ public synchronized V remove(Object k) { int index = findKeyIndex(k); // we found the right position, now do the removal if (key(index) != null) { // we found the object // same problem here as with put V v = value(index); key(index, deletedObject); value(index, deletedObject); //modCount++; elements--; return v; } else // we did not find the key return null; } /** * Adds the specified mapping to this map, returning the old value for * the mapping, if there was one. */ public synchronized V put(K k, V v) { if (k == null) k = (K)nullObject; int hash = k.hashCode(); int index = (hash & 0x7FFFFFFF) % tableSize(); int offset = 1; int deletedix = -1; // search for the key (continue while !null and !this key) while(key(index) != null && !(key(index).hashCode() == hash && key(index).equals(k))) { // if there's a deleted mapping here we can put this mapping here, // provided it's not in here somewhere else already if (key(index) == deletedObject) deletedix = index; index = ((index + offset) & 0x7FFFFFFF) % tableSize(); offset = offset*2 + 1; if (offset == -1) offset = 2; } if (key(index) == null) { // wasn't present already if (deletedix != -1) // reusing a deleted cell index = deletedix; else freecells--; //modCount++; elements++; key(index, k); value(index, v); // rehash with increased capacity if (1 - (freecells / (double) tableSize()) > LOAD_FACTOR) rehash(tableSize()*2 + 1); return null; } else { // was there already //modCount++; V oldv = value(index); value(index, v); return oldv; } } /** * INTERNAL: Rehashes the hashmap to a bigger size. */ void rehash(int newCapacity) { int oldCapacity = tableSize(); Object[] newTable = new Object[newCapacity*2]; for (int ix = 0; ix < oldCapacity; ix++) { Object k = key(ix); if (k == null || k == deletedObject) continue; int hash = k.hashCode(); int index = (hash & 0x7FFFFFFF) % newCapacity; int offset = 1; // search for the key while(newTable[index*2] != null) { // no need to test for duplicates index = ((index + offset) & 0x7FFFFFFF) % newCapacity; offset = offset*2 + 1; if (offset == -1) offset = 2; } newTable[index*2] = k; newTable[index*2+1] = value(ix); } table = newTable; freecells = tableSize() - elements; } /** * Returns the value for the key k, if there is one, and null if * there is none. */ public synchronized V get(Object k) { return value(findKeyIndex(k)); } /** * Returns a virtual read-only collection containing all the values * in the map. */ public synchronized Collection values() { return new ValueCollection(); } /** * Returns a virtual read-only set of all the keys in the map. */ public synchronized Set keySet() { return new KeySet(); } // --- Internal utilities final int findKeyIndex(Object k) { if (k == null) k = nullObject; int hash = k.hashCode(); int index = (hash & 0x7FFFFFFF) % tableSize(); int offset = 1; // search for the key (continue while !null and !this key) while(key(index) != null && !(key(index).hashCode() == hash && key(index).equals(k))) { index = ((index + offset) & 0x7FFFFFFF) % tableSize(); offset = offset*2 + 1; if (offset == -1) offset = 2; } return index; } // --- Key set class KeySet extends AbstractSet { public int size() { synchronized(CompactHashMap.this) { return elements; }} public boolean contains(Object k) { synchronized(CompactHashMap.this) { return containsKey(k); }} public Iterator iterator() { synchronized(CompactHashMap.this) { return new KeyIterator(); }} } class KeyIterator implements Iterator { private int ix; private KeyIterator() { synchronized(CompactHashMap.this) { // walk up to first value, so that hasNext() and next() return // correct results for (; ix < tableSize(); ix++) if (value(ix) != null && key(ix) != deletedObject) break; } } public boolean hasNext() { synchronized(CompactHashMap.this) { return ix < tableSize(); }} public void remove() { throw new UnsupportedOperationException("Collection is read-only"); } public K next() { synchronized(CompactHashMap.this) { if (ix >= tableSize()) throw new NoSuchElementException(); K key = (K) key(ix++); // walk up to next value for (; ix < tableSize(); ix++) if (key(ix) != null && key(ix) != deletedObject) break; // ix now either points to next key, or outside array (if no next) return key; }} } // --- Entry set class EntrySet extends AbstractSet> { public int size() { synchronized(CompactHashMap.this) { return elements; }} public boolean contains(Object o) { synchronized(CompactHashMap.this) { if (o instanceof Map.Entry) { Object key = ((Map.Entry) o).getKey(); if (!containsKey((Map.Entry) o)) return false; return eq(((Map.Entry) o).getValue(), get(key)); } return false; }} public Iterator> iterator() { return new EntryIterator(); } } class EntryIterator implements Iterator> { private int ix; private EntryIterator() { synchronized(CompactHashMap.this) { // walk up to first value, so that hasNext() and next() return // correct results for (; ix < tableSize(); ix++) if (value(ix) != null && key(ix) != deletedObject) break; } } public boolean hasNext() { synchronized(CompactHashMap.this) { return ix < tableSize(); }} public void remove() { throw new UnsupportedOperationException("Collection is read-only"); } public Map.Entry next() { synchronized(CompactHashMap.this) { if (ix >= tableSize()) throw new NoSuchElementException(); K key = key(ix); V val = value(ix); ++ix; // walk up to next value for (; ix < tableSize(); ix++) if (key(ix) != null && key(ix) != deletedObject) break; // ix now either points to next key, or outside array (if no next) return simpleMapEntry(key, val); }} } // --- Value collection class ValueCollection extends AbstractCollection { public int size() { synchronized(CompactHashMap.this) { return elements; }} public Iterator iterator() { return new ValueIterator(); } public boolean contains(Object v) { return containsValue(v); } } class ValueIterator implements Iterator { private int ix; private ValueIterator() { synchronized(CompactHashMap.this) { // walk up to first value, so that hasNext() and next() return // correct results for (; ix < table.length/2; ix++) if (value(ix) != null && value(ix) != deletedObject) break; } } public boolean hasNext() { synchronized(CompactHashMap.this) { return ix < tableSize(); }} public void remove() { throw new UnsupportedOperationException("Collection is read-only"); } public V next() { synchronized(CompactHashMap.this) { if (ix >= tableSize()) throw new NoSuchElementException(); V value = (V) value(ix++); // walk up to next value for (; ix < tableSize(); ix++) if (value(ix) != null && value(ix) != deletedObject) break; // ix now either points to next value, or outside array (if no next) return value; }} } K key(int i) { return (K) table[i*2]; } void key(int i, Object key) { table[i*2] = key; } V value(int i) { return (V) table[i*2+1]; } void value(int i, Object value) { table[i*2+1] = value; } int tableSize() { return table.length/2; } } abstract static class CompactAbstractMap implements Map { public int size() { return entrySet().size(); } public boolean isEmpty() { return size() == 0; } public boolean containsValue(Object value) { Iterator> i = entrySet().iterator(); if (value == null) { while (i.hasNext()) { Entry e = i.next(); if (e.getValue() == null) return true; } } else { while (i.hasNext()) { Entry e = i.next(); if (value.equals(e.getValue())) return true; } } return false; } public boolean containsKey(Object key) { Iterator> i = entrySet().iterator(); if (key == null) { while (i.hasNext()) { Entry e = i.next(); if (e.getKey() == null) return true; } } else { while (i.hasNext()) { Entry e = i.next(); if (key.equals(e.getKey())) return true; } } return false; } public V get(Object key) { Iterator> i = entrySet().iterator(); if (key == null) { while (i.hasNext()) { Entry e = i.next(); if (e.getKey() == null) return e.getValue(); } } else { while (i.hasNext()) { Entry e = i.next(); if (key.equals(e.getKey())) return e.getValue(); } } return null; } public V put(K key, V value) { throw new UnsupportedOperationException(); } public V remove(Object key) { Iterator> i = entrySet().iterator(); Entry correctEntry = null; if (key == null) { while (correctEntry == null && i.hasNext()) { Entry e = i.next(); if (e.getKey() == null) correctEntry = e; } } else { while (correctEntry == null && i.hasNext()) { Entry e = i.next(); if (key.equals(e.getKey())) correctEntry = e; } } V oldValue = null; if (correctEntry != null) { oldValue = correctEntry.getValue(); i.remove(); } return oldValue; } public void putAll(Map m) { for (Entry e : m.entrySet()) put(e.getKey(), e.getValue()); } public void clear() { entrySet().clear(); } public Set keySet() { return new AbstractSet() { public Iterator iterator() { return new Iterator() { private Iterator> i = entrySet().iterator(); public boolean hasNext() { return i.hasNext(); } public K next() { return i.next().getKey(); } public void remove() { i.remove(); } }; } public int size() { return CompactAbstractMap.this.size(); } public boolean isEmpty() { return CompactAbstractMap.this.isEmpty(); } public void clear() { CompactAbstractMap.this.clear(); } public boolean contains(Object k) { return CompactAbstractMap.this.containsKey(k); } }; } public Collection values() { return new AbstractCollection() { public Iterator iterator() { return new Iterator() { private Iterator> i = entrySet().iterator(); public boolean hasNext() { return i.hasNext(); } public V next() { return i.next().getValue(); } public void remove() { i.remove(); } }; } public int size() { return CompactAbstractMap.this.size(); } public boolean isEmpty() { return CompactAbstractMap.this.isEmpty(); } public void clear() { CompactAbstractMap.this.clear(); } public boolean contains(Object v) { return CompactAbstractMap.this.containsValue(v); } }; } public abstract Set> entrySet(); public boolean equals(Object o) { if (o == this) return true; if (!(o instanceof Map)) return false; Map m = (Map) o; if (m.size() != size()) return false; try { for (Entry e : entrySet()) { K key = e.getKey(); V value = e.getValue(); if (value == null) { if (!(m.get(key) == null && m.containsKey(key))) return false; } else { if (!value.equals(m.get(key))) return false; } } } catch (ClassCastException unused) { return false; } catch (NullPointerException unused) { return false; } return true; } public int hashCode() { int h = 0; for (Entry entry : entrySet()) h += entry.hashCode(); return h; } public String toString() { Iterator> i = entrySet().iterator(); if (!i.hasNext()) return "{}"; StringBuilder sb = new StringBuilder(); sb.append('{'); for (; ; ) { Entry e = i.next(); K key = e.getKey(); V value = e.getValue(); sb.append(key == this ? "(this Map)" : key); sb.append('='); sb.append(value == this ? "(this Map)" : value); if (!i.hasNext()) return sb.append('}').toString(); sb.append(',').append(' '); } } protected Object clone() throws CloneNotSupportedException { CompactAbstractMap result = (CompactAbstractMap) super.clone(); return result; } public static class SimpleEntry implements Entry, java.io.Serializable { @java.io.Serial private static final long serialVersionUID = -8499721149061103585L; @SuppressWarnings("serial") private final K key; @SuppressWarnings("serial") private V value; public SimpleEntry(K key, V value) { this.key = key; this.value = value; } public SimpleEntry(Entry entry) { this.key = entry.getKey(); this.value = entry.getValue(); } public K getKey() { return key; } public V getValue() { return value; } public V setValue(V value) { V oldValue = this.value; this.value = value; return oldValue; } public boolean equals(Object o) { if (!(o instanceof Map.Entry)) return false; Entry e = (Entry) o; return eq(key, e.getKey()) && eq(value, e.getValue()); } public int hashCode() { return (key == null ? 0 : key.hashCode()) ^ (value == null ? 0 : value.hashCode()); } public String toString() { return key + "=" + value; } } public static class SimpleImmutableEntry implements Entry, java.io.Serializable { @java.io.Serial private static final long serialVersionUID = 7138329143949025153L; @SuppressWarnings("serial") private final K key; @SuppressWarnings("serial") private final V value; public SimpleImmutableEntry(K key, V value) { this.key = key; this.value = value; } public SimpleImmutableEntry(Entry entry) { this.key = entry.getKey(); this.value = entry.getValue(); } public K getKey() { return key; } public V getValue() { return value; } public V setValue(V value) { throw new UnsupportedOperationException(); } public boolean equals(Object o) { if (!(o instanceof Map.Entry)) return false; Entry e = (Entry) o; return eq(key, e.getKey()) && eq(value, e.getValue()); } public int hashCode() { return (key == null ? 0 : key.hashCode()) ^ (value == null ? 0 : value.hashCode()); } public String toString() { return key + "=" + value; } } } static boolean scaffoldingEnabled(Object o) { return metaGet(o, "scaffolding") != null; } static Value value(A a) { return new Value(a); } static boolean containsKey(Map map, A key) { return map != null && map.containsKey(key); } static Map.Entry simpleMapEntry(A key, B value) { return new Map.Entry() { public A getKey() { return key; } public B getValue() { return value; } public B setValue(B newValue) { throw unimplemented(); } }; } static RuntimeException unimplemented() { throw fail("TODO"); } static RuntimeException unimplemented(String msg) { throw fail("TODO: " + msg); } static RuntimeException unimplemented(Object obj) { throw fail("TODO: implement method in " + className(obj)); } static class Value implements IF0 , IFieldsToList{ A value; Value() {} Value(A value) { this.value = value;} public boolean equals(Object o) { if (!(o instanceof Value)) return false; Value __1 = (Value) o; return eq(value, __1.value); } public int hashCode() { int h = 82420049; h = boostHashCombine(h, _hashCode(value)); return h; } public Object[] _fieldsToList() { return new Object[] {value}; } public A get() { return value; } public String toString() { return str(get()); } } }